mirror of
http://git.haproxy.org/git/haproxy.git/
synced 2025-04-17 20:45:40 +00:00
d7704b5343
This expiration flag is used to indicate that the timer has expired without having to check it everywhere.
6018 lines
180 KiB
C
6018 lines
180 KiB
C
/*
|
|
* HTTP protocol analyzer
|
|
*
|
|
* Copyright 2000-2008 Willy Tarreau <w@1wt.eu>
|
|
*
|
|
* This program is free software; you can redistribute it and/or
|
|
* modify it under the terms of the GNU General Public License
|
|
* as published by the Free Software Foundation; either version
|
|
* 2 of the License, or (at your option) any later version.
|
|
*
|
|
*/
|
|
|
|
#include <ctype.h>
|
|
#include <errno.h>
|
|
#include <fcntl.h>
|
|
#include <stdio.h>
|
|
#include <stdlib.h>
|
|
#include <string.h>
|
|
#include <syslog.h>
|
|
#include <time.h>
|
|
|
|
#include <sys/socket.h>
|
|
#include <sys/stat.h>
|
|
#include <sys/types.h>
|
|
|
|
#include <common/appsession.h>
|
|
#include <common/compat.h>
|
|
#include <common/config.h>
|
|
#include <common/debug.h>
|
|
#include <common/memory.h>
|
|
#include <common/mini-clist.h>
|
|
#include <common/standard.h>
|
|
#include <common/ticks.h>
|
|
#include <common/time.h>
|
|
#include <common/uri_auth.h>
|
|
#include <common/version.h>
|
|
|
|
#include <types/capture.h>
|
|
#include <types/global.h>
|
|
|
|
#include <proto/acl.h>
|
|
#include <proto/backend.h>
|
|
#include <proto/buffers.h>
|
|
#include <proto/dumpstats.h>
|
|
#include <proto/fd.h>
|
|
#include <proto/log.h>
|
|
#include <proto/hdr_idx.h>
|
|
#include <proto/proto_tcp.h>
|
|
#include <proto/proto_http.h>
|
|
#include <proto/queue.h>
|
|
#include <proto/senddata.h>
|
|
#include <proto/session.h>
|
|
#include <proto/stream_sock.h>
|
|
#include <proto/task.h>
|
|
|
|
#ifdef CONFIG_HAP_TCPSPLICE
|
|
#include <libtcpsplice.h>
|
|
#endif
|
|
|
|
#define DEBUG_PARSE_NO_SPEEDUP
|
|
#undef DEBUG_PARSE_NO_SPEEDUP
|
|
|
|
/* This is used to perform a quick jump as an alternative to a break/continue
|
|
* instruction. The first argument is the label for normal operation, and the
|
|
* second one is the break/continue instruction in the no_speedup mode.
|
|
*/
|
|
|
|
#ifdef DEBUG_PARSE_NO_SPEEDUP
|
|
#define QUICK_JUMP(x,y) y
|
|
#else
|
|
#define QUICK_JUMP(x,y) goto x
|
|
#endif
|
|
|
|
/* This is used by remote monitoring */
|
|
const char HTTP_200[] =
|
|
"HTTP/1.0 200 OK\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>200 OK</h1>\nHAProxy: service ready.\n</body></html>\n";
|
|
|
|
const struct chunk http_200_chunk = {
|
|
.str = (char *)&HTTP_200,
|
|
.len = sizeof(HTTP_200)-1
|
|
};
|
|
|
|
const char *HTTP_301 =
|
|
"HTTP/1.0 301 Moved Permantenly\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Location: "; /* not terminated since it will be concatenated with the URL */
|
|
|
|
const char *HTTP_302 =
|
|
"HTTP/1.0 302 Found\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Location: "; /* not terminated since it will be concatenated with the URL */
|
|
|
|
/* same as 302 except that the browser MUST retry with the GET method */
|
|
const char *HTTP_303 =
|
|
"HTTP/1.0 303 See Other\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Location: "; /* not terminated since it will be concatenated with the URL */
|
|
|
|
/* Warning: this one is an sprintf() fmt string, with <realm> as its only argument */
|
|
const char *HTTP_401_fmt =
|
|
"HTTP/1.0 401 Unauthorized\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"WWW-Authenticate: Basic realm=\"%s\"\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>401 Unauthorized</h1>\nYou need a valid user and password to access this content.\n</body></html>\n";
|
|
|
|
|
|
const int http_err_codes[HTTP_ERR_SIZE] = {
|
|
[HTTP_ERR_400] = 400,
|
|
[HTTP_ERR_403] = 403,
|
|
[HTTP_ERR_408] = 408,
|
|
[HTTP_ERR_500] = 500,
|
|
[HTTP_ERR_502] = 502,
|
|
[HTTP_ERR_503] = 503,
|
|
[HTTP_ERR_504] = 504,
|
|
};
|
|
|
|
static const char *http_err_msgs[HTTP_ERR_SIZE] = {
|
|
[HTTP_ERR_400] =
|
|
"HTTP/1.0 400 Bad request\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>400 Bad request</h1>\nYour browser sent an invalid request.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_403] =
|
|
"HTTP/1.0 403 Forbidden\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>403 Forbidden</h1>\nRequest forbidden by administrative rules.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_408] =
|
|
"HTTP/1.0 408 Request Time-out\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>408 Request Time-out</h1>\nYour browser didn't send a complete request in time.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_500] =
|
|
"HTTP/1.0 500 Server Error\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>500 Server Error</h1>\nAn internal server error occured.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_502] =
|
|
"HTTP/1.0 502 Bad Gateway\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>502 Bad Gateway</h1>\nThe server returned an invalid or incomplete response.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_503] =
|
|
"HTTP/1.0 503 Service Unavailable\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>503 Service Unavailable</h1>\nNo server is available to handle this request.\n</body></html>\n",
|
|
|
|
[HTTP_ERR_504] =
|
|
"HTTP/1.0 504 Gateway Time-out\r\n"
|
|
"Cache-Control: no-cache\r\n"
|
|
"Connection: close\r\n"
|
|
"Content-Type: text/html\r\n"
|
|
"\r\n"
|
|
"<html><body><h1>504 Gateway Time-out</h1>\nThe server didn't respond in time.\n</body></html>\n",
|
|
|
|
};
|
|
|
|
/* We must put the messages here since GCC cannot initialize consts depending
|
|
* on strlen().
|
|
*/
|
|
struct chunk http_err_chunks[HTTP_ERR_SIZE];
|
|
|
|
#define FD_SETS_ARE_BITFIELDS
|
|
#ifdef FD_SETS_ARE_BITFIELDS
|
|
/*
|
|
* This map is used with all the FD_* macros to check whether a particular bit
|
|
* is set or not. Each bit represents an ACSII code. FD_SET() sets those bytes
|
|
* which should be encoded. When FD_ISSET() returns non-zero, it means that the
|
|
* byte should be encoded. Be careful to always pass bytes from 0 to 255
|
|
* exclusively to the macros.
|
|
*/
|
|
fd_set hdr_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
|
|
fd_set url_encode_map[(sizeof(fd_set) > (256/8)) ? 1 : ((256/8) / sizeof(fd_set))];
|
|
|
|
#else
|
|
#error "Check if your OS uses bitfields for fd_sets"
|
|
#endif
|
|
|
|
void init_proto_http()
|
|
{
|
|
int i;
|
|
char *tmp;
|
|
int msg;
|
|
|
|
for (msg = 0; msg < HTTP_ERR_SIZE; msg++) {
|
|
if (!http_err_msgs[msg]) {
|
|
Alert("Internal error: no message defined for HTTP return code %d. Aborting.\n", msg);
|
|
abort();
|
|
}
|
|
|
|
http_err_chunks[msg].str = (char *)http_err_msgs[msg];
|
|
http_err_chunks[msg].len = strlen(http_err_msgs[msg]);
|
|
}
|
|
|
|
/* initialize the log header encoding map : '{|}"#' should be encoded with
|
|
* '#' as prefix, as well as non-printable characters ( <32 or >= 127 ).
|
|
* URL encoding only requires '"', '#' to be encoded as well as non-
|
|
* printable characters above.
|
|
*/
|
|
memset(hdr_encode_map, 0, sizeof(hdr_encode_map));
|
|
memset(url_encode_map, 0, sizeof(url_encode_map));
|
|
for (i = 0; i < 32; i++) {
|
|
FD_SET(i, hdr_encode_map);
|
|
FD_SET(i, url_encode_map);
|
|
}
|
|
for (i = 127; i < 256; i++) {
|
|
FD_SET(i, hdr_encode_map);
|
|
FD_SET(i, url_encode_map);
|
|
}
|
|
|
|
tmp = "\"#{|}";
|
|
while (*tmp) {
|
|
FD_SET(*tmp, hdr_encode_map);
|
|
tmp++;
|
|
}
|
|
|
|
tmp = "\"#";
|
|
while (*tmp) {
|
|
FD_SET(*tmp, url_encode_map);
|
|
tmp++;
|
|
}
|
|
|
|
/* memory allocations */
|
|
pool2_requri = create_pool("requri", REQURI_LEN, MEM_F_SHARED);
|
|
pool2_capture = create_pool("capture", CAPTURE_LEN, MEM_F_SHARED);
|
|
}
|
|
|
|
/*
|
|
* We have 26 list of methods (1 per first letter), each of which can have
|
|
* up to 3 entries (2 valid, 1 null).
|
|
*/
|
|
struct http_method_desc {
|
|
http_meth_t meth;
|
|
int len;
|
|
const char text[8];
|
|
};
|
|
|
|
const struct http_method_desc http_methods[26][3] = {
|
|
['C' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_CONNECT , .len=7, .text="CONNECT" },
|
|
},
|
|
['D' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_DELETE , .len=6, .text="DELETE" },
|
|
},
|
|
['G' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_GET , .len=3, .text="GET" },
|
|
},
|
|
['H' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_HEAD , .len=4, .text="HEAD" },
|
|
},
|
|
['P' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_POST , .len=4, .text="POST" },
|
|
[1] = { .meth = HTTP_METH_PUT , .len=3, .text="PUT" },
|
|
},
|
|
['T' - 'A'] = {
|
|
[0] = { .meth = HTTP_METH_TRACE , .len=5, .text="TRACE" },
|
|
},
|
|
/* rest is empty like this :
|
|
* [1] = { .meth = HTTP_METH_NONE , .len=0, .text="" },
|
|
*/
|
|
};
|
|
|
|
/* It is about twice as fast on recent architectures to lookup a byte in a
|
|
* table than to perform a boolean AND or OR between two tests. Refer to
|
|
* RFC2616 for those chars.
|
|
*/
|
|
|
|
const char http_is_spht[256] = {
|
|
[' '] = 1, ['\t'] = 1,
|
|
};
|
|
|
|
const char http_is_crlf[256] = {
|
|
['\r'] = 1, ['\n'] = 1,
|
|
};
|
|
|
|
const char http_is_lws[256] = {
|
|
[' '] = 1, ['\t'] = 1,
|
|
['\r'] = 1, ['\n'] = 1,
|
|
};
|
|
|
|
const char http_is_sep[256] = {
|
|
['('] = 1, [')'] = 1, ['<'] = 1, ['>'] = 1,
|
|
['@'] = 1, [','] = 1, [';'] = 1, [':'] = 1,
|
|
['"'] = 1, ['/'] = 1, ['['] = 1, [']'] = 1,
|
|
['{'] = 1, ['}'] = 1, ['?'] = 1, ['='] = 1,
|
|
[' '] = 1, ['\t'] = 1, ['\\'] = 1,
|
|
};
|
|
|
|
const char http_is_ctl[256] = {
|
|
[0 ... 31] = 1,
|
|
[127] = 1,
|
|
};
|
|
|
|
/*
|
|
* A token is any ASCII char that is neither a separator nor a CTL char.
|
|
* Do not overwrite values in assignment since gcc-2.95 will not handle
|
|
* them correctly. Instead, define every non-CTL char's status.
|
|
*/
|
|
const char http_is_token[256] = {
|
|
[' '] = 0, ['!'] = 1, ['"'] = 0, ['#'] = 1,
|
|
['$'] = 1, ['%'] = 1, ['&'] = 1, ['\''] = 1,
|
|
['('] = 0, [')'] = 0, ['*'] = 1, ['+'] = 1,
|
|
[','] = 0, ['-'] = 1, ['.'] = 1, ['/'] = 0,
|
|
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1,
|
|
['4'] = 1, ['5'] = 1, ['6'] = 1, ['7'] = 1,
|
|
['8'] = 1, ['9'] = 1, [':'] = 0, [';'] = 0,
|
|
['<'] = 0, ['='] = 0, ['>'] = 0, ['?'] = 0,
|
|
['@'] = 0, ['A'] = 1, ['B'] = 1, ['C'] = 1,
|
|
['D'] = 1, ['E'] = 1, ['F'] = 1, ['G'] = 1,
|
|
['H'] = 1, ['I'] = 1, ['J'] = 1, ['K'] = 1,
|
|
['L'] = 1, ['M'] = 1, ['N'] = 1, ['O'] = 1,
|
|
['P'] = 1, ['Q'] = 1, ['R'] = 1, ['S'] = 1,
|
|
['T'] = 1, ['U'] = 1, ['V'] = 1, ['W'] = 1,
|
|
['X'] = 1, ['Y'] = 1, ['Z'] = 1, ['['] = 0,
|
|
['\\'] = 0, [']'] = 0, ['^'] = 1, ['_'] = 1,
|
|
['`'] = 1, ['a'] = 1, ['b'] = 1, ['c'] = 1,
|
|
['d'] = 1, ['e'] = 1, ['f'] = 1, ['g'] = 1,
|
|
['h'] = 1, ['i'] = 1, ['j'] = 1, ['k'] = 1,
|
|
['l'] = 1, ['m'] = 1, ['n'] = 1, ['o'] = 1,
|
|
['p'] = 1, ['q'] = 1, ['r'] = 1, ['s'] = 1,
|
|
['t'] = 1, ['u'] = 1, ['v'] = 1, ['w'] = 1,
|
|
['x'] = 1, ['y'] = 1, ['z'] = 1, ['{'] = 0,
|
|
['|'] = 1, ['}'] = 0, ['~'] = 1,
|
|
};
|
|
|
|
|
|
/*
|
|
* An http ver_token is any ASCII which can be found in an HTTP version,
|
|
* which includes 'H', 'T', 'P', '/', '.' and any digit.
|
|
*/
|
|
const char http_is_ver_token[256] = {
|
|
['.'] = 1, ['/'] = 1,
|
|
['0'] = 1, ['1'] = 1, ['2'] = 1, ['3'] = 1, ['4'] = 1,
|
|
['5'] = 1, ['6'] = 1, ['7'] = 1, ['8'] = 1, ['9'] = 1,
|
|
['H'] = 1, ['P'] = 1, ['T'] = 1,
|
|
};
|
|
|
|
|
|
#ifdef DEBUG_FULL
|
|
static char *cli_stnames[4] = { "DAT", "SHR", "SHW", "CLS" };
|
|
#endif
|
|
|
|
static void http_sess_log(struct session *s);
|
|
|
|
/*
|
|
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
|
|
* CRLF. Text length is measured first, so it cannot be NULL.
|
|
* The header is also automatically added to the index <hdr_idx>, and the end
|
|
* of headers is automatically adjusted. The number of bytes added is returned
|
|
* on success, otherwise <0 is returned indicating an error.
|
|
*/
|
|
int http_header_add_tail(struct buffer *b, struct http_msg *msg,
|
|
struct hdr_idx *hdr_idx, const char *text)
|
|
{
|
|
int bytes, len;
|
|
|
|
len = strlen(text);
|
|
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
|
|
if (!bytes)
|
|
return -1;
|
|
msg->eoh += bytes;
|
|
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
|
|
}
|
|
|
|
/*
|
|
* Adds a header and its CRLF at the tail of buffer <b>, just before the last
|
|
* CRLF. <len> bytes are copied, not counting the CRLF. If <text> is NULL, then
|
|
* the buffer is only opened and the space reserved, but nothing is copied.
|
|
* The header is also automatically added to the index <hdr_idx>, and the end
|
|
* of headers is automatically adjusted. The number of bytes added is returned
|
|
* on success, otherwise <0 is returned indicating an error.
|
|
*/
|
|
int http_header_add_tail2(struct buffer *b, struct http_msg *msg,
|
|
struct hdr_idx *hdr_idx, const char *text, int len)
|
|
{
|
|
int bytes;
|
|
|
|
bytes = buffer_insert_line2(b, b->data + msg->eoh, text, len);
|
|
if (!bytes)
|
|
return -1;
|
|
msg->eoh += bytes;
|
|
return hdr_idx_add(len, 1, hdr_idx, hdr_idx->tail);
|
|
}
|
|
|
|
/*
|
|
* Checks if <hdr> is exactly <name> for <len> chars, and ends with a colon.
|
|
* If so, returns the position of the first non-space character relative to
|
|
* <hdr>, or <end>-<hdr> if not found before. If no value is found, it tries
|
|
* to return a pointer to the place after the first space. Returns 0 if the
|
|
* header name does not match. Checks are case-insensitive.
|
|
*/
|
|
int http_header_match2(const char *hdr, const char *end,
|
|
const char *name, int len)
|
|
{
|
|
const char *val;
|
|
|
|
if (hdr + len >= end)
|
|
return 0;
|
|
if (hdr[len] != ':')
|
|
return 0;
|
|
if (strncasecmp(hdr, name, len) != 0)
|
|
return 0;
|
|
val = hdr + len + 1;
|
|
while (val < end && HTTP_IS_SPHT(*val))
|
|
val++;
|
|
if ((val >= end) && (len + 2 <= end - hdr))
|
|
return len + 2; /* we may replace starting from second space */
|
|
return val - hdr;
|
|
}
|
|
|
|
/* Find the end of the header value contained between <s> and <e>.
|
|
* See RFC2616, par 2.2 for more information. Note that it requires
|
|
* a valid header to return a valid result.
|
|
*/
|
|
const char *find_hdr_value_end(const char *s, const char *e)
|
|
{
|
|
int quoted, qdpair;
|
|
|
|
quoted = qdpair = 0;
|
|
for (; s < e; s++) {
|
|
if (qdpair) qdpair = 0;
|
|
else if (quoted && *s == '\\') qdpair = 1;
|
|
else if (quoted && *s == '"') quoted = 0;
|
|
else if (*s == '"') quoted = 1;
|
|
else if (*s == ',') return s;
|
|
}
|
|
return s;
|
|
}
|
|
|
|
/* Find the first or next occurrence of header <name> in message buffer <sol>
|
|
* using headers index <idx>, and return it in the <ctx> structure. This
|
|
* structure holds everything necessary to use the header and find next
|
|
* occurrence. If its <idx> member is 0, the header is searched from the
|
|
* beginning. Otherwise, the next occurrence is returned. The function returns
|
|
* 1 when it finds a value, and 0 when there is no more.
|
|
*/
|
|
int http_find_header2(const char *name, int len,
|
|
const char *sol, struct hdr_idx *idx,
|
|
struct hdr_ctx *ctx)
|
|
{
|
|
__label__ return_hdr, next_hdr;
|
|
const char *eol, *sov;
|
|
int cur_idx;
|
|
|
|
if (ctx->idx) {
|
|
/* We have previously returned a value, let's search
|
|
* another one on the same line.
|
|
*/
|
|
cur_idx = ctx->idx;
|
|
sol = ctx->line;
|
|
sov = sol + ctx->val + ctx->vlen;
|
|
eol = sol + idx->v[cur_idx].len;
|
|
|
|
if (sov >= eol)
|
|
/* no more values in this header */
|
|
goto next_hdr;
|
|
|
|
/* values remaining for this header, skip the comma */
|
|
sov++;
|
|
while (sov < eol && http_is_lws[(unsigned char)*sov])
|
|
sov++;
|
|
|
|
goto return_hdr;
|
|
}
|
|
|
|
/* first request for this header */
|
|
sol += hdr_idx_first_pos(idx);
|
|
cur_idx = hdr_idx_first_idx(idx);
|
|
|
|
while (cur_idx) {
|
|
eol = sol + idx->v[cur_idx].len;
|
|
|
|
if (len == 0) {
|
|
/* No argument was passed, we want any header.
|
|
* To achieve this, we simply build a fake request. */
|
|
while (sol + len < eol && sol[len] != ':')
|
|
len++;
|
|
name = sol;
|
|
}
|
|
|
|
if ((len < eol - sol) &&
|
|
(sol[len] == ':') &&
|
|
(strncasecmp(sol, name, len) == 0)) {
|
|
|
|
sov = sol + len + 1;
|
|
while (sov < eol && http_is_lws[(unsigned char)*sov])
|
|
sov++;
|
|
return_hdr:
|
|
ctx->line = sol;
|
|
ctx->idx = cur_idx;
|
|
ctx->val = sov - sol;
|
|
|
|
eol = find_hdr_value_end(sov, eol);
|
|
ctx->vlen = eol - sov;
|
|
return 1;
|
|
}
|
|
next_hdr:
|
|
sol = eol + idx->v[cur_idx].cr + 1;
|
|
cur_idx = idx->v[cur_idx].next;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
int http_find_header(const char *name,
|
|
const char *sol, struct hdr_idx *idx,
|
|
struct hdr_ctx *ctx)
|
|
{
|
|
return http_find_header2(name, strlen(name), sol, idx, ctx);
|
|
}
|
|
|
|
/* This function shuts down the buffers on the server side, and sets indicators
|
|
* accordingly. The server's fd is supposed to already be closed. Note that if
|
|
* <status> is 0, or if the message pointer is NULL, then no message is returned.
|
|
*/
|
|
void srv_close_with_err(struct session *t, int err, int finst,
|
|
int status, const struct chunk *msg)
|
|
{
|
|
buffer_write_ena(t->rep);
|
|
buffer_shutw(t->req);
|
|
buffer_shutr(t->rep);
|
|
if (status > 0 && msg) {
|
|
t->txn.status = status;
|
|
if (t->fe->mode == PR_MODE_HTTP)
|
|
client_return(t, msg);
|
|
}
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= err;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= finst;
|
|
}
|
|
|
|
/* This function returns the appropriate error location for the given session
|
|
* and message.
|
|
*/
|
|
|
|
struct chunk *error_message(struct session *s, int msgnum)
|
|
{
|
|
if (s->be->errmsg[msgnum].str)
|
|
return &s->be->errmsg[msgnum];
|
|
else if (s->fe->errmsg[msgnum].str)
|
|
return &s->fe->errmsg[msgnum];
|
|
else
|
|
return &http_err_chunks[msgnum];
|
|
}
|
|
|
|
/*
|
|
* returns HTTP_METH_NONE if there is nothing valid to read (empty or non-text
|
|
* string), HTTP_METH_OTHER for unknown methods, or the identified method.
|
|
*/
|
|
static http_meth_t find_http_meth(const char *str, const int len)
|
|
{
|
|
unsigned char m;
|
|
const struct http_method_desc *h;
|
|
|
|
m = ((unsigned)*str - 'A');
|
|
|
|
if (m < 26) {
|
|
for (h = http_methods[m]; h->len > 0; h++) {
|
|
if (unlikely(h->len != len))
|
|
continue;
|
|
if (likely(memcmp(str, h->text, h->len) == 0))
|
|
return h->meth;
|
|
};
|
|
return HTTP_METH_OTHER;
|
|
}
|
|
return HTTP_METH_NONE;
|
|
|
|
}
|
|
|
|
/* Parse the URI from the given transaction (which is assumed to be in request
|
|
* phase) and look for the "/" beginning the PATH. If not found, return NULL.
|
|
* It is returned otherwise.
|
|
*/
|
|
static char *
|
|
http_get_path(struct http_txn *txn)
|
|
{
|
|
char *ptr, *end;
|
|
|
|
ptr = txn->req.sol + txn->req.sl.rq.u;
|
|
end = ptr + txn->req.sl.rq.u_l;
|
|
|
|
if (ptr >= end)
|
|
return NULL;
|
|
|
|
/* RFC2616, par. 5.1.2 :
|
|
* Request-URI = "*" | absuri | abspath | authority
|
|
*/
|
|
|
|
if (*ptr == '*')
|
|
return NULL;
|
|
|
|
if (isalpha((unsigned char)*ptr)) {
|
|
/* this is a scheme as described by RFC3986, par. 3.1 */
|
|
ptr++;
|
|
while (ptr < end &&
|
|
(isalnum((unsigned char)*ptr) || *ptr == '+' || *ptr == '-' || *ptr == '.'))
|
|
ptr++;
|
|
/* skip '://' */
|
|
if (ptr == end || *ptr++ != ':')
|
|
return NULL;
|
|
if (ptr == end || *ptr++ != '/')
|
|
return NULL;
|
|
if (ptr == end || *ptr++ != '/')
|
|
return NULL;
|
|
}
|
|
/* skip [user[:passwd]@]host[:[port]] */
|
|
|
|
while (ptr < end && *ptr != '/')
|
|
ptr++;
|
|
|
|
if (ptr == end)
|
|
return NULL;
|
|
|
|
/* OK, we got the '/' ! */
|
|
return ptr;
|
|
}
|
|
|
|
/* Processes the client, server, request and response jobs of a session task,
|
|
* then puts it back to the wait queue in a clean state, or cleans up its
|
|
* resources if it must be deleted. Returns in <next> the date the task wants
|
|
* to be woken up, or TICK_ETERNITY. In order not to call all functions for
|
|
* nothing too many times, the request and response buffers flags are monitored
|
|
* and each function is called only if at least another function has changed at
|
|
* least one flag it is interested in.
|
|
*/
|
|
void process_session(struct task *t, int *next)
|
|
{
|
|
struct session *s = t->context;
|
|
int resync;
|
|
unsigned int rqf_cli, rpf_cli;
|
|
unsigned int rqf_srv, rpf_srv;
|
|
|
|
/* 1: Check timeouts only during data phase for now */
|
|
if (unlikely(t->state & TASK_WOKEN_TIMER)) {
|
|
buffer_check_timeouts(s->req);
|
|
buffer_check_timeouts(s->rep);
|
|
stream_sock_check_timeouts(&s->si[0]);
|
|
stream_sock_check_timeouts(&s->si[1]);
|
|
|
|
if (unlikely(s->req->flags & (BF_READ_TIMEOUT|BF_WRITE_TIMEOUT))) {
|
|
if (s->req->flags & BF_READ_TIMEOUT) {
|
|
buffer_shutw(s->req);
|
|
s->req->cons->shutr(s->req->prod);
|
|
}
|
|
if (s->req->flags & BF_WRITE_TIMEOUT) {
|
|
buffer_shutw(s->req);
|
|
s->req->cons->shutw(s->req->cons);
|
|
}
|
|
}
|
|
|
|
if (unlikely(s->rep->flags & (BF_READ_TIMEOUT|BF_WRITE_TIMEOUT))) {
|
|
if (s->rep->flags & BF_READ_TIMEOUT) {
|
|
buffer_shutw(s->rep);
|
|
s->rep->cons->shutr(s->rep->prod);
|
|
}
|
|
if (s->rep->flags & BF_WRITE_TIMEOUT) {
|
|
buffer_shutw(s->rep);
|
|
s->rep->cons->shutw(s->rep->cons);
|
|
}
|
|
}
|
|
/* Note that we don't check nor indicate if we wake up because
|
|
* of a timeout on a stream interface.
|
|
*/
|
|
}
|
|
|
|
/* 2: Check if we need to close the write side. This can only happen
|
|
* when either SHUTR or EMPTY appears, because WRITE_ENA cannot appear
|
|
* from low level, and neither HIJACK nor SHUTW can disappear from low
|
|
* level.
|
|
*/
|
|
if (unlikely((s->req->flags & (BF_SHUTW|BF_EMPTY|BF_HIJACK|BF_WRITE_ENA|BF_SHUTR)) == (BF_EMPTY|BF_WRITE_ENA|BF_SHUTR))) {
|
|
buffer_shutw(s->req);
|
|
s->req->cons->shutw(s->req->cons);
|
|
}
|
|
|
|
if (unlikely((s->rep->flags & (BF_SHUTW|BF_EMPTY|BF_HIJACK|BF_WRITE_ENA|BF_SHUTR)) == (BF_EMPTY|BF_WRITE_ENA|BF_SHUTR))) {
|
|
buffer_shutw(s->rep);
|
|
s->rep->cons->shutw(s->rep->cons);
|
|
}
|
|
|
|
/* 3: When a server-side connection is released, we have to
|
|
* count it and check for pending connections on this server.
|
|
*/
|
|
if (unlikely(s->req->cons->state == SI_ST_CLO &&
|
|
s->req->cons->prev_state == SI_ST_EST)) {
|
|
/* Count server-side errors (but not timeouts). */
|
|
if (s->req->flags & BF_WRITE_ERROR) {
|
|
s->be->failed_resp++;
|
|
if (s->srv)
|
|
s->srv->failed_resp++;
|
|
}
|
|
|
|
if (s->srv) {
|
|
s->srv->cur_sess--;
|
|
sess_change_server(s, NULL);
|
|
if (may_dequeue_tasks(s->srv, s->be))
|
|
process_srv_queue(s->srv);
|
|
}
|
|
}
|
|
|
|
/* Dirty trick: force one first pass everywhere */
|
|
rqf_cli = rqf_srv = ~s->req->flags;
|
|
rpf_cli = rpf_srv = ~s->rep->flags;
|
|
|
|
/* well, the ST_CONN state is already handled properly */
|
|
if (s->req->prod->state == SI_ST_EST) {
|
|
rqf_cli = s->req->flags;
|
|
rpf_cli = s->rep->flags;
|
|
}
|
|
|
|
if (s->req->cons->state == SI_ST_EST) {
|
|
rqf_srv = s->req->flags;
|
|
rpf_srv = s->rep->flags;
|
|
}
|
|
|
|
do {
|
|
DPRINTF(stderr,"[%u] %s: task=%p rq=%p, rp=%p, exp(r,w)=%u,%u rqf=%08x rpf=%08x rql=%d rpl=%d cs=%d ss=%d\n",
|
|
now_ms, __FUNCTION__,
|
|
t,
|
|
s->req, s->rep,
|
|
s->req->rex, s->rep->wex,
|
|
s->req->flags, s->rep->flags,
|
|
s->req->l, s->rep->l, s->rep->cons->state, s->req->cons->state);
|
|
|
|
resync = 0;
|
|
|
|
/* Maybe resync client FD state */
|
|
if (s->rep->cons->state != SI_ST_CLO) {
|
|
if (((rqf_cli ^ s->req->flags) & BF_MASK_INTERFACE_I) ||
|
|
((rpf_cli ^ s->rep->flags) & BF_MASK_INTERFACE_O)) {
|
|
stream_sock_data_update(s->rep->cons->fd);
|
|
rqf_cli = s->req->flags;
|
|
rpf_cli = s->rep->flags;
|
|
}
|
|
}
|
|
|
|
/* Maybe resync server FD state */
|
|
if (s->req->cons->state != SI_ST_CLO) {
|
|
if (((rpf_srv ^ s->rep->flags) & BF_MASK_INTERFACE_I) ||
|
|
((rqf_srv ^ s->req->flags) & BF_MASK_INTERFACE_O)) {
|
|
if (s->req->cons->state < SI_ST_EST && s->req->flags & BF_WRITE_ENA) {
|
|
process_srv_conn(s);
|
|
resync = 1; /* we might have to resync */
|
|
}
|
|
|
|
if (s->req->cons->state == SI_ST_EST) {
|
|
if ((s->req->flags & (BF_SHUTW|BF_EMPTY|BF_WRITE_ENA)) == (BF_EMPTY|BF_WRITE_ENA) &&
|
|
s->be->options & PR_O_FORCE_CLO &&
|
|
s->rep->flags & BF_READ_ACTIVITY) {
|
|
/* We want to force the connection to the server to close,
|
|
* and the server has begun to respond. That's the right
|
|
* time.
|
|
*/
|
|
buffer_shutw_now(s->req);
|
|
}
|
|
|
|
stream_sock_data_update(s->req->cons->fd);
|
|
|
|
/* When a server-side connection is released, we have to
|
|
* count it and check for pending connections on this server.
|
|
*/
|
|
if (s->req->cons->state == SI_ST_CLO) {
|
|
if (s->srv) {
|
|
s->srv->cur_sess--;
|
|
sess_change_server(s, NULL);
|
|
if (may_dequeue_tasks(s->srv, s->be))
|
|
process_srv_queue(s->srv);
|
|
}
|
|
}
|
|
}
|
|
rqf_srv = s->req->flags;
|
|
rpf_srv = s->rep->flags;
|
|
}
|
|
}
|
|
|
|
/* we may have to resync because of pending connections */
|
|
if (resync)
|
|
continue;
|
|
|
|
/**** Process layer 7 below ****/
|
|
|
|
/* Analyse request */
|
|
if (s->req->flags & BF_MASK_ANALYSER) {
|
|
unsigned int flags = s->req->flags;
|
|
|
|
if (s->req->prod->state >= SI_ST_EST) {
|
|
/* it's up to the analysers to reset write_ena */
|
|
buffer_write_ena(s->req);
|
|
if (s->req->analysers)
|
|
process_request(s);
|
|
}
|
|
s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
if (s->req->flags != flags)
|
|
resync = 1;
|
|
}
|
|
|
|
/* Analyse response */
|
|
if (unlikely(s->rep->flags & BF_HIJACK)) {
|
|
/* In inject mode, we wake up everytime something has
|
|
* happened on the write side of the buffer.
|
|
*/
|
|
unsigned int flags = s->rep->flags;
|
|
|
|
if ((s->rep->flags & (BF_WRITE_PARTIAL|BF_WRITE_ERROR|BF_SHUTW)) &&
|
|
!(s->rep->flags & BF_FULL)) {
|
|
produce_content(s);
|
|
}
|
|
s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
if (s->rep->flags != flags)
|
|
resync = 1;
|
|
}
|
|
else if (s->rep->flags & BF_MASK_ANALYSER) {
|
|
unsigned int flags = s->rep->flags;
|
|
|
|
if (s->rep->prod->state >= SI_ST_EST) {
|
|
/* it's up to the analysers to reset write_ena */
|
|
buffer_write_ena(s->rep);
|
|
if (s->rep->analysers)
|
|
process_response(s);
|
|
}
|
|
s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
if (s->rep->flags != flags)
|
|
resync = 1;
|
|
}
|
|
|
|
/* For the moment, we need to clean the client and server flags that
|
|
* have vanished. This is just a temporary measure though.
|
|
*/
|
|
rqf_cli &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
rqf_srv &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
rpf_cli &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
rpf_srv &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
} while (resync);
|
|
|
|
/* This is needed only when debugging is enabled, to indicate
|
|
* client-side or server-side close. Please note that in the unlikely
|
|
* event where both sides would close at once, the sequence is reported
|
|
* on the server side first.
|
|
*/
|
|
if (unlikely((global.mode & MODE_DEBUG) &&
|
|
(!(global.mode & MODE_QUIET) ||
|
|
(global.mode & MODE_VERBOSE)))) {
|
|
int len;
|
|
|
|
if (s->si[1].state == SI_ST_CLO &&
|
|
s->si[1].prev_state == SI_ST_EST) {
|
|
len = sprintf(trash, "%08x:%s.srvcls[%04x:%04x]\n",
|
|
s->uniq_id, s->be->id,
|
|
(unsigned short)s->si[0].fd,
|
|
(unsigned short)s->si[1].fd);
|
|
write(1, trash, len);
|
|
}
|
|
|
|
if (s->si[0].state == SI_ST_CLO &&
|
|
s->si[0].prev_state == SI_ST_EST) {
|
|
len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n",
|
|
s->uniq_id, s->be->id,
|
|
(unsigned short)s->si[0].fd,
|
|
(unsigned short)s->si[1].fd);
|
|
write(1, trash, len);
|
|
}
|
|
}
|
|
|
|
if (likely((s->rep->cons->state != SI_ST_CLO) ||
|
|
(s->req->cons->state != SI_ST_CLO && s->req->cons->state != SI_ST_INI))) {
|
|
|
|
if ((s->fe->options & PR_O_CONTSTATS) && (s->flags & SN_BE_ASSIGNED))
|
|
session_process_counters(s);
|
|
|
|
if (s->rep->cons->state == SI_ST_EST)
|
|
stream_sock_data_finish(s->rep->cons->fd);
|
|
|
|
if (s->req->cons->state == SI_ST_EST)
|
|
stream_sock_data_finish(s->req->cons->fd);
|
|
|
|
s->req->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
s->rep->flags &= BF_CLEAR_READ & BF_CLEAR_WRITE & BF_CLEAR_TIMEOUT;
|
|
s->si[0].prev_state = s->si[0].state;
|
|
s->si[1].prev_state = s->si[1].state;
|
|
s->si[0].flags = s->si[1].flags = 0;
|
|
|
|
/* Trick: if a request is being waiting for the server to respond,
|
|
* and if we know the server can timeout, we don't want the timeout
|
|
* to expire on the client side first, but we're still interested
|
|
* in passing data from the client to the server (eg: POST). Thus,
|
|
* we can cancel the client's request timeout if the server's
|
|
* request timeout is set and the server has not yet sent a response.
|
|
*/
|
|
|
|
if ((s->rep->flags & (BF_WRITE_ENA|BF_SHUTR)) == 0 &&
|
|
(tick_isset(s->req->wex) || tick_isset(s->rep->rex)))
|
|
s->req->rex = TICK_ETERNITY;
|
|
|
|
t->expire = tick_first(tick_first(s->req->rex, s->req->wex),
|
|
tick_first(s->rep->rex, s->rep->wex));
|
|
if (s->req->analysers)
|
|
t->expire = tick_first(t->expire, s->req->analyse_exp);
|
|
|
|
if (s->si[0].exp)
|
|
t->expire = tick_first(t->expire, s->si[0].exp);
|
|
|
|
if (s->si[1].exp)
|
|
t->expire = tick_first(t->expire, s->si[1].exp);
|
|
|
|
#ifdef DEBUG_FULL
|
|
fprintf(stderr, "[%u] queuing with exp=%u req->rex=%u req->wex=%u req->ana_exp=%u rep->rex=%u rep->wex=%u\n",
|
|
now_ms, t->expire, s->req->rex, s->req->wex, s->req->analyse_exp, s->rep->rex, s->rep->wex);
|
|
#endif
|
|
/* restore t to its place in the task list */
|
|
task_queue(t);
|
|
|
|
#ifdef DEBUG_DEV
|
|
/* this may only happen when no timeout is set or in case of an FSM bug */
|
|
if (!t->expire)
|
|
ABORT_NOW();
|
|
#endif
|
|
*next = t->expire;
|
|
return; /* nothing more to do */
|
|
}
|
|
|
|
s->fe->feconn--;
|
|
if (s->flags & SN_BE_ASSIGNED)
|
|
s->be->beconn--;
|
|
actconn--;
|
|
|
|
if (unlikely((global.mode & MODE_DEBUG) &&
|
|
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)))) {
|
|
int len;
|
|
len = sprintf(trash, "%08x:%s.closed[%04x:%04x] (term_trace=0x%08x)\n",
|
|
s->uniq_id, s->be->id,
|
|
(unsigned short)s->req->prod->fd, (unsigned short)s->req->cons->fd,
|
|
s->term_trace);
|
|
write(1, trash, len);
|
|
}
|
|
|
|
s->logs.t_close = tv_ms_elapsed(&s->logs.tv_accept, &now);
|
|
session_process_counters(s);
|
|
|
|
/* let's do a final log if we need it */
|
|
if (s->logs.logwait &&
|
|
!(s->flags & SN_MONITOR) &&
|
|
(!(s->fe->options & PR_O_NULLNOLOG) || s->req->total)) {
|
|
if (s->fe->to_log & LW_REQ)
|
|
http_sess_log(s);
|
|
else
|
|
tcp_sess_log(s);
|
|
}
|
|
|
|
/* the task MUST not be in the run queue anymore */
|
|
task_delete(t);
|
|
session_free(s);
|
|
task_free(t);
|
|
*next = TICK_ETERNITY;
|
|
}
|
|
|
|
|
|
extern const char sess_term_cond[8];
|
|
extern const char sess_fin_state[8];
|
|
extern const char *monthname[12];
|
|
const char sess_cookie[4] = "NIDV"; /* No cookie, Invalid cookie, cookie for a Down server, Valid cookie */
|
|
const char sess_set_cookie[8] = "N1I3PD5R"; /* No set-cookie, unknown, Set-Cookie Inserted, unknown,
|
|
Set-cookie seen and left unchanged (passive), Set-cookie Deleted,
|
|
unknown, Set-cookie Rewritten */
|
|
struct pool_head *pool2_requri;
|
|
struct pool_head *pool2_capture;
|
|
|
|
/*
|
|
* send a log for the session when we have enough info about it.
|
|
* Will not log if the frontend has no log defined.
|
|
*/
|
|
static void http_sess_log(struct session *s)
|
|
{
|
|
char pn[INET6_ADDRSTRLEN + strlen(":65535")];
|
|
struct proxy *fe = s->fe;
|
|
struct proxy *be = s->be;
|
|
struct proxy *prx_log;
|
|
struct http_txn *txn = &s->txn;
|
|
int tolog;
|
|
char *uri, *h;
|
|
char *svid;
|
|
struct tm tm;
|
|
static char tmpline[MAX_SYSLOG_LEN];
|
|
int t_request;
|
|
int hdr;
|
|
|
|
if (fe->logfac1 < 0 && fe->logfac2 < 0)
|
|
return;
|
|
prx_log = fe;
|
|
|
|
if (s->cli_addr.ss_family == AF_INET)
|
|
inet_ntop(AF_INET,
|
|
(const void *)&((struct sockaddr_in *)&s->cli_addr)->sin_addr,
|
|
pn, sizeof(pn));
|
|
else
|
|
inet_ntop(AF_INET6,
|
|
(const void *)&((struct sockaddr_in6 *)(&s->cli_addr))->sin6_addr,
|
|
pn, sizeof(pn));
|
|
|
|
get_localtime(s->logs.accept_date.tv_sec, &tm);
|
|
|
|
/* FIXME: let's limit ourselves to frontend logging for now. */
|
|
tolog = fe->to_log;
|
|
|
|
h = tmpline;
|
|
if (fe->to_log & LW_REQHDR &&
|
|
txn->req.cap &&
|
|
(h < tmpline + sizeof(tmpline) - 10)) {
|
|
*(h++) = ' ';
|
|
*(h++) = '{';
|
|
for (hdr = 0; hdr < fe->nb_req_cap; hdr++) {
|
|
if (hdr)
|
|
*(h++) = '|';
|
|
if (txn->req.cap[hdr] != NULL)
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 7,
|
|
'#', hdr_encode_map, txn->req.cap[hdr]);
|
|
}
|
|
*(h++) = '}';
|
|
}
|
|
|
|
if (fe->to_log & LW_RSPHDR &&
|
|
txn->rsp.cap &&
|
|
(h < tmpline + sizeof(tmpline) - 7)) {
|
|
*(h++) = ' ';
|
|
*(h++) = '{';
|
|
for (hdr = 0; hdr < fe->nb_rsp_cap; hdr++) {
|
|
if (hdr)
|
|
*(h++) = '|';
|
|
if (txn->rsp.cap[hdr] != NULL)
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 4,
|
|
'#', hdr_encode_map, txn->rsp.cap[hdr]);
|
|
}
|
|
*(h++) = '}';
|
|
}
|
|
|
|
if (h < tmpline + sizeof(tmpline) - 4) {
|
|
*(h++) = ' ';
|
|
*(h++) = '"';
|
|
uri = txn->uri ? txn->uri : "<BADREQ>";
|
|
h = encode_string(h, tmpline + sizeof(tmpline) - 1,
|
|
'#', url_encode_map, uri);
|
|
*(h++) = '"';
|
|
}
|
|
*h = '\0';
|
|
|
|
svid = (tolog & LW_SVID) ?
|
|
(s->data_source != DATA_SRC_STATS) ?
|
|
(s->srv != NULL) ? s->srv->id : "<NOSRV>" : "<STATS>" : "-";
|
|
|
|
t_request = -1;
|
|
if (tv_isge(&s->logs.tv_request, &s->logs.tv_accept))
|
|
t_request = tv_ms_elapsed(&s->logs.tv_accept, &s->logs.tv_request);
|
|
|
|
send_log(prx_log, LOG_INFO,
|
|
"%s:%d [%02d/%s/%04d:%02d:%02d:%02d.%03d]"
|
|
" %s %s/%s %d/%d/%d/%d/%s%d %d %s%lld"
|
|
" %s %s %c%c%c%c %d/%d/%d/%d/%s%u %d/%d%s\n",
|
|
pn,
|
|
(s->cli_addr.ss_family == AF_INET) ?
|
|
ntohs(((struct sockaddr_in *)&s->cli_addr)->sin_port) :
|
|
ntohs(((struct sockaddr_in6 *)&s->cli_addr)->sin6_port),
|
|
tm.tm_mday, monthname[tm.tm_mon], tm.tm_year+1900,
|
|
tm.tm_hour, tm.tm_min, tm.tm_sec, s->logs.accept_date.tv_usec/1000,
|
|
fe->id, be->id, svid,
|
|
t_request,
|
|
(s->logs.t_queue >= 0) ? s->logs.t_queue - t_request : -1,
|
|
(s->logs.t_connect >= 0) ? s->logs.t_connect - s->logs.t_queue : -1,
|
|
(s->logs.t_data >= 0) ? s->logs.t_data - s->logs.t_connect : -1,
|
|
(tolog & LW_BYTES) ? "" : "+", s->logs.t_close,
|
|
txn->status,
|
|
(tolog & LW_BYTES) ? "" : "+", s->logs.bytes_out,
|
|
txn->cli_cookie ? txn->cli_cookie : "-",
|
|
txn->srv_cookie ? txn->srv_cookie : "-",
|
|
sess_term_cond[(s->flags & SN_ERR_MASK) >> SN_ERR_SHIFT],
|
|
sess_fin_state[(s->flags & SN_FINST_MASK) >> SN_FINST_SHIFT],
|
|
(be->options & PR_O_COOK_ANY) ? sess_cookie[(txn->flags & TX_CK_MASK) >> TX_CK_SHIFT] : '-',
|
|
(be->options & PR_O_COOK_ANY) ? sess_set_cookie[(txn->flags & TX_SCK_MASK) >> TX_SCK_SHIFT] : '-',
|
|
actconn, fe->feconn, be->beconn, s->srv ? s->srv->cur_sess : 0,
|
|
(s->flags & SN_REDISP)?"+":"",
|
|
(s->conn_retries>0)?(be->conn_retries - s->conn_retries):be->conn_retries,
|
|
s->logs.srv_queue_size, s->logs.prx_queue_size, tmpline);
|
|
|
|
s->logs.logwait = 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* Capture headers from message starting at <som> according to header list
|
|
* <cap_hdr>, and fill the <idx> structure appropriately.
|
|
*/
|
|
void capture_headers(char *som, struct hdr_idx *idx,
|
|
char **cap, struct cap_hdr *cap_hdr)
|
|
{
|
|
char *eol, *sol, *col, *sov;
|
|
int cur_idx;
|
|
struct cap_hdr *h;
|
|
int len;
|
|
|
|
sol = som + hdr_idx_first_pos(idx);
|
|
cur_idx = hdr_idx_first_idx(idx);
|
|
|
|
while (cur_idx) {
|
|
eol = sol + idx->v[cur_idx].len;
|
|
|
|
col = sol;
|
|
while (col < eol && *col != ':')
|
|
col++;
|
|
|
|
sov = col + 1;
|
|
while (sov < eol && http_is_lws[(unsigned char)*sov])
|
|
sov++;
|
|
|
|
for (h = cap_hdr; h; h = h->next) {
|
|
if ((h->namelen == col - sol) &&
|
|
(strncasecmp(sol, h->name, h->namelen) == 0)) {
|
|
if (cap[h->index] == NULL)
|
|
cap[h->index] =
|
|
pool_alloc2(h->pool);
|
|
|
|
if (cap[h->index] == NULL) {
|
|
Alert("HTTP capture : out of memory.\n");
|
|
continue;
|
|
}
|
|
|
|
len = eol - sov;
|
|
if (len > h->len)
|
|
len = h->len;
|
|
|
|
memcpy(cap[h->index], sov, len);
|
|
cap[h->index][len]=0;
|
|
}
|
|
}
|
|
sol = eol + idx->v[cur_idx].cr + 1;
|
|
cur_idx = idx->v[cur_idx].next;
|
|
}
|
|
}
|
|
|
|
|
|
/* either we find an LF at <ptr> or we jump to <bad>.
|
|
*/
|
|
#define EXPECT_LF_HERE(ptr, bad) do { if (unlikely(*(ptr) != '\n')) goto bad; } while (0)
|
|
|
|
/* plays with variables <ptr>, <end> and <state>. Jumps to <good> if OK,
|
|
* otherwise to <http_msg_ood> with <state> set to <st>.
|
|
*/
|
|
#define EAT_AND_JUMP_OR_RETURN(good, st) do { \
|
|
ptr++; \
|
|
if (likely(ptr < end)) \
|
|
goto good; \
|
|
else { \
|
|
state = (st); \
|
|
goto http_msg_ood; \
|
|
} \
|
|
} while (0)
|
|
|
|
|
|
/*
|
|
* This function parses a status line between <ptr> and <end>, starting with
|
|
* parser state <state>. Only states HTTP_MSG_RPVER, HTTP_MSG_RPVER_SP,
|
|
* HTTP_MSG_RPCODE, HTTP_MSG_RPCODE_SP and HTTP_MSG_RPREASON are handled. Others
|
|
* will give undefined results.
|
|
* Note that it is upon the caller's responsibility to ensure that ptr < end,
|
|
* and that msg->sol points to the beginning of the response.
|
|
* If a complete line is found (which implies that at least one CR or LF is
|
|
* found before <end>, the updated <ptr> is returned, otherwise NULL is
|
|
* returned indicating an incomplete line (which does not mean that parts have
|
|
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
|
|
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
|
|
* upon next call.
|
|
*
|
|
* This function was intentionally designed to be called from
|
|
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
|
|
* within its state machine and use the same macros, hence the need for same
|
|
* labels and variable names. Note that msg->sol is left unchanged.
|
|
*/
|
|
const char *http_parse_stsline(struct http_msg *msg, const char *msg_buf,
|
|
unsigned int state, const char *ptr, const char *end,
|
|
char **ret_ptr, unsigned int *ret_state)
|
|
{
|
|
__label__
|
|
http_msg_rpver,
|
|
http_msg_rpver_sp,
|
|
http_msg_rpcode,
|
|
http_msg_rpcode_sp,
|
|
http_msg_rpreason,
|
|
http_msg_rpline_eol,
|
|
http_msg_ood, /* out of data */
|
|
http_msg_invalid;
|
|
|
|
switch (state) {
|
|
http_msg_rpver:
|
|
case HTTP_MSG_RPVER:
|
|
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpver, HTTP_MSG_RPVER);
|
|
|
|
if (likely(HTTP_IS_SPHT(*ptr))) {
|
|
msg->sl.st.v_l = (ptr - msg_buf) - msg->som;
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
|
|
}
|
|
goto http_msg_invalid;
|
|
|
|
http_msg_rpver_sp:
|
|
case HTTP_MSG_RPVER_SP:
|
|
if (likely(!HTTP_IS_LWS(*ptr))) {
|
|
msg->sl.st.c = ptr - msg_buf;
|
|
goto http_msg_rpcode;
|
|
}
|
|
if (likely(HTTP_IS_SPHT(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpver_sp, HTTP_MSG_RPVER_SP);
|
|
/* so it's a CR/LF, this is invalid */
|
|
goto http_msg_invalid;
|
|
|
|
http_msg_rpcode:
|
|
case HTTP_MSG_RPCODE:
|
|
if (likely(!HTTP_IS_LWS(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode, HTTP_MSG_RPCODE);
|
|
|
|
if (likely(HTTP_IS_SPHT(*ptr))) {
|
|
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
|
|
}
|
|
|
|
/* so it's a CR/LF, so there is no reason phrase */
|
|
msg->sl.st.c_l = (ptr - msg_buf) - msg->sl.st.c;
|
|
http_msg_rsp_reason:
|
|
/* FIXME: should we support HTTP responses without any reason phrase ? */
|
|
msg->sl.st.r = ptr - msg_buf;
|
|
msg->sl.st.r_l = 0;
|
|
goto http_msg_rpline_eol;
|
|
|
|
http_msg_rpcode_sp:
|
|
case HTTP_MSG_RPCODE_SP:
|
|
if (likely(!HTTP_IS_LWS(*ptr))) {
|
|
msg->sl.st.r = ptr - msg_buf;
|
|
goto http_msg_rpreason;
|
|
}
|
|
if (likely(HTTP_IS_SPHT(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpcode_sp, HTTP_MSG_RPCODE_SP);
|
|
/* so it's a CR/LF, so there is no reason phrase */
|
|
goto http_msg_rsp_reason;
|
|
|
|
http_msg_rpreason:
|
|
case HTTP_MSG_RPREASON:
|
|
if (likely(!HTTP_IS_CRLF(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpreason, HTTP_MSG_RPREASON);
|
|
msg->sl.st.r_l = (ptr - msg_buf) - msg->sl.st.r;
|
|
http_msg_rpline_eol:
|
|
/* We have seen the end of line. Note that we do not
|
|
* necessarily have the \n yet, but at least we know that we
|
|
* have EITHER \r OR \n, otherwise the response would not be
|
|
* complete. We can then record the response length and return
|
|
* to the caller which will be able to register it.
|
|
*/
|
|
msg->sl.st.l = ptr - msg->sol;
|
|
return ptr;
|
|
|
|
#ifdef DEBUG_FULL
|
|
default:
|
|
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
|
|
exit(1);
|
|
#endif
|
|
}
|
|
|
|
http_msg_ood:
|
|
/* out of data */
|
|
if (ret_state)
|
|
*ret_state = state;
|
|
if (ret_ptr)
|
|
*ret_ptr = (char *)ptr;
|
|
return NULL;
|
|
|
|
http_msg_invalid:
|
|
/* invalid message */
|
|
if (ret_state)
|
|
*ret_state = HTTP_MSG_ERROR;
|
|
return NULL;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function parses a request line between <ptr> and <end>, starting with
|
|
* parser state <state>. Only states HTTP_MSG_RQMETH, HTTP_MSG_RQMETH_SP,
|
|
* HTTP_MSG_RQURI, HTTP_MSG_RQURI_SP and HTTP_MSG_RQVER are handled. Others
|
|
* will give undefined results.
|
|
* Note that it is upon the caller's responsibility to ensure that ptr < end,
|
|
* and that msg->sol points to the beginning of the request.
|
|
* If a complete line is found (which implies that at least one CR or LF is
|
|
* found before <end>, the updated <ptr> is returned, otherwise NULL is
|
|
* returned indicating an incomplete line (which does not mean that parts have
|
|
* not been updated). In the incomplete case, if <ret_ptr> or <ret_state> are
|
|
* non-NULL, they are fed with the new <ptr> and <state> values to be passed
|
|
* upon next call.
|
|
*
|
|
* This function was intentionally designed to be called from
|
|
* http_msg_analyzer() with the lowest overhead. It should integrate perfectly
|
|
* within its state machine and use the same macros, hence the need for same
|
|
* labels and variable names. Note that msg->sol is left unchanged.
|
|
*/
|
|
const char *http_parse_reqline(struct http_msg *msg, const char *msg_buf,
|
|
unsigned int state, const char *ptr, const char *end,
|
|
char **ret_ptr, unsigned int *ret_state)
|
|
{
|
|
__label__
|
|
http_msg_rqmeth,
|
|
http_msg_rqmeth_sp,
|
|
http_msg_rquri,
|
|
http_msg_rquri_sp,
|
|
http_msg_rqver,
|
|
http_msg_rqline_eol,
|
|
http_msg_ood, /* out of data */
|
|
http_msg_invalid;
|
|
|
|
switch (state) {
|
|
http_msg_rqmeth:
|
|
case HTTP_MSG_RQMETH:
|
|
if (likely(HTTP_IS_TOKEN(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth, HTTP_MSG_RQMETH);
|
|
|
|
if (likely(HTTP_IS_SPHT(*ptr))) {
|
|
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
|
|
}
|
|
|
|
if (likely(HTTP_IS_CRLF(*ptr))) {
|
|
/* HTTP 0.9 request */
|
|
msg->sl.rq.m_l = (ptr - msg_buf) - msg->som;
|
|
http_msg_req09_uri:
|
|
msg->sl.rq.u = ptr - msg_buf;
|
|
http_msg_req09_uri_e:
|
|
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
|
|
http_msg_req09_ver:
|
|
msg->sl.rq.v = ptr - msg_buf;
|
|
msg->sl.rq.v_l = 0;
|
|
goto http_msg_rqline_eol;
|
|
}
|
|
goto http_msg_invalid;
|
|
|
|
http_msg_rqmeth_sp:
|
|
case HTTP_MSG_RQMETH_SP:
|
|
if (likely(!HTTP_IS_LWS(*ptr))) {
|
|
msg->sl.rq.u = ptr - msg_buf;
|
|
goto http_msg_rquri;
|
|
}
|
|
if (likely(HTTP_IS_SPHT(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqmeth_sp, HTTP_MSG_RQMETH_SP);
|
|
/* so it's a CR/LF, meaning an HTTP 0.9 request */
|
|
goto http_msg_req09_uri;
|
|
|
|
http_msg_rquri:
|
|
case HTTP_MSG_RQURI:
|
|
if (likely(!HTTP_IS_LWS(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rquri, HTTP_MSG_RQURI);
|
|
|
|
if (likely(HTTP_IS_SPHT(*ptr))) {
|
|
msg->sl.rq.u_l = (ptr - msg_buf) - msg->sl.rq.u;
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
|
|
}
|
|
|
|
/* so it's a CR/LF, meaning an HTTP 0.9 request */
|
|
goto http_msg_req09_uri_e;
|
|
|
|
http_msg_rquri_sp:
|
|
case HTTP_MSG_RQURI_SP:
|
|
if (likely(!HTTP_IS_LWS(*ptr))) {
|
|
msg->sl.rq.v = ptr - msg_buf;
|
|
goto http_msg_rqver;
|
|
}
|
|
if (likely(HTTP_IS_SPHT(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rquri_sp, HTTP_MSG_RQURI_SP);
|
|
/* so it's a CR/LF, meaning an HTTP 0.9 request */
|
|
goto http_msg_req09_ver;
|
|
|
|
http_msg_rqver:
|
|
case HTTP_MSG_RQVER:
|
|
if (likely(HTTP_IS_VER_TOKEN(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqver, HTTP_MSG_RQVER);
|
|
|
|
if (likely(HTTP_IS_CRLF(*ptr))) {
|
|
msg->sl.rq.v_l = (ptr - msg_buf) - msg->sl.rq.v;
|
|
http_msg_rqline_eol:
|
|
/* We have seen the end of line. Note that we do not
|
|
* necessarily have the \n yet, but at least we know that we
|
|
* have EITHER \r OR \n, otherwise the request would not be
|
|
* complete. We can then record the request length and return
|
|
* to the caller which will be able to register it.
|
|
*/
|
|
msg->sl.rq.l = ptr - msg->sol;
|
|
return ptr;
|
|
}
|
|
|
|
/* neither an HTTP_VER token nor a CRLF */
|
|
goto http_msg_invalid;
|
|
|
|
#ifdef DEBUG_FULL
|
|
default:
|
|
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
|
|
exit(1);
|
|
#endif
|
|
}
|
|
|
|
http_msg_ood:
|
|
/* out of data */
|
|
if (ret_state)
|
|
*ret_state = state;
|
|
if (ret_ptr)
|
|
*ret_ptr = (char *)ptr;
|
|
return NULL;
|
|
|
|
http_msg_invalid:
|
|
/* invalid message */
|
|
if (ret_state)
|
|
*ret_state = HTTP_MSG_ERROR;
|
|
return NULL;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function parses an HTTP message, either a request or a response,
|
|
* depending on the initial msg->msg_state. It can be preempted everywhere
|
|
* when data are missing and recalled at the exact same location with no
|
|
* information loss. The header index is re-initialized when switching from
|
|
* MSG_R[PQ]BEFORE to MSG_RPVER|MSG_RQMETH. It modifies msg->sol among other
|
|
* fields.
|
|
*/
|
|
void http_msg_analyzer(struct buffer *buf, struct http_msg *msg, struct hdr_idx *idx)
|
|
{
|
|
__label__
|
|
http_msg_rqbefore,
|
|
http_msg_rqbefore_cr,
|
|
http_msg_rqmeth,
|
|
http_msg_rqline_end,
|
|
http_msg_hdr_first,
|
|
http_msg_hdr_name,
|
|
http_msg_hdr_l1_sp,
|
|
http_msg_hdr_l1_lf,
|
|
http_msg_hdr_l1_lws,
|
|
http_msg_hdr_val,
|
|
http_msg_hdr_l2_lf,
|
|
http_msg_hdr_l2_lws,
|
|
http_msg_complete_header,
|
|
http_msg_last_lf,
|
|
http_msg_ood, /* out of data */
|
|
http_msg_invalid;
|
|
|
|
unsigned int state; /* updated only when leaving the FSM */
|
|
register char *ptr, *end; /* request pointers, to avoid dereferences */
|
|
|
|
state = msg->msg_state;
|
|
ptr = buf->lr;
|
|
end = buf->r;
|
|
|
|
if (unlikely(ptr >= end))
|
|
goto http_msg_ood;
|
|
|
|
switch (state) {
|
|
/*
|
|
* First, states that are specific to the response only.
|
|
* We check them first so that request and headers are
|
|
* closer to each other (accessed more often).
|
|
*/
|
|
http_msg_rpbefore:
|
|
case HTTP_MSG_RPBEFORE:
|
|
if (likely(HTTP_IS_TOKEN(*ptr))) {
|
|
if (likely(ptr == buf->data)) {
|
|
msg->sol = ptr;
|
|
msg->som = 0;
|
|
} else {
|
|
#if PARSE_PRESERVE_EMPTY_LINES
|
|
/* only skip empty leading lines, don't remove them */
|
|
msg->sol = ptr;
|
|
msg->som = ptr - buf->data;
|
|
#else
|
|
/* Remove empty leading lines, as recommended by
|
|
* RFC2616. This takes a lot of time because we
|
|
* must move all the buffer backwards, but this
|
|
* is rarely needed. The method above will be
|
|
* cleaner when we'll be able to start sending
|
|
* the request from any place in the buffer.
|
|
*/
|
|
buf->lr = ptr;
|
|
buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
|
|
msg->som = 0;
|
|
msg->sol = buf->data;
|
|
ptr = buf->data;
|
|
end = buf->r;
|
|
#endif
|
|
}
|
|
hdr_idx_init(idx);
|
|
state = HTTP_MSG_RPVER;
|
|
goto http_msg_rpver;
|
|
}
|
|
|
|
if (unlikely(!HTTP_IS_CRLF(*ptr)))
|
|
goto http_msg_invalid;
|
|
|
|
if (unlikely(*ptr == '\n'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore_cr, HTTP_MSG_RPBEFORE_CR);
|
|
/* stop here */
|
|
|
|
http_msg_rpbefore_cr:
|
|
case HTTP_MSG_RPBEFORE_CR:
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpbefore, HTTP_MSG_RPBEFORE);
|
|
/* stop here */
|
|
|
|
http_msg_rpver:
|
|
case HTTP_MSG_RPVER:
|
|
case HTTP_MSG_RPVER_SP:
|
|
case HTTP_MSG_RPCODE:
|
|
case HTTP_MSG_RPCODE_SP:
|
|
case HTTP_MSG_RPREASON:
|
|
ptr = (char *)http_parse_stsline(msg, buf->data, state, ptr, end,
|
|
&buf->lr, &msg->msg_state);
|
|
if (unlikely(!ptr))
|
|
return;
|
|
|
|
/* we have a full response and we know that we have either a CR
|
|
* or an LF at <ptr>.
|
|
*/
|
|
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.st.l, *ptr);
|
|
hdr_idx_set_start(idx, msg->sl.st.l, *ptr == '\r');
|
|
|
|
msg->sol = ptr;
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rpline_end, HTTP_MSG_RPLINE_END);
|
|
goto http_msg_rpline_end;
|
|
|
|
http_msg_rpline_end:
|
|
case HTTP_MSG_RPLINE_END:
|
|
/* msg->sol must point to the first of CR or LF. */
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
|
|
/* stop here */
|
|
|
|
/*
|
|
* Second, states that are specific to the request only
|
|
*/
|
|
http_msg_rqbefore:
|
|
case HTTP_MSG_RQBEFORE:
|
|
if (likely(HTTP_IS_TOKEN(*ptr))) {
|
|
if (likely(ptr == buf->data)) {
|
|
msg->sol = ptr;
|
|
msg->som = 0;
|
|
} else {
|
|
#if PARSE_PRESERVE_EMPTY_LINES
|
|
/* only skip empty leading lines, don't remove them */
|
|
msg->sol = ptr;
|
|
msg->som = ptr - buf->data;
|
|
#else
|
|
/* Remove empty leading lines, as recommended by
|
|
* RFC2616. This takes a lot of time because we
|
|
* must move all the buffer backwards, but this
|
|
* is rarely needed. The method above will be
|
|
* cleaner when we'll be able to start sending
|
|
* the request from any place in the buffer.
|
|
*/
|
|
buf->lr = ptr;
|
|
buffer_replace2(buf, buf->data, buf->lr, NULL, 0);
|
|
msg->som = 0;
|
|
msg->sol = buf->data;
|
|
ptr = buf->data;
|
|
end = buf->r;
|
|
#endif
|
|
}
|
|
/* we will need this when keep-alive will be supported
|
|
hdr_idx_init(idx);
|
|
*/
|
|
state = HTTP_MSG_RQMETH;
|
|
goto http_msg_rqmeth;
|
|
}
|
|
|
|
if (unlikely(!HTTP_IS_CRLF(*ptr)))
|
|
goto http_msg_invalid;
|
|
|
|
if (unlikely(*ptr == '\n'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore_cr, HTTP_MSG_RQBEFORE_CR);
|
|
/* stop here */
|
|
|
|
http_msg_rqbefore_cr:
|
|
case HTTP_MSG_RQBEFORE_CR:
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqbefore, HTTP_MSG_RQBEFORE);
|
|
/* stop here */
|
|
|
|
http_msg_rqmeth:
|
|
case HTTP_MSG_RQMETH:
|
|
case HTTP_MSG_RQMETH_SP:
|
|
case HTTP_MSG_RQURI:
|
|
case HTTP_MSG_RQURI_SP:
|
|
case HTTP_MSG_RQVER:
|
|
ptr = (char *)http_parse_reqline(msg, buf->data, state, ptr, end,
|
|
&buf->lr, &msg->msg_state);
|
|
if (unlikely(!ptr))
|
|
return;
|
|
|
|
/* we have a full request and we know that we have either a CR
|
|
* or an LF at <ptr>.
|
|
*/
|
|
//fprintf(stderr,"som=%d rq.l=%d *ptr=0x%02x\n", msg->som, msg->sl.rq.l, *ptr);
|
|
hdr_idx_set_start(idx, msg->sl.rq.l, *ptr == '\r');
|
|
|
|
msg->sol = ptr;
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_rqline_end, HTTP_MSG_RQLINE_END);
|
|
goto http_msg_rqline_end;
|
|
|
|
http_msg_rqline_end:
|
|
case HTTP_MSG_RQLINE_END:
|
|
/* check for HTTP/0.9 request : no version information available.
|
|
* msg->sol must point to the first of CR or LF.
|
|
*/
|
|
if (unlikely(msg->sl.rq.v_l == 0))
|
|
goto http_msg_last_lf;
|
|
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_first, HTTP_MSG_HDR_FIRST);
|
|
/* stop here */
|
|
|
|
/*
|
|
* Common states below
|
|
*/
|
|
http_msg_hdr_first:
|
|
case HTTP_MSG_HDR_FIRST:
|
|
msg->sol = ptr;
|
|
if (likely(!HTTP_IS_CRLF(*ptr))) {
|
|
goto http_msg_hdr_name;
|
|
}
|
|
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
|
|
goto http_msg_last_lf;
|
|
|
|
http_msg_hdr_name:
|
|
case HTTP_MSG_HDR_NAME:
|
|
/* assumes msg->sol points to the first char */
|
|
if (likely(HTTP_IS_TOKEN(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_name, HTTP_MSG_HDR_NAME);
|
|
|
|
if (likely(*ptr == ':')) {
|
|
msg->col = ptr - buf->data;
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
|
|
}
|
|
|
|
goto http_msg_invalid;
|
|
|
|
http_msg_hdr_l1_sp:
|
|
case HTTP_MSG_HDR_L1_SP:
|
|
/* assumes msg->sol points to the first char and msg->col to the colon */
|
|
if (likely(HTTP_IS_SPHT(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_sp, HTTP_MSG_HDR_L1_SP);
|
|
|
|
/* header value can be basically anything except CR/LF */
|
|
msg->sov = ptr - buf->data;
|
|
|
|
if (likely(!HTTP_IS_CRLF(*ptr))) {
|
|
goto http_msg_hdr_val;
|
|
}
|
|
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lf, HTTP_MSG_HDR_L1_LF);
|
|
goto http_msg_hdr_l1_lf;
|
|
|
|
http_msg_hdr_l1_lf:
|
|
case HTTP_MSG_HDR_L1_LF:
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l1_lws, HTTP_MSG_HDR_L1_LWS);
|
|
|
|
http_msg_hdr_l1_lws:
|
|
case HTTP_MSG_HDR_L1_LWS:
|
|
if (likely(HTTP_IS_SPHT(*ptr))) {
|
|
/* replace HT,CR,LF with spaces */
|
|
for (; buf->data+msg->sov < ptr; msg->sov++)
|
|
buf->data[msg->sov] = ' ';
|
|
goto http_msg_hdr_l1_sp;
|
|
}
|
|
/* we had a header consisting only in spaces ! */
|
|
msg->eol = buf->data + msg->sov;
|
|
goto http_msg_complete_header;
|
|
|
|
http_msg_hdr_val:
|
|
case HTTP_MSG_HDR_VAL:
|
|
/* assumes msg->sol points to the first char, msg->col to the
|
|
* colon, and msg->sov points to the first character of the
|
|
* value.
|
|
*/
|
|
if (likely(!HTTP_IS_CRLF(*ptr)))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_val, HTTP_MSG_HDR_VAL);
|
|
|
|
msg->eol = ptr;
|
|
/* Note: we could also copy eol into ->eoh so that we have the
|
|
* real header end in case it ends with lots of LWS, but is this
|
|
* really needed ?
|
|
*/
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lf, HTTP_MSG_HDR_L2_LF);
|
|
goto http_msg_hdr_l2_lf;
|
|
|
|
http_msg_hdr_l2_lf:
|
|
case HTTP_MSG_HDR_L2_LF:
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_hdr_l2_lws, HTTP_MSG_HDR_L2_LWS);
|
|
|
|
http_msg_hdr_l2_lws:
|
|
case HTTP_MSG_HDR_L2_LWS:
|
|
if (unlikely(HTTP_IS_SPHT(*ptr))) {
|
|
/* LWS: replace HT,CR,LF with spaces */
|
|
for (; msg->eol < ptr; msg->eol++)
|
|
*msg->eol = ' ';
|
|
goto http_msg_hdr_val;
|
|
}
|
|
http_msg_complete_header:
|
|
/*
|
|
* It was a new header, so the last one is finished.
|
|
* Assumes msg->sol points to the first char, msg->col to the
|
|
* colon, msg->sov points to the first character of the value
|
|
* and msg->eol to the first CR or LF so we know how the line
|
|
* ends. We insert last header into the index.
|
|
*/
|
|
/*
|
|
fprintf(stderr,"registering %-2d bytes : ", msg->eol - msg->sol);
|
|
write(2, msg->sol, msg->eol-msg->sol);
|
|
fprintf(stderr,"\n");
|
|
*/
|
|
|
|
if (unlikely(hdr_idx_add(msg->eol - msg->sol, *msg->eol == '\r',
|
|
idx, idx->tail) < 0))
|
|
goto http_msg_invalid;
|
|
|
|
msg->sol = ptr;
|
|
if (likely(!HTTP_IS_CRLF(*ptr))) {
|
|
goto http_msg_hdr_name;
|
|
}
|
|
|
|
if (likely(*ptr == '\r'))
|
|
EAT_AND_JUMP_OR_RETURN(http_msg_last_lf, HTTP_MSG_LAST_LF);
|
|
goto http_msg_last_lf;
|
|
|
|
http_msg_last_lf:
|
|
case HTTP_MSG_LAST_LF:
|
|
/* Assumes msg->sol points to the first of either CR or LF */
|
|
EXPECT_LF_HERE(ptr, http_msg_invalid);
|
|
ptr++;
|
|
buf->lr = ptr;
|
|
msg->eoh = msg->sol - buf->data;
|
|
msg->msg_state = HTTP_MSG_BODY;
|
|
return;
|
|
#ifdef DEBUG_FULL
|
|
default:
|
|
fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, state);
|
|
exit(1);
|
|
#endif
|
|
}
|
|
http_msg_ood:
|
|
/* out of data */
|
|
msg->msg_state = state;
|
|
buf->lr = ptr;
|
|
return;
|
|
|
|
http_msg_invalid:
|
|
/* invalid message */
|
|
msg->msg_state = HTTP_MSG_ERROR;
|
|
return;
|
|
}
|
|
|
|
/* This function performs all the processing enabled for the current request.
|
|
* It normally returns zero, but may return 1 if it absolutely needs to be
|
|
* called again after other functions. It relies on buffers flags, and updates
|
|
* t->req->analysers. It might make sense to explode it into several other
|
|
* functions. Its behaviour is rather simple :
|
|
* - all enabled analysers are called in turn from the lower to the higher
|
|
* bit.
|
|
* - if an analyser does not have enough data, it must return without calling
|
|
* other ones. It should also probably reset the BF_WRITE_ENA bit to ensure
|
|
* that unprocessed data will not be forwarded. But that probably depends on
|
|
* the protocol. Generally it is not reset in case of errors.
|
|
* - if an analyser has enough data, it just has to pass on to the next
|
|
* analyser without touching BF_WRITE_ENA (it is enabled prior to
|
|
* analysis).
|
|
* - if an analyser thinks it has no added value anymore staying here, it must
|
|
* reset its bit from the analysers flags in order not to be called anymore.
|
|
*
|
|
* In the future, analysers should be able to indicate that they want to be
|
|
* called after XXX bytes have been received (or transfered), and the min of
|
|
* all's wishes will be used to ring back (unless a special condition occurs).
|
|
*
|
|
*
|
|
*/
|
|
int process_request(struct session *t)
|
|
{
|
|
struct buffer *req = t->req;
|
|
struct buffer *rep = t->rep;
|
|
|
|
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
|
|
now_ms, __FUNCTION__,
|
|
t,
|
|
req,
|
|
req->rex, req->wex,
|
|
req->flags,
|
|
req->l,
|
|
req->analysers);
|
|
|
|
/* The tcp-inspect analyser is always called alone */
|
|
if (req->analysers & AN_REQ_INSPECT) {
|
|
struct tcp_rule *rule;
|
|
int partial;
|
|
|
|
/* We will abort if we encounter a read error. In theory, we
|
|
* should not abort if we get a close, it might be valid,
|
|
* although very unlikely. FIXME: we'll abort for now, this
|
|
* will be easier to change later.
|
|
*/
|
|
if (req->flags & BF_READ_ERROR) {
|
|
req->analysers = 0;
|
|
//t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
|
|
/* Abort if client read timeout has expired */
|
|
else if (req->flags & BF_READ_TIMEOUT) {
|
|
req->analysers = 0;
|
|
t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
|
|
/* We don't know whether we have enough data, so must proceed
|
|
* this way :
|
|
* - iterate through all rules in their declaration order
|
|
* - if one rule returns MISS, it means the inspect delay is
|
|
* not over yet, then return immediately, otherwise consider
|
|
* it as a non-match.
|
|
* - if one rule returns OK, then return OK
|
|
* - if one rule returns KO, then return KO
|
|
*/
|
|
|
|
if (req->flags & BF_SHUTR || tick_is_expired(req->analyse_exp, now_ms))
|
|
partial = 0;
|
|
else
|
|
partial = ACL_PARTIAL;
|
|
|
|
list_for_each_entry(rule, &t->fe->tcp_req.inspect_rules, list) {
|
|
int ret = ACL_PAT_PASS;
|
|
|
|
if (rule->cond) {
|
|
ret = acl_exec_cond(rule->cond, t->fe, t, NULL, ACL_DIR_REQ | partial);
|
|
if (ret == ACL_PAT_MISS) {
|
|
buffer_write_dis(req);
|
|
/* just set the request timeout once at the beginning of the request */
|
|
if (!tick_isset(req->analyse_exp))
|
|
req->analyse_exp = tick_add_ifset(now_ms, t->fe->tcp_req.inspect_delay);
|
|
return 0;
|
|
}
|
|
|
|
ret = acl_pass(ret);
|
|
if (rule->cond->pol == ACL_COND_UNLESS)
|
|
ret = !ret;
|
|
}
|
|
|
|
if (ret) {
|
|
/* we have a matching rule. */
|
|
if (rule->action == TCP_ACT_REJECT) {
|
|
buffer_abort(req);
|
|
buffer_abort(rep);
|
|
//FIXME: this delete this
|
|
//fd_delete(t->cli_fd);
|
|
//t->cli_state = CL_STCLOSE;
|
|
req->analysers = 0;
|
|
t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
/* otherwise accept */
|
|
break;
|
|
}
|
|
}
|
|
|
|
/* if we get there, it means we have no rule which matches, or
|
|
* we have an explicit accept, so we apply the default accept.
|
|
*/
|
|
req->analysers &= ~AN_REQ_INSPECT;
|
|
req->analyse_exp = TICK_ETERNITY;
|
|
}
|
|
|
|
if (req->analysers & AN_REQ_HTTP_HDR) {
|
|
/*
|
|
* Now parse the partial (or complete) lines.
|
|
* We will check the request syntax, and also join multi-line
|
|
* headers. An index of all the lines will be elaborated while
|
|
* parsing.
|
|
*
|
|
* For the parsing, we use a 28 states FSM.
|
|
*
|
|
* Here is the information we currently have :
|
|
* req->data + req->som = beginning of request
|
|
* req->data + req->eoh = end of processed headers / start of current one
|
|
* req->data + req->eol = end of current header or line (LF or CRLF)
|
|
* req->lr = first non-visited byte
|
|
* req->r = end of data
|
|
*/
|
|
|
|
int cur_idx;
|
|
struct http_txn *txn = &t->txn;
|
|
struct http_msg *msg = &txn->req;
|
|
struct proxy *cur_proxy;
|
|
|
|
if (likely(req->lr < req->r))
|
|
http_msg_analyzer(req, msg, &txn->hdr_idx);
|
|
|
|
/* 1: we might have to print this header in debug mode */
|
|
if (unlikely((global.mode & MODE_DEBUG) &&
|
|
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
|
|
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
|
|
char *eol, *sol;
|
|
|
|
sol = req->data + msg->som;
|
|
eol = sol + msg->sl.rq.l;
|
|
debug_hdr("clireq", t, sol, eol);
|
|
|
|
sol += hdr_idx_first_pos(&txn->hdr_idx);
|
|
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
|
|
|
|
while (cur_idx) {
|
|
eol = sol + txn->hdr_idx.v[cur_idx].len;
|
|
debug_hdr("clihdr", t, sol, eol);
|
|
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
|
|
cur_idx = txn->hdr_idx.v[cur_idx].next;
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* Now we quickly check if we have found a full valid request.
|
|
* If not so, we check the FD and buffer states before leaving.
|
|
* A full request is indicated by the fact that we have seen
|
|
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
|
|
* requests are checked first.
|
|
*
|
|
*/
|
|
|
|
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
|
|
/*
|
|
* First, let's catch bad requests.
|
|
*/
|
|
if (unlikely(msg->msg_state == HTTP_MSG_ERROR))
|
|
goto return_bad_req;
|
|
|
|
/* 1: Since we are in header mode, if there's no space
|
|
* left for headers, we won't be able to free more
|
|
* later, so the session will never terminate. We
|
|
* must terminate it now.
|
|
*/
|
|
if (unlikely(req->flags & BF_FULL)) {
|
|
/* FIXME: check if URI is set and return Status
|
|
* 414 Request URI too long instead.
|
|
*/
|
|
goto return_bad_req;
|
|
}
|
|
|
|
/* 2: have we encountered a read error ? */
|
|
else if (req->flags & BF_READ_ERROR) {
|
|
/* we cannot return any message on error */
|
|
msg->msg_state = HTTP_MSG_ERROR;
|
|
req->analysers = 0;
|
|
//t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
|
|
/* 3: has the read timeout expired ? */
|
|
else if (req->flags & BF_READ_TIMEOUT || tick_is_expired(req->analyse_exp, now_ms)) {
|
|
/* read timeout : give up with an error message. */
|
|
txn->status = 408;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_408));
|
|
msg->msg_state = HTTP_MSG_ERROR;
|
|
req->analysers = 0;
|
|
t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLITO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
|
|
/* 4: have we encountered a close ? */
|
|
else if (req->flags & BF_SHUTR) {
|
|
txn->status = 400;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_400));
|
|
msg->msg_state = HTTP_MSG_ERROR;
|
|
req->analysers = 0;
|
|
t->fe->failed_req++;
|
|
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_CLICL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
}
|
|
|
|
buffer_write_dis(req);
|
|
/* just set the request timeout once at the beginning of the request */
|
|
if (!tick_isset(req->analyse_exp))
|
|
req->analyse_exp = tick_add_ifset(now_ms, t->fe->timeout.httpreq);
|
|
|
|
/* we're not ready yet */
|
|
return 0;
|
|
}
|
|
|
|
|
|
/****************************************************************
|
|
* More interesting part now : we know that we have a complete *
|
|
* request which at least looks like HTTP. We have an indicator *
|
|
* of each header's length, so we can parse them quickly. *
|
|
****************************************************************/
|
|
|
|
req->analysers &= ~AN_REQ_HTTP_HDR;
|
|
req->analyse_exp = TICK_ETERNITY;
|
|
|
|
/* ensure we keep this pointer to the beginning of the message */
|
|
msg->sol = req->data + msg->som;
|
|
|
|
/*
|
|
* 1: identify the method
|
|
*/
|
|
txn->meth = find_http_meth(&req->data[msg->som], msg->sl.rq.m_l);
|
|
|
|
/* we can make use of server redirect on GET and HEAD */
|
|
if (txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)
|
|
t->flags |= SN_REDIRECTABLE;
|
|
|
|
/*
|
|
* 2: check if the URI matches the monitor_uri.
|
|
* We have to do this for every request which gets in, because
|
|
* the monitor-uri is defined by the frontend.
|
|
*/
|
|
if (unlikely((t->fe->monitor_uri_len != 0) &&
|
|
(t->fe->monitor_uri_len == msg->sl.rq.u_l) &&
|
|
!memcmp(&req->data[msg->sl.rq.u],
|
|
t->fe->monitor_uri,
|
|
t->fe->monitor_uri_len))) {
|
|
/*
|
|
* We have found the monitor URI
|
|
*/
|
|
struct acl_cond *cond;
|
|
cur_proxy = t->fe;
|
|
|
|
t->flags |= SN_MONITOR;
|
|
|
|
/* Check if we want to fail this monitor request or not */
|
|
list_for_each_entry(cond, &cur_proxy->mon_fail_cond, list) {
|
|
int ret = acl_exec_cond(cond, cur_proxy, t, txn, ACL_DIR_REQ);
|
|
|
|
ret = acl_pass(ret);
|
|
if (cond->pol == ACL_COND_UNLESS)
|
|
ret = !ret;
|
|
|
|
if (ret) {
|
|
/* we fail this request, let's return 503 service unavail */
|
|
txn->status = 503;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_503));
|
|
goto return_prx_cond;
|
|
}
|
|
}
|
|
|
|
/* nothing to fail, let's reply normaly */
|
|
txn->status = 200;
|
|
client_retnclose(t, &http_200_chunk);
|
|
goto return_prx_cond;
|
|
}
|
|
|
|
/*
|
|
* 3: Maybe we have to copy the original REQURI for the logs ?
|
|
* Note: we cannot log anymore if the request has been
|
|
* classified as invalid.
|
|
*/
|
|
if (unlikely(t->logs.logwait & LW_REQ)) {
|
|
/* we have a complete HTTP request that we must log */
|
|
if ((txn->uri = pool_alloc2(pool2_requri)) != NULL) {
|
|
int urilen = msg->sl.rq.l;
|
|
|
|
if (urilen >= REQURI_LEN)
|
|
urilen = REQURI_LEN - 1;
|
|
memcpy(txn->uri, &req->data[msg->som], urilen);
|
|
txn->uri[urilen] = 0;
|
|
|
|
if (!(t->logs.logwait &= ~LW_REQ))
|
|
http_sess_log(t);
|
|
} else {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
}
|
|
}
|
|
|
|
|
|
/* 4. We may have to convert HTTP/0.9 requests to HTTP/1.0 */
|
|
if (unlikely(msg->sl.rq.v_l == 0)) {
|
|
int delta;
|
|
char *cur_end;
|
|
msg->sol = req->data + msg->som;
|
|
cur_end = msg->sol + msg->sl.rq.l;
|
|
delta = 0;
|
|
|
|
if (msg->sl.rq.u_l == 0) {
|
|
/* if no URI was set, add "/" */
|
|
delta = buffer_replace2(req, cur_end, cur_end, " /", 2);
|
|
cur_end += delta;
|
|
msg->eoh += delta;
|
|
}
|
|
/* add HTTP version */
|
|
delta = buffer_replace2(req, cur_end, cur_end, " HTTP/1.0\r\n", 11);
|
|
msg->eoh += delta;
|
|
cur_end += delta;
|
|
cur_end = (char *)http_parse_reqline(msg, req->data,
|
|
HTTP_MSG_RQMETH,
|
|
msg->sol, cur_end + 1,
|
|
NULL, NULL);
|
|
if (unlikely(!cur_end))
|
|
goto return_bad_req;
|
|
|
|
/* we have a full HTTP/1.0 request now and we know that
|
|
* we have either a CR or an LF at <ptr>.
|
|
*/
|
|
hdr_idx_set_start(&txn->hdr_idx, msg->sl.rq.l, *cur_end == '\r');
|
|
}
|
|
|
|
|
|
/* 5: we may need to capture headers */
|
|
if (unlikely((t->logs.logwait & LW_REQHDR) && t->fe->req_cap))
|
|
capture_headers(req->data + msg->som, &txn->hdr_idx,
|
|
txn->req.cap, t->fe->req_cap);
|
|
|
|
/*
|
|
* 6: we will have to evaluate the filters.
|
|
* As opposed to version 1.2, now they will be evaluated in the
|
|
* filters order and not in the header order. This means that
|
|
* each filter has to be validated among all headers.
|
|
*
|
|
* We can now check whether we want to switch to another
|
|
* backend, in which case we will re-check the backend's
|
|
* filters and various options. In order to support 3-level
|
|
* switching, here's how we should proceed :
|
|
*
|
|
* a) run be.
|
|
* if (switch) then switch ->be to the new backend.
|
|
* b) run be if (be != fe).
|
|
* There cannot be any switch from there, so ->be cannot be
|
|
* changed anymore.
|
|
*
|
|
* => filters always apply to ->be, then ->be may change.
|
|
*
|
|
* The response path will be able to apply either ->be, or
|
|
* ->be then ->fe filters in order to match the reverse of
|
|
* the forward sequence.
|
|
*/
|
|
|
|
do {
|
|
struct acl_cond *cond;
|
|
struct redirect_rule *rule;
|
|
struct proxy *rule_set = t->be;
|
|
cur_proxy = t->be;
|
|
|
|
/* first check whether we have some ACLs set to redirect this request */
|
|
list_for_each_entry(rule, &cur_proxy->redirect_rules, list) {
|
|
int ret = acl_exec_cond(rule->cond, cur_proxy, t, txn, ACL_DIR_REQ);
|
|
|
|
ret = acl_pass(ret);
|
|
if (rule->cond->pol == ACL_COND_UNLESS)
|
|
ret = !ret;
|
|
|
|
if (ret) {
|
|
struct chunk rdr = { trash, 0 };
|
|
const char *msg_fmt;
|
|
|
|
/* build redirect message */
|
|
switch(rule->code) {
|
|
case 303:
|
|
rdr.len = strlen(HTTP_303);
|
|
msg_fmt = HTTP_303;
|
|
break;
|
|
case 301:
|
|
rdr.len = strlen(HTTP_301);
|
|
msg_fmt = HTTP_301;
|
|
break;
|
|
case 302:
|
|
default:
|
|
rdr.len = strlen(HTTP_302);
|
|
msg_fmt = HTTP_302;
|
|
break;
|
|
}
|
|
|
|
if (unlikely(rdr.len > sizeof(trash)))
|
|
goto return_bad_req;
|
|
memcpy(rdr.str, msg_fmt, rdr.len);
|
|
|
|
switch(rule->type) {
|
|
case REDIRECT_TYPE_PREFIX: {
|
|
const char *path;
|
|
int pathlen;
|
|
|
|
path = http_get_path(txn);
|
|
/* build message using path */
|
|
if (path) {
|
|
pathlen = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path;
|
|
} else {
|
|
path = "/";
|
|
pathlen = 1;
|
|
}
|
|
|
|
if (rdr.len + rule->rdr_len + pathlen > sizeof(trash) - 4)
|
|
goto return_bad_req;
|
|
|
|
/* add prefix */
|
|
memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len);
|
|
rdr.len += rule->rdr_len;
|
|
|
|
/* add path */
|
|
memcpy(rdr.str + rdr.len, path, pathlen);
|
|
rdr.len += pathlen;
|
|
break;
|
|
}
|
|
case REDIRECT_TYPE_LOCATION:
|
|
default:
|
|
if (rdr.len + rule->rdr_len > sizeof(trash) - 4)
|
|
goto return_bad_req;
|
|
|
|
/* add location */
|
|
memcpy(rdr.str + rdr.len, rule->rdr_str, rule->rdr_len);
|
|
rdr.len += rule->rdr_len;
|
|
break;
|
|
}
|
|
|
|
/* add end of headers */
|
|
memcpy(rdr.str + rdr.len, "\r\n\r\n", 4);
|
|
rdr.len += 4;
|
|
|
|
txn->status = rule->code;
|
|
/* let's log the request time */
|
|
t->logs.tv_request = now;
|
|
client_retnclose(t, &rdr);
|
|
goto return_prx_cond;
|
|
}
|
|
}
|
|
|
|
/* first check whether we have some ACLs set to block this request */
|
|
list_for_each_entry(cond, &cur_proxy->block_cond, list) {
|
|
int ret = acl_exec_cond(cond, cur_proxy, t, txn, ACL_DIR_REQ);
|
|
|
|
ret = acl_pass(ret);
|
|
if (cond->pol == ACL_COND_UNLESS)
|
|
ret = !ret;
|
|
|
|
if (ret) {
|
|
txn->status = 403;
|
|
/* let's log the request time */
|
|
t->logs.tv_request = now;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_403));
|
|
goto return_prx_cond;
|
|
}
|
|
}
|
|
|
|
/* try headers filters */
|
|
if (rule_set->req_exp != NULL) {
|
|
if (apply_filters_to_request(t, req, rule_set->req_exp) < 0)
|
|
goto return_bad_req;
|
|
}
|
|
|
|
if (!(t->flags & SN_BE_ASSIGNED) && (t->be != cur_proxy)) {
|
|
/* to ensure correct connection accounting on
|
|
* the backend, we count the connection for the
|
|
* one managing the queue.
|
|
*/
|
|
t->be->beconn++;
|
|
if (t->be->beconn > t->be->beconn_max)
|
|
t->be->beconn_max = t->be->beconn;
|
|
t->be->cum_beconn++;
|
|
t->flags |= SN_BE_ASSIGNED;
|
|
}
|
|
|
|
/* has the request been denied ? */
|
|
if (txn->flags & TX_CLDENY) {
|
|
/* no need to go further */
|
|
txn->status = 403;
|
|
/* let's log the request time */
|
|
t->logs.tv_request = now;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_403));
|
|
goto return_prx_cond;
|
|
}
|
|
|
|
/* We might have to check for "Connection:" */
|
|
if (((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) &&
|
|
!(t->flags & SN_CONN_CLOSED)) {
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx, delta, val;
|
|
struct hdr_idx_elem *cur_hdr;
|
|
|
|
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
old_idx = 0;
|
|
|
|
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
|
|
if (val) {
|
|
/* 3 possibilities :
|
|
* - we have already set Connection: close,
|
|
* so we remove this line.
|
|
* - we have not yet set Connection: close,
|
|
* but this line indicates close. We leave
|
|
* it untouched and set the flag.
|
|
* - we have not yet set Connection: close,
|
|
* and this line indicates non-close. We
|
|
* replace it.
|
|
*/
|
|
if (t->flags & SN_CONN_CLOSED) {
|
|
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
|
|
txn->req.eoh += delta;
|
|
cur_next += delta;
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
} else {
|
|
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
|
|
delta = buffer_replace2(req, cur_ptr + val, cur_end,
|
|
"close", 5);
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->req.eoh += delta;
|
|
}
|
|
t->flags |= SN_CONN_CLOSED;
|
|
}
|
|
}
|
|
old_idx = cur_idx;
|
|
}
|
|
}
|
|
/* add request headers from the rule sets in the same order */
|
|
for (cur_idx = 0; cur_idx < rule_set->nb_reqadd; cur_idx++) {
|
|
if (unlikely(http_header_add_tail(req,
|
|
&txn->req,
|
|
&txn->hdr_idx,
|
|
rule_set->req_add[cur_idx])) < 0)
|
|
goto return_bad_req;
|
|
}
|
|
|
|
/* check if stats URI was requested, and if an auth is needed */
|
|
if (rule_set->uri_auth != NULL &&
|
|
(txn->meth == HTTP_METH_GET || txn->meth == HTTP_METH_HEAD)) {
|
|
/* we have to check the URI and auth for this request.
|
|
* FIXME!!! that one is rather dangerous, we want to
|
|
* make it follow standard rules (eg: clear req->analysers).
|
|
*/
|
|
if (stats_check_uri_auth(t, rule_set))
|
|
return 1;
|
|
}
|
|
|
|
/* now check whether we have some switching rules for this request */
|
|
if (!(t->flags & SN_BE_ASSIGNED)) {
|
|
struct switching_rule *rule;
|
|
|
|
list_for_each_entry(rule, &cur_proxy->switching_rules, list) {
|
|
int ret;
|
|
|
|
ret = acl_exec_cond(rule->cond, cur_proxy, t, txn, ACL_DIR_REQ);
|
|
|
|
ret = acl_pass(ret);
|
|
if (rule->cond->pol == ACL_COND_UNLESS)
|
|
ret = !ret;
|
|
|
|
if (ret) {
|
|
t->be = rule->be.backend;
|
|
t->be->beconn++;
|
|
if (t->be->beconn > t->be->beconn_max)
|
|
t->be->beconn_max = t->be->beconn;
|
|
t->be->cum_beconn++;
|
|
|
|
/* assign new parameters to the session from the new backend */
|
|
t->rep->rto = t->req->wto = t->be->timeout.server;
|
|
t->req->cto = t->be->timeout.connect;
|
|
t->conn_retries = t->be->conn_retries;
|
|
t->flags |= SN_BE_ASSIGNED;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (!(t->flags & SN_BE_ASSIGNED) && cur_proxy->defbe.be) {
|
|
/* No backend was set, but there was a default
|
|
* backend set in the frontend, so we use it and
|
|
* loop again.
|
|
*/
|
|
t->be = cur_proxy->defbe.be;
|
|
t->be->beconn++;
|
|
if (t->be->beconn > t->be->beconn_max)
|
|
t->be->beconn_max = t->be->beconn;
|
|
t->be->cum_beconn++;
|
|
|
|
/* assign new parameters to the session from the new backend */
|
|
t->rep->rto = t->req->wto = t->be->timeout.server;
|
|
t->req->cto = t->be->timeout.connect;
|
|
t->conn_retries = t->be->conn_retries;
|
|
t->flags |= SN_BE_ASSIGNED;
|
|
}
|
|
} while (t->be != cur_proxy); /* we loop only if t->be has changed */
|
|
|
|
|
|
if (!(t->flags & SN_BE_ASSIGNED)) {
|
|
/* To ensure correct connection accounting on
|
|
* the backend, we count the connection for the
|
|
* one managing the queue.
|
|
*/
|
|
t->be->beconn++;
|
|
if (t->be->beconn > t->be->beconn_max)
|
|
t->be->beconn_max = t->be->beconn;
|
|
t->be->cum_beconn++;
|
|
t->flags |= SN_BE_ASSIGNED;
|
|
}
|
|
|
|
/*
|
|
* Right now, we know that we have processed the entire headers
|
|
* and that unwanted requests have been filtered out. We can do
|
|
* whatever we want with the remaining request. Also, now we
|
|
* may have separate values for ->fe, ->be.
|
|
*/
|
|
|
|
/*
|
|
* If HTTP PROXY is set we simply get remote server address
|
|
* parsing incoming request.
|
|
*/
|
|
if ((t->be->options & PR_O_HTTP_PROXY) && !(t->flags & SN_ADDR_SET)) {
|
|
url2sa(req->data + msg->sl.rq.u, msg->sl.rq.u_l, &t->srv_addr);
|
|
}
|
|
|
|
/*
|
|
* 7: the appsession cookie was looked up very early in 1.2,
|
|
* so let's do the same now.
|
|
*/
|
|
|
|
/* It needs to look into the URI */
|
|
if (t->be->appsession_name) {
|
|
get_srv_from_appsession(t, &req->data[msg->som], msg->sl.rq.l);
|
|
}
|
|
|
|
|
|
/*
|
|
* 8: Now we can work with the cookies.
|
|
* Note that doing so might move headers in the request, but
|
|
* the fields will stay coherent and the URI will not move.
|
|
* This should only be performed in the backend.
|
|
*/
|
|
if ((t->be->cookie_name || t->be->appsession_name || t->be->capture_name)
|
|
&& !(txn->flags & (TX_CLDENY|TX_CLTARPIT)))
|
|
manage_client_side_cookies(t, req);
|
|
|
|
|
|
/*
|
|
* 9: add X-Forwarded-For if either the frontend or the backend
|
|
* asks for it.
|
|
*/
|
|
if ((t->fe->options | t->be->options) & PR_O_FWDFOR) {
|
|
if (t->cli_addr.ss_family == AF_INET) {
|
|
/* Add an X-Forwarded-For header unless the source IP is
|
|
* in the 'except' network range.
|
|
*/
|
|
if ((!t->fe->except_mask.s_addr ||
|
|
(((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->fe->except_mask.s_addr)
|
|
!= t->fe->except_net.s_addr) &&
|
|
(!t->be->except_mask.s_addr ||
|
|
(((struct sockaddr_in *)&t->cli_addr)->sin_addr.s_addr & t->be->except_mask.s_addr)
|
|
!= t->be->except_net.s_addr)) {
|
|
int len;
|
|
unsigned char *pn;
|
|
pn = (unsigned char *)&((struct sockaddr_in *)&t->cli_addr)->sin_addr;
|
|
|
|
/* Note: we rely on the backend to get the header name to be used for
|
|
* x-forwarded-for, because the header is really meant for the backends.
|
|
* However, if the backend did not specify any option, we have to rely
|
|
* on the frontend's header name.
|
|
*/
|
|
if (t->be->fwdfor_hdr_len) {
|
|
len = t->be->fwdfor_hdr_len;
|
|
memcpy(trash, t->be->fwdfor_hdr_name, len);
|
|
} else {
|
|
len = t->fe->fwdfor_hdr_len;
|
|
memcpy(trash, t->fe->fwdfor_hdr_name, len);
|
|
}
|
|
len += sprintf(trash + len, ": %d.%d.%d.%d", pn[0], pn[1], pn[2], pn[3]);
|
|
|
|
if (unlikely(http_header_add_tail2(req, &txn->req,
|
|
&txn->hdr_idx, trash, len)) < 0)
|
|
goto return_bad_req;
|
|
}
|
|
}
|
|
else if (t->cli_addr.ss_family == AF_INET6) {
|
|
/* FIXME: for the sake of completeness, we should also support
|
|
* 'except' here, although it is mostly useless in this case.
|
|
*/
|
|
int len;
|
|
char pn[INET6_ADDRSTRLEN];
|
|
inet_ntop(AF_INET6,
|
|
(const void *)&((struct sockaddr_in6 *)(&t->cli_addr))->sin6_addr,
|
|
pn, sizeof(pn));
|
|
|
|
/* Note: we rely on the backend to get the header name to be used for
|
|
* x-forwarded-for, because the header is really meant for the backends.
|
|
* However, if the backend did not specify any option, we have to rely
|
|
* on the frontend's header name.
|
|
*/
|
|
if (t->be->fwdfor_hdr_len) {
|
|
len = t->be->fwdfor_hdr_len;
|
|
memcpy(trash, t->be->fwdfor_hdr_name, len);
|
|
} else {
|
|
len = t->fe->fwdfor_hdr_len;
|
|
memcpy(trash, t->fe->fwdfor_hdr_name, len);
|
|
}
|
|
len += sprintf(trash + len, ": %s", pn);
|
|
|
|
if (unlikely(http_header_add_tail2(req, &txn->req,
|
|
&txn->hdr_idx, trash, len)) < 0)
|
|
goto return_bad_req;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* 10: add "Connection: close" if needed and not yet set.
|
|
* Note that we do not need to add it in case of HTTP/1.0.
|
|
*/
|
|
if (!(t->flags & SN_CONN_CLOSED) &&
|
|
((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO))) {
|
|
if ((unlikely(msg->sl.rq.v_l != 8) ||
|
|
unlikely(req->data[msg->som + msg->sl.rq.v + 7] != '0')) &&
|
|
unlikely(http_header_add_tail2(req, &txn->req, &txn->hdr_idx,
|
|
"Connection: close", 17)) < 0)
|
|
goto return_bad_req;
|
|
t->flags |= SN_CONN_CLOSED;
|
|
}
|
|
/* Before we switch to data, was assignment set in manage_client_side_cookie?
|
|
* If not assigned, perhaps we are balancing on url_param, but this is a
|
|
* POST; and the parameters are in the body, maybe scan there to find our server.
|
|
* (unless headers overflowed the buffer?)
|
|
*/
|
|
if (!(t->flags & (SN_ASSIGNED|SN_DIRECT)) &&
|
|
t->txn.meth == HTTP_METH_POST && t->be->url_param_name != NULL &&
|
|
t->be->url_param_post_limit != 0 && !(req->flags & BF_FULL) &&
|
|
memchr(msg->sol + msg->sl.rq.u, '?', msg->sl.rq.u_l) == NULL) {
|
|
/* are there enough bytes here? total == l || r || rlim ?
|
|
* len is unsigned, but eoh is int,
|
|
* how many bytes of body have we received?
|
|
* eoh is the first empty line of the header
|
|
*/
|
|
/* already established CRLF or LF at eoh, move to start of message, find message length in buffer */
|
|
unsigned long len = req->l - (msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1);
|
|
|
|
/* If we have HTTP/1.1 and Expect: 100-continue, then abort.
|
|
* We can't assume responsibility for the server's decision,
|
|
* on this URI and header set. See rfc2616: 14.20, 8.2.3,
|
|
* We also can't change our mind later, about which server to choose, so round robin.
|
|
*/
|
|
if ((likely(msg->sl.rq.v_l == 8) && req->data[msg->som + msg->sl.rq.v + 7] == '1')) {
|
|
struct hdr_ctx ctx;
|
|
ctx.idx = 0;
|
|
/* Expect is allowed in 1.1, look for it */
|
|
http_find_header2("Expect", 6, msg->sol, &txn->hdr_idx, &ctx);
|
|
if (ctx.idx != 0 &&
|
|
unlikely(ctx.vlen == 12 && strncasecmp(ctx.line+ctx.val, "100-continue", 12) == 0))
|
|
/* We can't reliablly stall and wait for data, because of
|
|
* .NET clients that don't conform to rfc2616; so, no need for
|
|
* the next block to check length expectations.
|
|
* We could send 100 status back to the client, but then we need to
|
|
* re-write headers, and send the message. And this isn't the right
|
|
* place for that action.
|
|
* TODO: support Expect elsewhere and delete this block.
|
|
*/
|
|
goto end_check_maybe_wait_for_body;
|
|
}
|
|
|
|
if (likely(len > t->be->url_param_post_limit)) {
|
|
/* nothing to do, we got enough */
|
|
} else {
|
|
/* limit implies we are supposed to need this many bytes
|
|
* to find the parameter. Let's see how many bytes we can wait for.
|
|
*/
|
|
long long hint = len;
|
|
struct hdr_ctx ctx;
|
|
ctx.idx = 0;
|
|
http_find_header2("Transfer-Encoding", 17, msg->sol, &txn->hdr_idx, &ctx);
|
|
if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) {
|
|
buffer_write_dis(req);
|
|
req->analysers |= AN_REQ_HTTP_BODY;
|
|
}
|
|
else {
|
|
ctx.idx = 0;
|
|
http_find_header2("Content-Length", 14, msg->sol, &txn->hdr_idx, &ctx);
|
|
/* now if we have a length, we'll take the hint */
|
|
if (ctx.idx) {
|
|
/* We have Content-Length */
|
|
if (strl2llrc(ctx.line+ctx.val,ctx.vlen, &hint))
|
|
hint = 0; /* parse failure, untrusted client */
|
|
else {
|
|
if (hint > 0)
|
|
msg->hdr_content_len = hint;
|
|
else
|
|
hint = 0; /* bad client, sent negative length */
|
|
}
|
|
}
|
|
/* but limited to what we care about, maybe we don't expect any entity data (hint == 0) */
|
|
if (t->be->url_param_post_limit < hint)
|
|
hint = t->be->url_param_post_limit;
|
|
/* now do we really need to buffer more data? */
|
|
if (len < hint) {
|
|
buffer_write_dis(req);
|
|
req->analysers |= AN_REQ_HTTP_BODY;
|
|
}
|
|
/* else... There are no body bytes to wait for */
|
|
}
|
|
}
|
|
}
|
|
end_check_maybe_wait_for_body:
|
|
|
|
/*************************************************************
|
|
* OK, that's finished for the headers. We have done what we *
|
|
* could. Let's switch to the DATA state. *
|
|
************************************************************/
|
|
|
|
buffer_set_rlim(req, BUFSIZE); /* no more rewrite needed */
|
|
t->logs.tv_request = now;
|
|
|
|
/* When a connection is tarpitted, we use the tarpit timeout,
|
|
* which may be the same as the connect timeout if unspecified.
|
|
* If unset, then set it to zero because we really want it to
|
|
* eventually expire. We build the tarpit as an analyser.
|
|
*/
|
|
if (txn->flags & TX_CLTARPIT) {
|
|
buffer_flush(t->req);
|
|
/* flush the request so that we can drop the connection early
|
|
* if the client closes first.
|
|
*/
|
|
buffer_write_dis(req);
|
|
req->analysers |= AN_REQ_HTTP_TARPIT;
|
|
req->analyse_exp = tick_add_ifset(now_ms, t->be->timeout.tarpit);
|
|
if (!req->analyse_exp)
|
|
req->analyse_exp = now_ms;
|
|
}
|
|
|
|
/* OK let's go on with the BODY now */
|
|
goto end_of_headers;
|
|
|
|
return_bad_req: /* let's centralize all bad requests */
|
|
txn->req.msg_state = HTTP_MSG_ERROR;
|
|
txn->status = 400;
|
|
req->analysers = 0;
|
|
client_retnclose(t, error_message(t, HTTP_ERR_400));
|
|
t->fe->failed_req++;
|
|
return_prx_cond:
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 0;
|
|
end_of_headers:
|
|
; // to keep gcc happy
|
|
}
|
|
|
|
if (req->analysers & AN_REQ_HTTP_TARPIT) {
|
|
struct http_txn *txn = &t->txn;
|
|
|
|
/* This connection is being tarpitted. The CLIENT side has
|
|
* already set the connect expiration date to the right
|
|
* timeout. We just have to check that the client is still
|
|
* there and that the timeout has not expired.
|
|
*/
|
|
if ((req->flags & (BF_SHUTR|BF_READ_ERROR)) == 0 &&
|
|
!tick_is_expired(req->analyse_exp, now_ms))
|
|
return 0;
|
|
|
|
/* We will set the queue timer to the time spent, just for
|
|
* logging purposes. We fake a 500 server error, so that the
|
|
* attacker will not suspect his connection has been tarpitted.
|
|
* It will not cause trouble to the logs because we can exclude
|
|
* the tarpitted connections by filtering on the 'PT' status flags.
|
|
*/
|
|
trace_term(t, TT_HTTP_SRV_2);
|
|
t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
|
|
txn->status = 500;
|
|
if (req->flags != BF_READ_ERROR)
|
|
client_retnclose(t, error_message(t, HTTP_ERR_500));
|
|
|
|
req->analysers = 0;
|
|
req->analyse_exp = TICK_ETERNITY;
|
|
|
|
t->fe->failed_req++;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_T;
|
|
return 0;
|
|
}
|
|
|
|
if (req->analysers & AN_REQ_HTTP_BODY) {
|
|
/* We have to parse the HTTP request body to find any required data.
|
|
* "balance url_param check_post" should have been the only way to get
|
|
* into this. We were brought here after HTTP header analysis, so all
|
|
* related structures are ready.
|
|
*/
|
|
struct http_msg *msg = &t->txn.req;
|
|
unsigned long body = msg->sol[msg->eoh] == '\r' ? msg->eoh + 2 : msg->eoh + 1;
|
|
long long limit = t->be->url_param_post_limit;
|
|
struct hdr_ctx ctx;
|
|
|
|
ctx.idx = 0;
|
|
|
|
/* now if we have a length, we'll take the hint */
|
|
http_find_header2("Transfer-Encoding", 17, msg->sol, &t->txn.hdr_idx, &ctx);
|
|
if (ctx.idx && ctx.vlen >= 7 && strncasecmp(ctx.line+ctx.val, "chunked", 7) == 0) {
|
|
unsigned int chunk = 0;
|
|
while (body < req->l && !HTTP_IS_CRLF(msg->sol[body])) {
|
|
char c = msg->sol[body];
|
|
if (ishex(c)) {
|
|
unsigned int hex = toupper(c) - '0';
|
|
if (hex > 9)
|
|
hex -= 'A' - '9' - 1;
|
|
chunk = (chunk << 4) | hex;
|
|
} else
|
|
break;
|
|
body++;
|
|
}
|
|
if (body + 2 >= req->l) /* we want CRLF too */
|
|
goto http_body_end; /* end of buffer? data missing! */
|
|
|
|
if (memcmp(msg->sol+body, "\r\n", 2) != 0)
|
|
goto http_body_end; /* chunked encoding len ends with CRLF, and we don't have it yet */
|
|
|
|
body += 2; // skip CRLF
|
|
|
|
/* if we support more then one chunk here, we have to do it again when assigning server
|
|
* 1. how much entity data do we have? new var
|
|
* 2. should save entity_start, entity_cursor, elen & rlen in req; so we don't repeat scanning here
|
|
* 3. test if elen > limit, or set new limit to elen if 0 (end of entity found)
|
|
*/
|
|
|
|
if (chunk < limit)
|
|
limit = chunk; /* only reading one chunk */
|
|
} else {
|
|
if (msg->hdr_content_len < limit)
|
|
limit = msg->hdr_content_len;
|
|
}
|
|
|
|
http_body_end:
|
|
/* we leave once we know we have nothing left to do. This means that we have
|
|
* enough bytes, or that we know we'll not get any more (buffer full, read
|
|
* buffer closed).
|
|
*/
|
|
if (req->l - body >= limit || /* enough bytes! */
|
|
req->flags & (BF_FULL | BF_READ_ERROR | BF_SHUTR | BF_READ_TIMEOUT) ||
|
|
tick_is_expired(req->analyse_exp, now_ms)) {
|
|
/* The situation will not evolve, so let's give up on the analysis. */
|
|
t->logs.tv_request = now; /* update the request timer to reflect full request */
|
|
req->analysers &= ~AN_REQ_HTTP_BODY;
|
|
req->analyse_exp = TICK_ETERNITY;
|
|
}
|
|
else {
|
|
/* Not enough data. We'll re-use the http-request
|
|
* timeout here. Ideally, we should set the timeout
|
|
* relative to the accept() date. We just set the
|
|
* request timeout once at the beginning of the
|
|
* request.
|
|
*/
|
|
buffer_write_dis(req);
|
|
if (!tick_isset(req->analyse_exp))
|
|
req->analyse_exp = tick_add_ifset(now_ms, t->fe->timeout.httpreq);
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
/* Note: eventhough nobody should set an unknown flag, clearing them right now will
|
|
* probably reduce one day's debugging session.
|
|
*/
|
|
#ifdef DEBUG_DEV
|
|
if (req->analysers & ~(AN_REQ_INSPECT | AN_REQ_HTTP_HDR | AN_REQ_HTTP_TARPIT | AN_REQ_HTTP_BODY)) {
|
|
fprintf(stderr, "FIXME !!!! unknown analysers flags %s:%d = 0x%08X\n",
|
|
__FILE__, __LINE__, req->analysers);
|
|
ABORT_NOW();
|
|
}
|
|
#endif
|
|
req->analysers &= AN_REQ_INSPECT | AN_REQ_HTTP_HDR | AN_REQ_HTTP_TARPIT | AN_REQ_HTTP_BODY;
|
|
return 0;
|
|
}
|
|
|
|
/* This function performs all the processing enabled for the current response.
|
|
* It normally returns zero, but may return 1 if it absolutely needs to be
|
|
* called again after other functions. It relies on buffers flags, and updates
|
|
* t->rep->analysers. It might make sense to explode it into several other
|
|
* functions. It works like process_request (see indications above).
|
|
*/
|
|
int process_response(struct session *t)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
struct buffer *req = t->req;
|
|
struct buffer *rep = t->rep;
|
|
|
|
DPRINTF(stderr,"[%u] %s: session=%p b=%p, exp(r,w)=%u,%u bf=%08x bl=%d analysers=%02x\n",
|
|
now_ms, __FUNCTION__,
|
|
t,
|
|
rep,
|
|
rep->rex, rep->wex,
|
|
rep->flags,
|
|
rep->l,
|
|
rep->analysers);
|
|
|
|
if (rep->analysers & AN_RTR_HTTP_HDR) { /* receiving server headers */
|
|
/*
|
|
* Now parse the partial (or complete) lines.
|
|
* We will check the response syntax, and also join multi-line
|
|
* headers. An index of all the lines will be elaborated while
|
|
* parsing.
|
|
*
|
|
* For the parsing, we use a 28 states FSM.
|
|
*
|
|
* Here is the information we currently have :
|
|
* rep->data + rep->som = beginning of response
|
|
* rep->data + rep->eoh = end of processed headers / start of current one
|
|
* rep->data + rep->eol = end of current header or line (LF or CRLF)
|
|
* rep->lr = first non-visited byte
|
|
* rep->r = end of data
|
|
*/
|
|
|
|
int cur_idx;
|
|
struct http_msg *msg = &txn->rsp;
|
|
struct proxy *cur_proxy;
|
|
|
|
if (likely(rep->lr < rep->r))
|
|
http_msg_analyzer(rep, msg, &txn->hdr_idx);
|
|
|
|
/* 1: we might have to print this header in debug mode */
|
|
if (unlikely((global.mode & MODE_DEBUG) &&
|
|
(!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE)) &&
|
|
(msg->msg_state == HTTP_MSG_BODY || msg->msg_state == HTTP_MSG_ERROR))) {
|
|
char *eol, *sol;
|
|
|
|
sol = rep->data + msg->som;
|
|
eol = sol + msg->sl.rq.l;
|
|
debug_hdr("srvrep", t, sol, eol);
|
|
|
|
sol += hdr_idx_first_pos(&txn->hdr_idx);
|
|
cur_idx = hdr_idx_first_idx(&txn->hdr_idx);
|
|
|
|
while (cur_idx) {
|
|
eol = sol + txn->hdr_idx.v[cur_idx].len;
|
|
debug_hdr("srvhdr", t, sol, eol);
|
|
sol = eol + txn->hdr_idx.v[cur_idx].cr + 1;
|
|
cur_idx = txn->hdr_idx.v[cur_idx].next;
|
|
}
|
|
}
|
|
|
|
/*
|
|
* Now we quickly check if we have found a full valid response.
|
|
* If not so, we check the FD and buffer states before leaving.
|
|
* A full response is indicated by the fact that we have seen
|
|
* the double LF/CRLF, so the state is HTTP_MSG_BODY. Invalid
|
|
* responses are checked first.
|
|
*
|
|
* Depending on whether the client is still there or not, we
|
|
* may send an error response back or not. Note that normally
|
|
* we should only check for HTTP status there, and check I/O
|
|
* errors somewhere else.
|
|
*/
|
|
|
|
if (unlikely(msg->msg_state != HTTP_MSG_BODY)) {
|
|
/* Invalid response */
|
|
if (unlikely(msg->msg_state == HTTP_MSG_ERROR)) {
|
|
hdr_response_bad:
|
|
//buffer_shutr(rep);
|
|
//buffer_shutw(req);
|
|
//fd_delete(req->cons->fd);
|
|
//req->cons->state = SI_ST_CLO;
|
|
buffer_shutr_now(rep);
|
|
buffer_shutw_now(req);
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_resp++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
t->be->failed_resp++;
|
|
rep->analysers = 0;
|
|
txn->status = 502;
|
|
client_return(t, error_message(t, HTTP_ERR_502));
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
|
|
//if (t->srv && may_dequeue_tasks(t->srv, t->be))
|
|
// process_srv_queue(t->srv);
|
|
|
|
return 0;
|
|
}
|
|
/* too large response does not fit in buffer. */
|
|
else if (rep->flags & BF_FULL) {
|
|
goto hdr_response_bad;
|
|
}
|
|
/* read error */
|
|
else if (rep->flags & BF_READ_ERROR) {
|
|
buffer_shutr_now(rep);
|
|
buffer_shutw_now(req);
|
|
//fd_delete(req->cons->fd);
|
|
//req->cons->state = SI_ST_CLO;
|
|
//if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
//t->srv->failed_resp++;
|
|
//sess_change_server(t, NULL);
|
|
//}
|
|
//t->be->failed_resp++;
|
|
rep->analysers = 0;
|
|
txn->status = 502;
|
|
client_return(t, error_message(t, HTTP_ERR_502));
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
|
|
//if (t->srv && may_dequeue_tasks(t->srv, t->be))
|
|
// process_srv_queue(t->srv);
|
|
|
|
return 0;
|
|
}
|
|
/* read timeout : return a 504 to the client. */
|
|
else if (rep->flags & BF_READ_TIMEOUT) {
|
|
buffer_shutr_now(rep);
|
|
buffer_shutw_now(req);
|
|
//fd_delete(req->cons->fd);
|
|
//req->cons->state = SI_ST_CLO;
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_resp++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
t->be->failed_resp++;
|
|
rep->analysers = 0;
|
|
txn->status = 504;
|
|
client_return(t, error_message(t, HTTP_ERR_504));
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVTO;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
|
|
//if (t->srv && may_dequeue_tasks(t->srv, t->be))
|
|
// process_srv_queue(t->srv);
|
|
return 0;
|
|
}
|
|
/* write error to client, or close from server */
|
|
else if (rep->flags & (BF_WRITE_ERROR|BF_SHUTR)) {
|
|
buffer_shutr_now(rep);
|
|
buffer_shutw_now(req);
|
|
//fd_delete(req->cons->fd);
|
|
//req->cons->state = SI_ST_CLO;
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_resp++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
t->be->failed_resp++;
|
|
rep->analysers = 0;
|
|
txn->status = 502;
|
|
client_return(t, error_message(t, HTTP_ERR_502));
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_SRVCL;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
|
|
//if (t->srv && may_dequeue_tasks(t->srv, t->be))
|
|
// process_srv_queue(t->srv);
|
|
|
|
return 0;
|
|
}
|
|
buffer_write_dis(rep);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*****************************************************************
|
|
* More interesting part now : we know that we have a complete *
|
|
* response which at least looks like HTTP. We have an indicator *
|
|
* of each header's length, so we can parse them quickly. *
|
|
****************************************************************/
|
|
|
|
rep->analysers &= ~AN_RTR_HTTP_HDR;
|
|
|
|
/* ensure we keep this pointer to the beginning of the message */
|
|
msg->sol = rep->data + msg->som;
|
|
|
|
/*
|
|
* 1: get the status code and check for cacheability.
|
|
*/
|
|
|
|
t->logs.logwait &= ~LW_RESP;
|
|
txn->status = strl2ui(rep->data + msg->sl.st.c, msg->sl.st.c_l);
|
|
|
|
switch (txn->status) {
|
|
case 200:
|
|
case 203:
|
|
case 206:
|
|
case 300:
|
|
case 301:
|
|
case 410:
|
|
/* RFC2616 @13.4:
|
|
* "A response received with a status code of
|
|
* 200, 203, 206, 300, 301 or 410 MAY be stored
|
|
* by a cache (...) unless a cache-control
|
|
* directive prohibits caching."
|
|
*
|
|
* RFC2616 @9.5: POST method :
|
|
* "Responses to this method are not cacheable,
|
|
* unless the response includes appropriate
|
|
* Cache-Control or Expires header fields."
|
|
*/
|
|
if (likely(txn->meth != HTTP_METH_POST) &&
|
|
(t->be->options & (PR_O_CHK_CACHE|PR_O_COOK_NOC)))
|
|
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
|
|
break;
|
|
default:
|
|
break;
|
|
}
|
|
|
|
/*
|
|
* 2: we may need to capture headers
|
|
*/
|
|
if (unlikely((t->logs.logwait & LW_RSPHDR) && t->fe->rsp_cap))
|
|
capture_headers(rep->data + msg->som, &txn->hdr_idx,
|
|
txn->rsp.cap, t->fe->rsp_cap);
|
|
|
|
/*
|
|
* 3: we will have to evaluate the filters.
|
|
* As opposed to version 1.2, now they will be evaluated in the
|
|
* filters order and not in the header order. This means that
|
|
* each filter has to be validated among all headers.
|
|
*
|
|
* Filters are tried with ->be first, then with ->fe if it is
|
|
* different from ->be.
|
|
*/
|
|
|
|
t->flags &= ~SN_CONN_CLOSED; /* prepare for inspection */
|
|
|
|
cur_proxy = t->be;
|
|
while (1) {
|
|
struct proxy *rule_set = cur_proxy;
|
|
|
|
/* try headers filters */
|
|
if (rule_set->rsp_exp != NULL) {
|
|
if (apply_filters_to_response(t, rep, rule_set->rsp_exp) < 0) {
|
|
return_bad_resp:
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_resp++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
cur_proxy->failed_resp++;
|
|
return_srv_prx_502:
|
|
buffer_shutr_now(rep);
|
|
buffer_shutw_now(req);
|
|
//fd_delete(req->cons->fd);
|
|
//req->cons->state = SI_ST_CLO;
|
|
rep->analysers = 0;
|
|
txn->status = 502;
|
|
client_return(t, error_message(t, HTTP_ERR_502));
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_H;
|
|
/* We used to have a free connection slot. Since we'll never use it,
|
|
* we have to inform the server that it may be used by another session.
|
|
*/
|
|
//if (t->srv && may_dequeue_tasks(t->srv, cur_proxy))
|
|
// process_srv_queue(t->srv);
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
/* has the response been denied ? */
|
|
if (txn->flags & TX_SVDENY) {
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_secu++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
cur_proxy->denied_resp++;
|
|
goto return_srv_prx_502;
|
|
}
|
|
|
|
/* We might have to check for "Connection:" */
|
|
if (((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO)) &&
|
|
!(t->flags & SN_CONN_CLOSED)) {
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx, delta, val;
|
|
struct hdr_idx_elem *cur_hdr;
|
|
|
|
cur_next = rep->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
old_idx = 0;
|
|
|
|
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Connection", 10);
|
|
if (val) {
|
|
/* 3 possibilities :
|
|
* - we have already set Connection: close,
|
|
* so we remove this line.
|
|
* - we have not yet set Connection: close,
|
|
* but this line indicates close. We leave
|
|
* it untouched and set the flag.
|
|
* - we have not yet set Connection: close,
|
|
* and this line indicates non-close. We
|
|
* replace it.
|
|
*/
|
|
if (t->flags & SN_CONN_CLOSED) {
|
|
delta = buffer_replace2(rep, cur_ptr, cur_next, NULL, 0);
|
|
txn->rsp.eoh += delta;
|
|
cur_next += delta;
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
} else {
|
|
if (strncasecmp(cur_ptr + val, "close", 5) != 0) {
|
|
delta = buffer_replace2(rep, cur_ptr + val, cur_end,
|
|
"close", 5);
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->rsp.eoh += delta;
|
|
}
|
|
t->flags |= SN_CONN_CLOSED;
|
|
}
|
|
}
|
|
old_idx = cur_idx;
|
|
}
|
|
}
|
|
|
|
/* add response headers from the rule sets in the same order */
|
|
for (cur_idx = 0; cur_idx < rule_set->nb_rspadd; cur_idx++) {
|
|
if (unlikely(http_header_add_tail(rep, &txn->rsp, &txn->hdr_idx,
|
|
rule_set->rsp_add[cur_idx])) < 0)
|
|
goto return_bad_resp;
|
|
}
|
|
|
|
/* check whether we're already working on the frontend */
|
|
if (cur_proxy == t->fe)
|
|
break;
|
|
cur_proxy = t->fe;
|
|
}
|
|
|
|
/*
|
|
* 4: check for server cookie.
|
|
*/
|
|
if (t->be->cookie_name || t->be->appsession_name || t->be->capture_name
|
|
|| (t->be->options & PR_O_CHK_CACHE))
|
|
manage_server_side_cookies(t, rep);
|
|
|
|
|
|
/*
|
|
* 5: check for cache-control or pragma headers if required.
|
|
*/
|
|
if ((t->be->options & (PR_O_COOK_NOC | PR_O_CHK_CACHE)) != 0)
|
|
check_response_for_cacheability(t, rep);
|
|
|
|
/*
|
|
* 6: add server cookie in the response if needed
|
|
*/
|
|
if ((t->srv) && !(t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_INS) &&
|
|
(!(t->be->options & PR_O_COOK_POST) || (txn->meth == HTTP_METH_POST))) {
|
|
int len;
|
|
|
|
/* the server is known, it's not the one the client requested, we have to
|
|
* insert a set-cookie here, except if we want to insert only on POST
|
|
* requests and this one isn't. Note that servers which don't have cookies
|
|
* (eg: some backup servers) will return a full cookie removal request.
|
|
*/
|
|
len = sprintf(trash, "Set-Cookie: %s=%s; path=/",
|
|
t->be->cookie_name,
|
|
t->srv->cookie ? t->srv->cookie : "; Expires=Thu, 01-Jan-1970 00:00:01 GMT");
|
|
|
|
if (t->be->cookie_domain)
|
|
len += sprintf(trash+len, "; domain=%s", t->be->cookie_domain);
|
|
|
|
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
|
|
trash, len)) < 0)
|
|
goto return_bad_resp;
|
|
txn->flags |= TX_SCK_INSERTED;
|
|
|
|
/* Here, we will tell an eventual cache on the client side that we don't
|
|
* want it to cache this reply because HTTP/1.0 caches also cache cookies !
|
|
* Some caches understand the correct form: 'no-cache="set-cookie"', but
|
|
* others don't (eg: apache <= 1.3.26). So we use 'private' instead.
|
|
*/
|
|
if ((t->be->options & PR_O_COOK_NOC) && (txn->flags & TX_CACHEABLE)) {
|
|
|
|
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
|
|
|
|
if (unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
|
|
"Cache-control: private", 22)) < 0)
|
|
goto return_bad_resp;
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* 7: check if result will be cacheable with a cookie.
|
|
* We'll block the response if security checks have caught
|
|
* nasty things such as a cacheable cookie.
|
|
*/
|
|
if (((txn->flags & (TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) ==
|
|
(TX_CACHEABLE | TX_CACHE_COOK | TX_SCK_ANY)) &&
|
|
(t->be->options & PR_O_CHK_CACHE)) {
|
|
|
|
/* we're in presence of a cacheable response containing
|
|
* a set-cookie header. We'll block it as requested by
|
|
* the 'checkcache' option, and send an alert.
|
|
*/
|
|
if (t->srv) {
|
|
//t->srv->cur_sess--;
|
|
t->srv->failed_secu++;
|
|
//sess_change_server(t, NULL);
|
|
}
|
|
t->be->denied_resp++;
|
|
|
|
Alert("Blocking cacheable cookie in response from instance %s, server %s.\n",
|
|
t->be->id, t->srv?t->srv->id:"<dispatch>");
|
|
send_log(t->be, LOG_ALERT,
|
|
"Blocking cacheable cookie in response from instance %s, server %s.\n",
|
|
t->be->id, t->srv?t->srv->id:"<dispatch>");
|
|
goto return_srv_prx_502;
|
|
}
|
|
|
|
/*
|
|
* 8: add "Connection: close" if needed and not yet set.
|
|
* Note that we do not need to add it in case of HTTP/1.0.
|
|
*/
|
|
if (!(t->flags & SN_CONN_CLOSED) &&
|
|
((t->fe->options | t->be->options) & (PR_O_HTTP_CLOSE|PR_O_FORCE_CLO))) {
|
|
if ((unlikely(msg->sl.st.v_l != 8) ||
|
|
unlikely(req->data[msg->som + 7] != '0')) &&
|
|
unlikely(http_header_add_tail2(rep, &txn->rsp, &txn->hdr_idx,
|
|
"Connection: close", 17)) < 0)
|
|
goto return_bad_resp;
|
|
t->flags |= SN_CONN_CLOSED;
|
|
}
|
|
|
|
/*************************************************************
|
|
* OK, that's finished for the headers. We have done what we *
|
|
* could. Let's switch to the DATA state. *
|
|
************************************************************/
|
|
|
|
buffer_set_rlim(rep, BUFSIZE); /* no more rewrite needed */
|
|
t->logs.t_data = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
|
|
#ifdef CONFIG_HAP_TCPSPLICE
|
|
if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
|
|
/* TCP splicing supported by both FE and BE */
|
|
tcp_splice_splicefd(rep->cons->fd, rep->prod->fd, 0);
|
|
}
|
|
#endif
|
|
/* if the user wants to log as soon as possible, without counting
|
|
* bytes from the server, then this is the right moment. We have
|
|
* to temporarily assign bytes_out to log what we currently have.
|
|
*/
|
|
if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
|
|
t->logs.t_close = t->logs.t_data; /* to get a valid end date */
|
|
t->logs.bytes_out = txn->rsp.eoh;
|
|
if (t->fe->to_log & LW_REQ)
|
|
http_sess_log(t);
|
|
else
|
|
tcp_sess_log(t);
|
|
t->logs.bytes_out = 0;
|
|
}
|
|
|
|
/* Note: we must not try to cheat by jumping directly to DATA,
|
|
* otherwise we would not let the client side wake up.
|
|
*/
|
|
|
|
return 0;
|
|
}
|
|
|
|
/* Note: eventhough nobody should set an unknown flag, clearing them right now will
|
|
* probably reduce one day's debugging session.
|
|
*/
|
|
#ifdef DEBUG_DEV
|
|
if (rep->analysers & ~(AN_RTR_HTTP_HDR)) {
|
|
fprintf(stderr, "FIXME !!!! unknown analysers flags %s:%d = 0x%08X\n",
|
|
__FILE__, __LINE__, rep->analysers);
|
|
ABORT_NOW();
|
|
}
|
|
#endif
|
|
rep->analysers &= AN_RTR_HTTP_HDR;
|
|
return 0;
|
|
}
|
|
|
|
///*
|
|
// * Manages the client FSM and its socket. It normally returns zero, but may
|
|
// * return 1 if it absolutely wants to be called again.
|
|
// *
|
|
// * Note: process_cli is the ONLY function allowed to set cli_state to anything
|
|
// * but CL_STCLOSE.
|
|
// */
|
|
//int process_cli(struct session *t)
|
|
//{
|
|
// struct buffer *req = t->req;
|
|
// struct buffer *rep = t->rep;
|
|
//
|
|
// DPRINTF(stderr,"[%u] %s: fd=%d[%d] c=%s set(r,w)=%d,%d exp(r,w)=%u,%u req=%08x rep=%08x rql=%d rpl=%d\n",
|
|
// now_ms, __FUNCTION__,
|
|
// t->cli_fd, t->cli_fd >= 0 ? fdtab[t->cli_fd].state : 0, /* fd,state*/
|
|
// cli_stnames[t->cli_state],
|
|
// t->cli_fd >= 0 && fdtab[t->cli_fd].state != FD_STCLOSE ? EV_FD_ISSET(t->cli_fd, DIR_RD) : 0,
|
|
// t->cli_fd >= 0 && fdtab[t->cli_fd].state != FD_STCLOSE ? EV_FD_ISSET(t->cli_fd, DIR_WR) : 0,
|
|
// req->rex, rep->wex,
|
|
// req->flags, rep->flags,
|
|
// req->l, rep->l);
|
|
//
|
|
// update_state:
|
|
// /* FIXME: we still have to check for CL_STSHUTR because client_retnclose
|
|
// * still set this state (and will do until unix sockets are converted).
|
|
// */
|
|
// if (t->cli_state == CL_STDATA || t->cli_state == CL_STSHUTR) {
|
|
// /* we can skip most of the tests at once if some conditions are not met */
|
|
// if (!((fdtab[t->cli_fd].state == FD_STERROR) ||
|
|
// (req->flags & (BF_READ_TIMEOUT|BF_READ_ERROR|BF_SHUTR_NOW)) ||
|
|
// (rep->flags & (BF_WRITE_TIMEOUT|BF_WRITE_ERROR|BF_SHUTW_NOW)) ||
|
|
// (!(req->flags & BF_SHUTR) && req->flags & (BF_READ_NULL|BF_SHUTW)) ||
|
|
// (!(rep->flags & BF_SHUTW) &&
|
|
// (rep->flags & (BF_EMPTY|BF_MAY_FORWARD|BF_SHUTR)) == (BF_EMPTY|BF_MAY_FORWARD|BF_SHUTR))))
|
|
// goto update_timeouts;
|
|
//
|
|
// /* read or write error */
|
|
// if (fdtab[t->cli_fd].state == FD_STERROR) {
|
|
// buffer_shutr(req);
|
|
// req->flags |= BF_READ_ERROR;
|
|
// buffer_shutw(rep);
|
|
// rep->flags |= BF_WRITE_ERROR;
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_1);
|
|
// if (!req->analysers) {
|
|
// if (!(t->flags & SN_ERR_MASK))
|
|
// t->flags |= SN_ERR_CLICL;
|
|
// if (!(t->flags & SN_FINST_MASK)) {
|
|
// if (req->cons->err_type <= SI_ET_QUEUE_ABRT)
|
|
// t->flags |= SN_FINST_Q;
|
|
// else if (req->cons->err_type <= SI_ET_CONN_OTHER)
|
|
// t->flags |= SN_FINST_C;
|
|
// else
|
|
// t->flags |= SN_FINST_D;
|
|
// }
|
|
// }
|
|
// goto update_state;
|
|
// }
|
|
// /* last read, or end of server write */
|
|
// else if (!(req->flags & BF_SHUTR) && /* not already done */
|
|
// req->flags & (BF_READ_NULL|BF_SHUTR_NOW|BF_SHUTW)) {
|
|
// buffer_shutr(req);
|
|
// if (!(rep->flags & BF_SHUTW)) {
|
|
// EV_FD_CLR(t->cli_fd, DIR_RD);
|
|
// trace_term(t, TT_HTTP_CLI_2);
|
|
// } else {
|
|
// /* output was already closed */
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_3);
|
|
// }
|
|
// goto update_state;
|
|
// }
|
|
// /* last server read and buffer empty : we only check them when we're
|
|
// * allowed to forward the data.
|
|
// */
|
|
// else if (!(rep->flags & BF_SHUTW) && /* not already done */
|
|
// ((rep->flags & BF_SHUTW_NOW) ||
|
|
// (rep->flags & BF_EMPTY && rep->flags & BF_MAY_FORWARD &&
|
|
// rep->flags & BF_SHUTR && !(t->flags & SN_SELF_GEN)))) {
|
|
// buffer_shutw(rep);
|
|
// if (!(req->flags & BF_SHUTR)) {
|
|
// EV_FD_CLR(t->cli_fd, DIR_WR);
|
|
// shutdown(t->cli_fd, SHUT_WR);
|
|
// trace_term(t, TT_HTTP_CLI_4);
|
|
// } else {
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_5);
|
|
// }
|
|
// goto update_state;
|
|
// }
|
|
// /* read timeout */
|
|
// else if ((req->flags & (BF_SHUTR|BF_READ_TIMEOUT)) == BF_READ_TIMEOUT) {
|
|
// buffer_shutr(req);
|
|
// if (!(rep->flags & BF_SHUTW)) {
|
|
// EV_FD_CLR(t->cli_fd, DIR_RD);
|
|
// trace_term(t, TT_HTTP_CLI_6);
|
|
// } else {
|
|
// /* output was already closed */
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_7);
|
|
// }
|
|
// if (!req->analysers) {
|
|
// if (!(t->flags & SN_ERR_MASK))
|
|
// t->flags |= SN_ERR_CLITO;
|
|
// if (!(t->flags & SN_FINST_MASK)) {
|
|
// if (req->cons->err_type <= SI_ET_QUEUE_ABRT)
|
|
// t->flags |= SN_FINST_Q;
|
|
// else if (req->cons->err_type <= SI_ET_CONN_OTHER)
|
|
// t->flags |= SN_FINST_C;
|
|
// else
|
|
// t->flags |= SN_FINST_D;
|
|
// }
|
|
// }
|
|
// goto update_state;
|
|
// }
|
|
// /* write timeout */
|
|
// else if ((rep->flags & (BF_SHUTW|BF_WRITE_TIMEOUT)) == BF_WRITE_TIMEOUT) {
|
|
// buffer_shutw(rep);
|
|
// if (!(req->flags & BF_SHUTR)) {
|
|
// EV_FD_CLR(t->cli_fd, DIR_WR);
|
|
// shutdown(t->cli_fd, SHUT_WR);
|
|
// trace_term(t, TT_HTTP_CLI_8);
|
|
// } else {
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_9);
|
|
// }
|
|
// if (!req->analysers) {
|
|
// if (!(t->flags & SN_ERR_MASK))
|
|
// t->flags |= SN_ERR_CLITO;
|
|
// if (!(t->flags & SN_FINST_MASK)) {
|
|
// if (req->cons->err_type <= SI_ET_QUEUE_ABRT)
|
|
// t->flags |= SN_FINST_Q;
|
|
// else if (req->cons->err_type <= SI_ET_CONN_OTHER)
|
|
// t->flags |= SN_FINST_C;
|
|
// else
|
|
// t->flags |= SN_FINST_D;
|
|
// }
|
|
// }
|
|
// goto update_state;
|
|
// }
|
|
//
|
|
// update_timeouts:
|
|
// /* manage read timeout */
|
|
// if (!(req->flags & BF_SHUTR)) {
|
|
// if (req->flags & BF_FULL) {
|
|
// /* no room to read more data */
|
|
// if (EV_FD_COND_C(t->cli_fd, DIR_RD)) {
|
|
// /* stop reading until we get some space */
|
|
// req->rex = TICK_ETERNITY;
|
|
// }
|
|
// } else {
|
|
// EV_FD_COND_S(t->cli_fd, DIR_RD);
|
|
// req->rex = tick_add_ifset(now_ms, t->fe->timeout.client);
|
|
// }
|
|
// }
|
|
//
|
|
// /* manage write timeout */
|
|
// if (!(rep->flags & BF_SHUTW)) {
|
|
// /* first, we may have to produce data (eg: stats).
|
|
// * right now, this is limited to the SHUTR state.
|
|
// */
|
|
// if (req->flags & BF_SHUTR && t->flags & SN_SELF_GEN) {
|
|
// produce_content(t);
|
|
// if (rep->flags & BF_EMPTY) {
|
|
// buffer_shutw(rep);
|
|
// fd_delete(t->cli_fd);
|
|
// t->cli_state = CL_STCLOSE;
|
|
// trace_term(t, TT_HTTP_CLI_10);
|
|
// goto update_state;
|
|
// }
|
|
// }
|
|
//
|
|
// /* we don't enable client write if the buffer is empty, nor if the server has to analyze it */
|
|
// if ((rep->flags & (BF_EMPTY|BF_MAY_FORWARD)) != BF_MAY_FORWARD) {
|
|
// if (EV_FD_COND_C(t->cli_fd, DIR_WR)) {
|
|
// /* stop writing */
|
|
// rep->wex = TICK_ETERNITY;
|
|
// }
|
|
// } else {
|
|
// /* buffer not empty */
|
|
// EV_FD_COND_S(t->cli_fd, DIR_WR);
|
|
// if (!tick_isset(rep->wex)) {
|
|
// /* restart writing */
|
|
// rep->wex = tick_add_ifset(now_ms, t->fe->timeout.client);
|
|
// if (!(req->flags & BF_SHUTR) && tick_isset(rep->wex) && tick_isset(req->rex)) {
|
|
// /* FIXME: to prevent the client from expiring read timeouts during writes,
|
|
// * we refresh it, except if it was already infinite. */
|
|
// req->rex = rep->wex;
|
|
// }
|
|
// }
|
|
// }
|
|
// }
|
|
// return 0; /* other cases change nothing */
|
|
// }
|
|
// else if (t->cli_state == CL_STCLOSE) { /* CL_STCLOSE: nothing to do */
|
|
// if ((global.mode & MODE_DEBUG) && (!(global.mode & MODE_QUIET) || (global.mode & MODE_VERBOSE))) {
|
|
// int len;
|
|
// len = sprintf(trash, "%08x:%s.clicls[%04x:%04x]\n", t->uniq_id, t->be->id, (unsigned short)t->cli_fd, (unsigned short)req->cons->fd);
|
|
// write(1, trash, len);
|
|
// }
|
|
// return 0;
|
|
// }
|
|
//#ifdef DEBUG_DEV
|
|
// fprintf(stderr, "FIXME !!!! impossible state at %s:%d = %d\n", __FILE__, __LINE__, t->cli_state);
|
|
// ABORT_NOW();
|
|
//#endif
|
|
// return 0;
|
|
//}
|
|
|
|
|
|
/* Return 1 if the pending connection has failed and should be retried,
|
|
* otherwise zero. We may only come here in SI_ST_CON state, which means that
|
|
* the socket's file descriptor is known.
|
|
*/
|
|
int tcp_connection_status(struct session *t)
|
|
{
|
|
struct buffer *req = t->req;
|
|
struct buffer *rep = t->rep;
|
|
int conn_err = 0;
|
|
|
|
DPRINTF(stderr,"[%u] %s: c=%s exp(r,w)=%u,%u req=%08x rep=%08x rql=%d rpl=%d\n",
|
|
now_ms, __FUNCTION__,
|
|
cli_stnames[t->cli_state],
|
|
rep->rex, req->wex,
|
|
req->flags, rep->flags,
|
|
req->l, rep->l);
|
|
|
|
if ((req->flags & BF_SHUTW_NOW) ||
|
|
(rep->flags & BF_SHUTW) ||
|
|
((req->flags & BF_SHUTR) && /* FIXME: this should not prevent a connection from establishing */
|
|
((req->flags & BF_EMPTY && !(req->flags & BF_WRITE_ACTIVITY)) ||
|
|
t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
|
|
|
|
trace_term(t, TT_HTTP_SRV_5);
|
|
req->wex = TICK_ETERNITY;
|
|
fd_delete(req->cons->fd);
|
|
if (t->srv) {
|
|
t->srv->cur_sess--;
|
|
sess_change_server(t, NULL);
|
|
}
|
|
/* note that this must not return any error because it would be able to
|
|
* overwrite the client_retnclose() output.
|
|
*/
|
|
//srv_close_with_err(t, SN_ERR_CLICL, SN_FINST_C, 0, NULL);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutw(req);
|
|
buffer_shutr(rep);
|
|
req->cons->state = SI_ST_CLO;
|
|
if (!req->cons->err_type)
|
|
req->cons->err_type = SI_ET_CONN_ABRT;
|
|
req->cons->err_loc = t->srv;
|
|
return 0;
|
|
}
|
|
|
|
/* check for timeouts and asynchronous connect errors */
|
|
if (fdtab[req->cons->fd].state == FD_STERROR) {
|
|
conn_err = SI_ET_CONN_ERR;
|
|
if (!req->cons->err_type)
|
|
req->cons->err_type = SI_ET_CONN_ERR;
|
|
}
|
|
else if (!(req->flags & BF_WRITE_ACTIVITY)) {
|
|
/* nothing happened, maybe we timed out */
|
|
if (tick_is_expired(req->wex, now_ms)) {
|
|
conn_err = SI_ET_CONN_TO;
|
|
if (!req->cons->err_type)
|
|
req->cons->err_type = SI_ET_CONN_TO;
|
|
}
|
|
else
|
|
return 0; /* let's wait a bit more */
|
|
}
|
|
|
|
if (conn_err) {
|
|
fd_delete(req->cons->fd);
|
|
req->cons->state = SI_ST_CLO;
|
|
|
|
if (t->srv) {
|
|
t->srv->cur_sess--;
|
|
sess_change_server(t, NULL);
|
|
req->cons->err_loc = t->srv;
|
|
}
|
|
|
|
/* ensure that we have enough retries left */
|
|
if (srv_count_retry_down(t, conn_err))
|
|
return 0;
|
|
|
|
if (conn_err == SI_ET_CONN_ERR) {
|
|
/* we encountered an immediate connection error, and we
|
|
* will have to retry connecting to the same server, most
|
|
* likely leading to the same result. To avoid this, we
|
|
* fake a connection timeout to retry after a turn-around
|
|
* time of 1 second. We will wait in the previous if block.
|
|
*/
|
|
req->cons->state = SI_ST_TAR;
|
|
req->cons->exp = tick_add(now_ms, MS_TO_TICKS(1000));
|
|
return 0;
|
|
}
|
|
|
|
if (t->srv && t->conn_retries == 0 && t->be->options & PR_O_REDISP) {
|
|
/* We're on our last chance, and the REDISP option was specified.
|
|
* We will ignore cookie and force to balance or use the dispatcher.
|
|
*/
|
|
/* let's try to offer this slot to anybody */
|
|
if (may_dequeue_tasks(t->srv, t->be))
|
|
process_srv_queue(t->srv);
|
|
|
|
/* it's left to the dispatcher to choose a server */
|
|
t->flags &= ~(SN_DIRECT | SN_ASSIGNED | SN_ADDR_SET);
|
|
t->prev_srv = t->srv;
|
|
} else {
|
|
/* we just want to retry */
|
|
if (t->srv)
|
|
t->srv->retries++;
|
|
t->be->retries++;
|
|
|
|
/* Now we will try to either reconnect to the same server or
|
|
* connect to another server. If the connection gets queued
|
|
* because all servers are saturated, then we will go back to
|
|
* the idle state where the buffer's consumer is marked as
|
|
* unknown.
|
|
*/
|
|
if (srv_retryable_connect(t)) {
|
|
/* success or unrecoverable error */
|
|
t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
/* We'll rely on the caller to try to get a connection again */
|
|
return 1;
|
|
}
|
|
else {
|
|
/* no error and write OK : connection succeeded */
|
|
t->logs.t_connect = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
req->cons->state = SI_ST_EST;
|
|
req->cons->err_type = SI_ET_NONE;
|
|
req->cons->err_loc = NULL;
|
|
|
|
if (req->flags & BF_EMPTY) {
|
|
EV_FD_CLR(req->cons->fd, DIR_WR);
|
|
req->wex = TICK_ETERNITY;
|
|
} else {
|
|
EV_FD_SET(req->cons->fd, DIR_WR);
|
|
req->wex = tick_add_ifset(now_ms, t->be->timeout.server);
|
|
if (tick_isset(req->wex)) {
|
|
/* FIXME: to prevent the server from expiring read timeouts during writes,
|
|
* we refresh it. */
|
|
rep->rex = req->wex;
|
|
}
|
|
}
|
|
|
|
if (t->be->mode == PR_MODE_TCP) { /* let's allow immediate data connection in this case */
|
|
if (!(rep->flags & BF_HIJACK)) {
|
|
EV_FD_SET(req->cons->fd, DIR_RD);
|
|
rep->rex = tick_add_ifset(now_ms, t->be->timeout.server);
|
|
}
|
|
buffer_set_rlim(rep, BUFSIZE); /* no rewrite needed */
|
|
|
|
/* if the user wants to log as soon as possible, without counting
|
|
bytes from the server, then this is the right moment. */
|
|
if (t->fe->to_log && !(t->logs.logwait & LW_BYTES)) {
|
|
t->logs.t_close = t->logs.t_connect; /* to get a valid end date */
|
|
tcp_sess_log(t);
|
|
}
|
|
#ifdef CONFIG_HAP_TCPSPLICE
|
|
if ((t->fe->options & t->be->options) & PR_O_TCPSPLICE) {
|
|
/* TCP splicing supported by both FE and BE */
|
|
tcp_splice_splicefd(req->prod->fd, req->cons->fd, 0);
|
|
}
|
|
#endif
|
|
}
|
|
else {
|
|
rep->analysers |= AN_RTR_HTTP_HDR;
|
|
buffer_set_rlim(rep, BUFSIZE - MAXREWRITE); /* rewrite needed */
|
|
t->txn.rsp.msg_state = HTTP_MSG_RPBEFORE;
|
|
/* reset hdr_idx which was already initialized by the request.
|
|
* right now, the http parser does it.
|
|
* hdr_idx_init(&t->txn.hdr_idx);
|
|
*/
|
|
}
|
|
|
|
rep->flags |= BF_READ_ATTACHED; /* producer is now attached */
|
|
req->wex = TICK_ETERNITY;
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* This function tries to assign a server to a stream_sock interface.
|
|
* It may be called only for t->req->cons->state = one of { SI_ST_INI,
|
|
* SI_ST_TAR, SI_ST_QUE }. It returns one of those states, SI_ST_ASS
|
|
* in case of success, or SI_ST_CLO in case of failure. It returns 1 if
|
|
* it returns SI_ST_ASS, otherwise zero.
|
|
*/
|
|
int stream_sock_assign_server(struct session *t)
|
|
{
|
|
DPRINTF(stderr,"[%u] %s: c=%s exp(r,w)=%u,%u req=%08x rep=%08x rql=%d rpl=%d\n",
|
|
now_ms, __FUNCTION__,
|
|
cli_stnames[t->cli_state],
|
|
t->rep->rex, t->req->wex,
|
|
t->req->flags, t->rep->flags,
|
|
t->req->l, t->rep->l);
|
|
|
|
if (t->req->cons->state == SI_ST_TAR) {
|
|
/* connection might be aborted */
|
|
if ((t->req->flags & BF_SHUTW_NOW) ||
|
|
(t->rep->flags & BF_SHUTW) ||
|
|
((t->req->flags & BF_SHUTR) && /* FIXME: this should not prevent a connection from establishing */
|
|
(t->req->flags & BF_EMPTY || t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
|
|
|
|
trace_term(t, TT_HTTP_SRV_1);
|
|
t->req->cons->exp = TICK_ETERNITY;
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_CONN_ABRT;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
|
|
if (!tick_is_expired(t->req->cons->exp, now_ms))
|
|
return 0; /* still in turn-around */
|
|
|
|
t->req->cons->state = SI_ST_INI;
|
|
t->req->cons->exp = TICK_ETERNITY;
|
|
}
|
|
else if (t->req->cons->state == SI_ST_QUE) {
|
|
if (t->pend_pos) {
|
|
/* request still in queue... */
|
|
if (tick_is_expired(t->req->cons->exp, now_ms)) {
|
|
/* ... and timeout expired */
|
|
trace_term(t, TT_HTTP_SRV_3);
|
|
t->req->cons->exp = TICK_ETERNITY;
|
|
t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
if (t->srv)
|
|
t->srv->failed_conns++;
|
|
t->be->failed_conns++;
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
t->req->flags |= BF_WRITE_TIMEOUT;
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_QUEUE_TO;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
/* connection remains in queue, check if we have to abort it */
|
|
if ((t->req->flags & BF_SHUTW_NOW) ||
|
|
(t->rep->flags & BF_SHUTW) ||
|
|
((t->req->flags & BF_SHUTR) && /* FIXME: this should not prevent a connection from establishing */
|
|
(t->req->flags & BF_EMPTY || t->be->options & PR_O_ABRT_CLOSE))) {
|
|
/* give up */
|
|
trace_term(t, TT_HTTP_SRV_1);
|
|
t->req->cons->exp = TICK_ETERNITY;
|
|
t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_QUEUE_ABRT;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
}
|
|
return 0;
|
|
}
|
|
/* The connection is not in the queue anymore */
|
|
t->req->cons->state = SI_ST_INI;
|
|
t->req->cons->exp = TICK_ETERNITY;
|
|
}
|
|
|
|
/* we may get here from above */
|
|
if (t->req->cons->state == SI_ST_INI) {
|
|
/* no connection in progress, we have to get a new one */
|
|
|
|
/* first, check if the connection has been aborted */
|
|
if ((t->req->flags & BF_SHUTW_NOW) ||
|
|
(t->rep->flags & BF_SHUTW) ||
|
|
((t->req->flags & BF_SHUTR) &&
|
|
(t->req->flags & BF_EMPTY || t->be->options & PR_O_ABRT_CLOSE))) { /* give up */
|
|
|
|
trace_term(t, TT_HTTP_SRV_1);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_CONN_ABRT;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
|
|
/* try to get a server assigned */
|
|
if (srv_redispatch_connect(t) != 0) {
|
|
/* we did not get any server, let's check the cause */
|
|
if (t->req->cons->state == SI_ST_QUE) {
|
|
/* the connection was queued, that's OK */
|
|
return 0;
|
|
}
|
|
|
|
trace_term(t, TT_HTTP_SRV_2);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
t->req->flags |= BF_WRITE_ERROR;
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_CONN_OTHER;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
|
|
t->req->cons->state = SI_ST_ASS;
|
|
/* Once the server is assigned, we have to return because
|
|
* the caller might be interested in checking several
|
|
* things before connecting.
|
|
*/
|
|
return 1;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* This function tries to establish a connection to an assigned server. It also
|
|
* performs connection retries. It may only be called with t->req->cons->state
|
|
* in { SI_ST_ASS, SI_ST_CON }. It may also set the state to SI_ST_INI,
|
|
* SI_ST_EST, or SI_ST_CLO.
|
|
*/
|
|
int stream_sock_connect_server(struct session *t)
|
|
{
|
|
if (t->req->cons->state == SI_ST_ASS) {
|
|
/* server assigned to request, we have to try to connect now */
|
|
|
|
if (!srv_retryable_connect(t)) {
|
|
/* we need to redispatch */
|
|
t->req->cons->state = SI_ST_INI;
|
|
return 0;
|
|
}
|
|
|
|
t->logs.t_queue = tv_ms_elapsed(&t->logs.tv_accept, &now);
|
|
if (t->req->cons->state != SI_ST_CON) {
|
|
/* it was an error */
|
|
trace_term(t, TT_HTTP_SRV_4);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutr(t->rep);
|
|
buffer_shutw(t->req);
|
|
t->req->flags |= BF_WRITE_ERROR;
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_CONN_OTHER;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
/* We have a socket and switched to SI_ST_CON */
|
|
}
|
|
|
|
/* we may also get here from above */
|
|
if (t->req->cons->state == SI_ST_CON) {
|
|
/* connection in progress or just completed */
|
|
if (!tcp_connection_status(t))
|
|
return 0;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* Tries to establish a connection to the server and associate it to the
|
|
* request buffer's consumer side. It is assumed that this function will not be
|
|
* be called with SI_ST_EST nor with BF_WRITE_ENA cleared. It normally
|
|
* returns zero, but may return 1 if it absolutely wants to be called again.
|
|
*/
|
|
int process_srv_conn(struct session *t)
|
|
{
|
|
DPRINTF(stderr,"[%u] %s: c=%s exp(r,w)=%u,%u req=%08x rep=%08x rql=%d rpl=%d\n",
|
|
now_ms, __FUNCTION__,
|
|
cli_stnames[t->cli_state],
|
|
t->rep->rex, t->req->wex,
|
|
t->req->flags, t->rep->flags,
|
|
t->req->l, t->rep->l);
|
|
|
|
do {
|
|
if (t->req->cons->state == SI_ST_INI ||
|
|
t->req->cons->state == SI_ST_TAR ||
|
|
t->req->cons->state == SI_ST_QUE) {
|
|
/* try to assign a server */
|
|
if (!stream_sock_assign_server(t))
|
|
return 0;
|
|
}
|
|
|
|
if (t->req->cons->state == SI_ST_ASS &&
|
|
t->srv && t->srv->rdr_len && t->flags & SN_REDIRECTABLE) {
|
|
/* Server supporting redirection and it is possible.
|
|
* Invalid requests are reported as such. It concerns all
|
|
* the largest ones.
|
|
*/
|
|
struct http_txn *txn = &t->txn;
|
|
struct chunk rdr;
|
|
char *path;
|
|
int len;
|
|
|
|
/* 1: create the response header */
|
|
rdr.len = strlen(HTTP_302);
|
|
rdr.str = trash;
|
|
memcpy(rdr.str, HTTP_302, rdr.len);
|
|
|
|
/* 2: add the server's prefix */
|
|
if (rdr.len + t->srv->rdr_len > sizeof(trash))
|
|
goto cancel_redir;
|
|
|
|
memcpy(rdr.str + rdr.len, t->srv->rdr_pfx, t->srv->rdr_len);
|
|
rdr.len += t->srv->rdr_len;
|
|
|
|
/* 3: add the request URI */
|
|
path = http_get_path(txn);
|
|
if (!path)
|
|
goto cancel_redir;
|
|
len = txn->req.sl.rq.u_l + (txn->req.sol+txn->req.sl.rq.u) - path;
|
|
if (rdr.len + len > sizeof(trash) - 4) /* 4 for CRLF-CRLF */
|
|
goto cancel_redir;
|
|
|
|
memcpy(rdr.str + rdr.len, path, len);
|
|
rdr.len += len;
|
|
memcpy(rdr.str + rdr.len, "\r\n\r\n", 4);
|
|
rdr.len += 4;
|
|
|
|
srv_close_with_err(t, SN_ERR_PRXCOND, SN_FINST_C, 302, &rdr);
|
|
trace_term(t, TT_HTTP_SRV_3);
|
|
|
|
/* FIXME: we should increase a counter of redirects per server and per backend. */
|
|
if (t->srv)
|
|
t->srv->cum_sess++;
|
|
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
cancel_redir:
|
|
//txn->status = 400;
|
|
//t->fe->failed_req++;
|
|
//srv_close_with_err(t, SN_ERR_PRXCOND, SN_FINST_C,
|
|
// 400, error_message(t, HTTP_ERR_400));
|
|
trace_term(t, TT_HTTP_SRV_4);
|
|
|
|
// FIXME: should we set rep->MAY_FORWARD ?
|
|
buffer_shutw(t->req);
|
|
buffer_shutr(t->rep);
|
|
if (!t->req->cons->err_type)
|
|
t->req->cons->err_type = SI_ET_CONN_OTHER;
|
|
t->req->cons->state = SI_ST_CLO;
|
|
return 0;
|
|
}
|
|
|
|
if (t->req->cons->state == SI_ST_CON ||
|
|
t->req->cons->state == SI_ST_ASS) {
|
|
stream_sock_connect_server(t);
|
|
}
|
|
} while (t->req->cons->state != SI_ST_CLO &&
|
|
t->req->cons->state != SI_ST_CON &&
|
|
t->req->cons->state != SI_ST_EST);
|
|
return 0;
|
|
}
|
|
|
|
|
|
/*
|
|
* Produces data for the session <s> depending on its source. Expects to be
|
|
* called with client socket shut down on input. Right now, only statistics can
|
|
* be produced. It stops by itself by unsetting the BF_HIJACK flag from the
|
|
* buffer, which it uses to keep on being called when there is free space in
|
|
* the buffer, or simply by letting an empty buffer upon return. It returns 1
|
|
* when it wants to stop sending data, otherwise 0.
|
|
*/
|
|
int produce_content(struct session *s)
|
|
{
|
|
if (s->data_source == DATA_SRC_NONE) {
|
|
buffer_stop_hijack(s->rep);
|
|
return 1;
|
|
}
|
|
else if (s->data_source == DATA_SRC_STATS) {
|
|
/* dump server statistics */
|
|
int ret = stats_dump_http(s, s->be->uri_auth);
|
|
if (ret >= 0)
|
|
return ret;
|
|
/* -1 indicates an error */
|
|
}
|
|
|
|
/* unknown data source or internal error */
|
|
s->txn.status = 500;
|
|
client_retnclose(s, error_message(s, HTTP_ERR_500));
|
|
trace_term(s, TT_HTTP_CNT_1);
|
|
if (!(s->flags & SN_ERR_MASK))
|
|
s->flags |= SN_ERR_PRXCOND;
|
|
if (!(s->flags & SN_FINST_MASK))
|
|
s->flags |= SN_FINST_R;
|
|
buffer_stop_hijack(s->rep);
|
|
return 1;
|
|
}
|
|
|
|
|
|
/* Iterate the same filter through all request headers.
|
|
* Returns 1 if this filter can be stopped upon return, otherwise 0.
|
|
* Since it can manage the switch to another backend, it updates the per-proxy
|
|
* DENY stats.
|
|
*/
|
|
int apply_filter_to_req_headers(struct session *t, struct buffer *req, struct hdr_exp *exp)
|
|
{
|
|
char term;
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx, last_hdr;
|
|
struct http_txn *txn = &t->txn;
|
|
struct hdr_idx_elem *cur_hdr;
|
|
int len, delta;
|
|
|
|
last_hdr = 0;
|
|
|
|
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
old_idx = 0;
|
|
|
|
while (!last_hdr) {
|
|
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
|
|
return 1;
|
|
else if (unlikely(txn->flags & TX_CLALLOW) &&
|
|
(exp->action == ACT_ALLOW ||
|
|
exp->action == ACT_DENY ||
|
|
exp->action == ACT_TARPIT))
|
|
return 0;
|
|
|
|
cur_idx = txn->hdr_idx.v[old_idx].next;
|
|
if (!cur_idx)
|
|
break;
|
|
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
/* Now we have one header between cur_ptr and cur_end,
|
|
* and the next header starts at cur_next.
|
|
*/
|
|
|
|
/* The annoying part is that pattern matching needs
|
|
* that we modify the contents to null-terminate all
|
|
* strings before testing them.
|
|
*/
|
|
|
|
term = *cur_end;
|
|
*cur_end = '\0';
|
|
|
|
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_SETBE:
|
|
/* It is not possible to jump a second time.
|
|
* FIXME: should we return an HTTP/500 here so that
|
|
* the admin knows there's a problem ?
|
|
*/
|
|
if (t->be != t->fe)
|
|
break;
|
|
|
|
/* Swithing Proxy */
|
|
t->be = (struct proxy *) exp->replace;
|
|
|
|
/* right now, the backend switch is not overly complicated
|
|
* because we have associated req_cap and rsp_cap to the
|
|
* frontend, and the beconn will be updated later.
|
|
*/
|
|
|
|
t->rep->rto = t->req->wto = t->be->timeout.server;
|
|
t->req->cto = t->be->timeout.connect;
|
|
t->conn_retries = t->be->conn_retries;
|
|
last_hdr = 1;
|
|
break;
|
|
|
|
case ACT_ALLOW:
|
|
txn->flags |= TX_CLALLOW;
|
|
last_hdr = 1;
|
|
break;
|
|
|
|
case ACT_DENY:
|
|
txn->flags |= TX_CLDENY;
|
|
last_hdr = 1;
|
|
t->be->denied_req++;
|
|
break;
|
|
|
|
case ACT_TARPIT:
|
|
txn->flags |= TX_CLTARPIT;
|
|
last_hdr = 1;
|
|
t->be->denied_req++;
|
|
break;
|
|
|
|
case ACT_REPLACE:
|
|
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
|
|
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
|
|
/* FIXME: if the user adds a newline in the replacement, the
|
|
* index will not be recalculated for now, and the new line
|
|
* will not be counted as a new header.
|
|
*/
|
|
|
|
cur_end += delta;
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->req.eoh += delta;
|
|
break;
|
|
|
|
case ACT_REMOVE:
|
|
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
|
|
cur_next += delta;
|
|
|
|
/* FIXME: this should be a separate function */
|
|
txn->req.eoh += delta;
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
cur_end = NULL; /* null-term has been rewritten */
|
|
break;
|
|
|
|
}
|
|
}
|
|
if (cur_end)
|
|
*cur_end = term; /* restore the string terminator */
|
|
|
|
/* keep the link from this header to next one in case of later
|
|
* removal of next header.
|
|
*/
|
|
old_idx = cur_idx;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/* Apply the filter to the request line.
|
|
* Returns 0 if nothing has been done, 1 if the filter has been applied,
|
|
* or -1 if a replacement resulted in an invalid request line.
|
|
* Since it can manage the switch to another backend, it updates the per-proxy
|
|
* DENY stats.
|
|
*/
|
|
int apply_filter_to_req_line(struct session *t, struct buffer *req, struct hdr_exp *exp)
|
|
{
|
|
char term;
|
|
char *cur_ptr, *cur_end;
|
|
int done;
|
|
struct http_txn *txn = &t->txn;
|
|
int len, delta;
|
|
|
|
|
|
if (unlikely(txn->flags & (TX_CLDENY | TX_CLTARPIT)))
|
|
return 1;
|
|
else if (unlikely(txn->flags & TX_CLALLOW) &&
|
|
(exp->action == ACT_ALLOW ||
|
|
exp->action == ACT_DENY ||
|
|
exp->action == ACT_TARPIT))
|
|
return 0;
|
|
else if (exp->action == ACT_REMOVE)
|
|
return 0;
|
|
|
|
done = 0;
|
|
|
|
cur_ptr = req->data + txn->req.som; /* should be equal to txn->sol */
|
|
cur_end = cur_ptr + txn->req.sl.rq.l;
|
|
|
|
/* Now we have the request line between cur_ptr and cur_end */
|
|
|
|
/* The annoying part is that pattern matching needs
|
|
* that we modify the contents to null-terminate all
|
|
* strings before testing them.
|
|
*/
|
|
|
|
term = *cur_end;
|
|
*cur_end = '\0';
|
|
|
|
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_SETBE:
|
|
/* It is not possible to jump a second time.
|
|
* FIXME: should we return an HTTP/500 here so that
|
|
* the admin knows there's a problem ?
|
|
*/
|
|
if (t->be != t->fe)
|
|
break;
|
|
|
|
/* Swithing Proxy */
|
|
t->be = (struct proxy *) exp->replace;
|
|
|
|
/* right now, the backend switch is not too much complicated
|
|
* because we have associated req_cap and rsp_cap to the
|
|
* frontend, and the beconn will be updated later.
|
|
*/
|
|
|
|
t->rep->rto = t->req->wto = t->be->timeout.server;
|
|
t->req->cto = t->be->timeout.connect;
|
|
t->conn_retries = t->be->conn_retries;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_ALLOW:
|
|
txn->flags |= TX_CLALLOW;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_DENY:
|
|
txn->flags |= TX_CLDENY;
|
|
t->be->denied_req++;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_TARPIT:
|
|
txn->flags |= TX_CLTARPIT;
|
|
t->be->denied_req++;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_REPLACE:
|
|
*cur_end = term; /* restore the string terminator */
|
|
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
|
|
delta = buffer_replace2(req, cur_ptr, cur_end, trash, len);
|
|
/* FIXME: if the user adds a newline in the replacement, the
|
|
* index will not be recalculated for now, and the new line
|
|
* will not be counted as a new header.
|
|
*/
|
|
|
|
txn->req.eoh += delta;
|
|
cur_end += delta;
|
|
|
|
txn->req.sol = req->data + txn->req.som; /* should be equal to txn->sol */
|
|
cur_end = (char *)http_parse_reqline(&txn->req, req->data,
|
|
HTTP_MSG_RQMETH,
|
|
cur_ptr, cur_end + 1,
|
|
NULL, NULL);
|
|
if (unlikely(!cur_end))
|
|
return -1;
|
|
|
|
/* we have a full request and we know that we have either a CR
|
|
* or an LF at <ptr>.
|
|
*/
|
|
txn->meth = find_http_meth(cur_ptr, txn->req.sl.rq.m_l);
|
|
hdr_idx_set_start(&txn->hdr_idx, txn->req.sl.rq.l, *cur_end == '\r');
|
|
/* there is no point trying this regex on headers */
|
|
return 1;
|
|
}
|
|
}
|
|
*cur_end = term; /* restore the string terminator */
|
|
return done;
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* Apply all the req filters <exp> to all headers in buffer <req> of session <t>.
|
|
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
|
|
* unparsable request. Since it can manage the switch to another backend, it
|
|
* updates the per-proxy DENY stats.
|
|
*/
|
|
int apply_filters_to_request(struct session *t, struct buffer *req, struct hdr_exp *exp)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
/* iterate through the filters in the outer loop */
|
|
while (exp && !(txn->flags & (TX_CLDENY|TX_CLTARPIT))) {
|
|
int ret;
|
|
|
|
/*
|
|
* The interleaving of transformations and verdicts
|
|
* makes it difficult to decide to continue or stop
|
|
* the evaluation.
|
|
*/
|
|
|
|
if ((txn->flags & TX_CLALLOW) &&
|
|
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
|
|
exp->action == ACT_TARPIT || exp->action == ACT_PASS)) {
|
|
exp = exp->next;
|
|
continue;
|
|
}
|
|
|
|
/* Apply the filter to the request line. */
|
|
ret = apply_filter_to_req_line(t, req, exp);
|
|
if (unlikely(ret < 0))
|
|
return -1;
|
|
|
|
if (likely(ret == 0)) {
|
|
/* The filter did not match the request, it can be
|
|
* iterated through all headers.
|
|
*/
|
|
apply_filter_to_req_headers(t, req, exp);
|
|
}
|
|
exp = exp->next;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* Manage client-side cookie. It can impact performance by about 2% so it is
|
|
* desirable to call it only when needed.
|
|
*/
|
|
void manage_client_side_cookies(struct session *t, struct buffer *req)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
char *p1, *p2, *p3, *p4;
|
|
char *del_colon, *del_cookie, *colon;
|
|
int app_cookies;
|
|
|
|
appsess *asession_temp = NULL;
|
|
appsess local_asession;
|
|
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx;
|
|
|
|
/* Iterate through the headers.
|
|
* we start with the start line.
|
|
*/
|
|
old_idx = 0;
|
|
cur_next = req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
|
|
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
|
|
struct hdr_idx_elem *cur_hdr;
|
|
int val;
|
|
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
/* We have one full header between cur_ptr and cur_end, and the
|
|
* next header starts at cur_next. We're only interested in
|
|
* "Cookie:" headers.
|
|
*/
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Cookie", 6);
|
|
if (!val) {
|
|
old_idx = cur_idx;
|
|
continue;
|
|
}
|
|
|
|
/* Now look for cookies. Conforming to RFC2109, we have to support
|
|
* attributes whose name begin with a '$', and associate them with
|
|
* the right cookie, if we want to delete this cookie.
|
|
* So there are 3 cases for each cookie read :
|
|
* 1) it's a special attribute, beginning with a '$' : ignore it.
|
|
* 2) it's a server id cookie that we *MAY* want to delete : save
|
|
* some pointers on it (last semi-colon, beginning of cookie...)
|
|
* 3) it's an application cookie : we *MAY* have to delete a previous
|
|
* "special" cookie.
|
|
* At the end of loop, if a "special" cookie remains, we may have to
|
|
* remove it. If no application cookie persists in the header, we
|
|
* *MUST* delete it
|
|
*/
|
|
|
|
colon = p1 = cur_ptr + val; /* first non-space char after 'Cookie:' */
|
|
|
|
/* del_cookie == NULL => nothing to be deleted */
|
|
del_colon = del_cookie = NULL;
|
|
app_cookies = 0;
|
|
|
|
while (p1 < cur_end) {
|
|
/* skip spaces and colons, but keep an eye on these ones */
|
|
while (p1 < cur_end) {
|
|
if (*p1 == ';' || *p1 == ',')
|
|
colon = p1;
|
|
else if (!isspace((unsigned char)*p1))
|
|
break;
|
|
p1++;
|
|
}
|
|
|
|
if (p1 == cur_end)
|
|
break;
|
|
|
|
/* p1 is at the beginning of the cookie name */
|
|
p2 = p1;
|
|
while (p2 < cur_end && *p2 != '=')
|
|
p2++;
|
|
|
|
if (p2 == cur_end)
|
|
break;
|
|
|
|
p3 = p2 + 1; /* skips the '=' sign */
|
|
if (p3 == cur_end)
|
|
break;
|
|
|
|
p4 = p3;
|
|
while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';' && *p4 != ',')
|
|
p4++;
|
|
|
|
/* here, we have the cookie name between p1 and p2,
|
|
* and its value between p3 and p4.
|
|
* we can process it :
|
|
*
|
|
* Cookie: NAME=VALUE;
|
|
* | || || |
|
|
* | || || +--> p4
|
|
* | || |+-------> p3
|
|
* | || +--------> p2
|
|
* | |+------------> p1
|
|
* | +-------------> colon
|
|
* +--------------------> cur_ptr
|
|
*/
|
|
|
|
if (*p1 == '$') {
|
|
/* skip this one */
|
|
}
|
|
else {
|
|
/* first, let's see if we want to capture it */
|
|
if (t->fe->capture_name != NULL &&
|
|
txn->cli_cookie == NULL &&
|
|
(p4 - p1 >= t->fe->capture_namelen) &&
|
|
memcmp(p1, t->fe->capture_name, t->fe->capture_namelen) == 0) {
|
|
int log_len = p4 - p1;
|
|
|
|
if ((txn->cli_cookie = pool_alloc2(pool2_capture)) == NULL) {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
} else {
|
|
if (log_len > t->fe->capture_len)
|
|
log_len = t->fe->capture_len;
|
|
memcpy(txn->cli_cookie, p1, log_len);
|
|
txn->cli_cookie[log_len] = 0;
|
|
}
|
|
}
|
|
|
|
if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
|
|
(memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
|
|
/* Cool... it's the right one */
|
|
struct server *srv = t->be->srv;
|
|
char *delim;
|
|
|
|
/* if we're in cookie prefix mode, we'll search the delimitor so that we
|
|
* have the server ID betweek p3 and delim, and the original cookie between
|
|
* delim+1 and p4. Otherwise, delim==p4 :
|
|
*
|
|
* Cookie: NAME=SRV~VALUE;
|
|
* | || || | |
|
|
* | || || | +--> p4
|
|
* | || || +--------> delim
|
|
* | || |+-----------> p3
|
|
* | || +------------> p2
|
|
* | |+----------------> p1
|
|
* | +-----------------> colon
|
|
* +------------------------> cur_ptr
|
|
*/
|
|
|
|
if (t->be->options & PR_O_COOK_PFX) {
|
|
for (delim = p3; delim < p4; delim++)
|
|
if (*delim == COOKIE_DELIM)
|
|
break;
|
|
}
|
|
else
|
|
delim = p4;
|
|
|
|
|
|
/* Here, we'll look for the first running server which supports the cookie.
|
|
* This allows to share a same cookie between several servers, for example
|
|
* to dedicate backup servers to specific servers only.
|
|
* However, to prevent clients from sticking to cookie-less backup server
|
|
* when they have incidentely learned an empty cookie, we simply ignore
|
|
* empty cookies and mark them as invalid.
|
|
*/
|
|
if (delim == p3)
|
|
srv = NULL;
|
|
|
|
while (srv) {
|
|
if (srv->cookie && (srv->cklen == delim - p3) &&
|
|
!memcmp(p3, srv->cookie, delim - p3)) {
|
|
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_VALID;
|
|
t->flags |= SN_DIRECT | SN_ASSIGNED;
|
|
t->srv = srv;
|
|
break;
|
|
} else {
|
|
/* we found a server, but it's down */
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_DOWN;
|
|
}
|
|
}
|
|
srv = srv->next;
|
|
}
|
|
|
|
if (!srv && !(txn->flags & TX_CK_DOWN)) {
|
|
/* no server matched this cookie */
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_INVALID;
|
|
}
|
|
|
|
/* depending on the cookie mode, we may have to either :
|
|
* - delete the complete cookie if we're in insert+indirect mode, so that
|
|
* the server never sees it ;
|
|
* - remove the server id from the cookie value, and tag the cookie as an
|
|
* application cookie so that it does not get accidentely removed later,
|
|
* if we're in cookie prefix mode
|
|
*/
|
|
if ((t->be->options & PR_O_COOK_PFX) && (delim != p4)) {
|
|
int delta; /* negative */
|
|
|
|
delta = buffer_replace2(req, p3, delim + 1, NULL, 0);
|
|
p4 += delta;
|
|
cur_end += delta;
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->req.eoh += delta;
|
|
|
|
del_cookie = del_colon = NULL;
|
|
app_cookies++; /* protect the header from deletion */
|
|
}
|
|
else if (del_cookie == NULL &&
|
|
(t->be->options & (PR_O_COOK_INS | PR_O_COOK_IND)) == (PR_O_COOK_INS | PR_O_COOK_IND)) {
|
|
del_cookie = p1;
|
|
del_colon = colon;
|
|
}
|
|
} else {
|
|
/* now we know that we must keep this cookie since it's
|
|
* not ours. But if we wanted to delete our cookie
|
|
* earlier, we cannot remove the complete header, but we
|
|
* can remove the previous block itself.
|
|
*/
|
|
app_cookies++;
|
|
|
|
if (del_cookie != NULL) {
|
|
int delta; /* negative */
|
|
|
|
delta = buffer_replace2(req, del_cookie, p1, NULL, 0);
|
|
p4 += delta;
|
|
cur_end += delta;
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->req.eoh += delta;
|
|
del_cookie = del_colon = NULL;
|
|
}
|
|
}
|
|
|
|
if ((t->be->appsession_name != NULL) &&
|
|
(memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
|
|
/* first, let's see if the cookie is our appcookie*/
|
|
|
|
/* Cool... it's the right one */
|
|
|
|
asession_temp = &local_asession;
|
|
|
|
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession->sessid:malloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession->sessid:malloc().\n");
|
|
return;
|
|
}
|
|
|
|
memcpy(asession_temp->sessid, p3, t->be->appsession_len);
|
|
asession_temp->sessid[t->be->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
|
|
if (asession_temp == NULL) {
|
|
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
|
|
/* free previously allocated memory */
|
|
pool_free2(apools.sessid, local_asession.sessid);
|
|
Alert("Not enough memory process_cli():asession:calloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
|
return;
|
|
}
|
|
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
asession_temp->request_count = 0;
|
|
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
|
|
} else {
|
|
/* free previously allocated memory */
|
|
pool_free2(apools.sessid, local_asession.sessid);
|
|
}
|
|
if (asession_temp->serverid == NULL) {
|
|
/* TODO redispatch request */
|
|
Alert("Found Application Session without matching server.\n");
|
|
} else {
|
|
struct server *srv = t->be->srv;
|
|
while (srv) {
|
|
if (strcmp(srv->id, asession_temp->serverid) == 0) {
|
|
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_VALID;
|
|
t->flags |= SN_DIRECT | SN_ASSIGNED;
|
|
t->srv = srv;
|
|
break;
|
|
} else {
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_DOWN;
|
|
}
|
|
}
|
|
srv = srv->next;
|
|
}/* end while(srv) */
|
|
}/* end else if server == NULL */
|
|
|
|
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
|
|
asession_temp->request_count++;
|
|
#if defined(DEBUG_HASH)
|
|
Alert("manage_client_side_cookies\n");
|
|
appsession_hash_dump(&(t->be->htbl_proxy));
|
|
#endif
|
|
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
|
}
|
|
|
|
/* we'll have to look for another cookie ... */
|
|
p1 = p4;
|
|
} /* while (p1 < cur_end) */
|
|
|
|
/* There's no more cookie on this line.
|
|
* We may have marked the last one(s) for deletion.
|
|
* We must do this now in two ways :
|
|
* - if there is no app cookie, we simply delete the header ;
|
|
* - if there are app cookies, we must delete the end of the
|
|
* string properly, including the colon/semi-colon before
|
|
* the cookie name.
|
|
*/
|
|
if (del_cookie != NULL) {
|
|
int delta;
|
|
if (app_cookies) {
|
|
delta = buffer_replace2(req, del_colon, cur_end, NULL, 0);
|
|
cur_end = del_colon;
|
|
cur_hdr->len += delta;
|
|
} else {
|
|
delta = buffer_replace2(req, cur_ptr, cur_next, NULL, 0);
|
|
|
|
/* FIXME: this should be a separate function */
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
}
|
|
cur_next += delta;
|
|
txn->req.eoh += delta;
|
|
}
|
|
|
|
/* keep the link from this header to next one */
|
|
old_idx = cur_idx;
|
|
} /* end of cookie processing on this header */
|
|
}
|
|
|
|
|
|
/* Iterate the same filter through all response headers contained in <rtr>.
|
|
* Returns 1 if this filter can be stopped upon return, otherwise 0.
|
|
*/
|
|
int apply_filter_to_resp_headers(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
|
|
{
|
|
char term;
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx, last_hdr;
|
|
struct http_txn *txn = &t->txn;
|
|
struct hdr_idx_elem *cur_hdr;
|
|
int len, delta;
|
|
|
|
last_hdr = 0;
|
|
|
|
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
old_idx = 0;
|
|
|
|
while (!last_hdr) {
|
|
if (unlikely(txn->flags & TX_SVDENY))
|
|
return 1;
|
|
else if (unlikely(txn->flags & TX_SVALLOW) &&
|
|
(exp->action == ACT_ALLOW ||
|
|
exp->action == ACT_DENY))
|
|
return 0;
|
|
|
|
cur_idx = txn->hdr_idx.v[old_idx].next;
|
|
if (!cur_idx)
|
|
break;
|
|
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
/* Now we have one header between cur_ptr and cur_end,
|
|
* and the next header starts at cur_next.
|
|
*/
|
|
|
|
/* The annoying part is that pattern matching needs
|
|
* that we modify the contents to null-terminate all
|
|
* strings before testing them.
|
|
*/
|
|
|
|
term = *cur_end;
|
|
*cur_end = '\0';
|
|
|
|
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_ALLOW:
|
|
txn->flags |= TX_SVALLOW;
|
|
last_hdr = 1;
|
|
break;
|
|
|
|
case ACT_DENY:
|
|
txn->flags |= TX_SVDENY;
|
|
last_hdr = 1;
|
|
break;
|
|
|
|
case ACT_REPLACE:
|
|
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
|
|
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
|
|
/* FIXME: if the user adds a newline in the replacement, the
|
|
* index will not be recalculated for now, and the new line
|
|
* will not be counted as a new header.
|
|
*/
|
|
|
|
cur_end += delta;
|
|
cur_next += delta;
|
|
cur_hdr->len += delta;
|
|
txn->rsp.eoh += delta;
|
|
break;
|
|
|
|
case ACT_REMOVE:
|
|
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
|
|
cur_next += delta;
|
|
|
|
/* FIXME: this should be a separate function */
|
|
txn->rsp.eoh += delta;
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
cur_end = NULL; /* null-term has been rewritten */
|
|
break;
|
|
|
|
}
|
|
}
|
|
if (cur_end)
|
|
*cur_end = term; /* restore the string terminator */
|
|
|
|
/* keep the link from this header to next one in case of later
|
|
* removal of next header.
|
|
*/
|
|
old_idx = cur_idx;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
/* Apply the filter to the status line in the response buffer <rtr>.
|
|
* Returns 0 if nothing has been done, 1 if the filter has been applied,
|
|
* or -1 if a replacement resulted in an invalid status line.
|
|
*/
|
|
int apply_filter_to_sts_line(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
|
|
{
|
|
char term;
|
|
char *cur_ptr, *cur_end;
|
|
int done;
|
|
struct http_txn *txn = &t->txn;
|
|
int len, delta;
|
|
|
|
|
|
if (unlikely(txn->flags & TX_SVDENY))
|
|
return 1;
|
|
else if (unlikely(txn->flags & TX_SVALLOW) &&
|
|
(exp->action == ACT_ALLOW ||
|
|
exp->action == ACT_DENY))
|
|
return 0;
|
|
else if (exp->action == ACT_REMOVE)
|
|
return 0;
|
|
|
|
done = 0;
|
|
|
|
cur_ptr = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
|
|
cur_end = cur_ptr + txn->rsp.sl.rq.l;
|
|
|
|
/* Now we have the status line between cur_ptr and cur_end */
|
|
|
|
/* The annoying part is that pattern matching needs
|
|
* that we modify the contents to null-terminate all
|
|
* strings before testing them.
|
|
*/
|
|
|
|
term = *cur_end;
|
|
*cur_end = '\0';
|
|
|
|
if (regexec(exp->preg, cur_ptr, MAX_MATCH, pmatch, 0) == 0) {
|
|
switch (exp->action) {
|
|
case ACT_ALLOW:
|
|
txn->flags |= TX_SVALLOW;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_DENY:
|
|
txn->flags |= TX_SVDENY;
|
|
done = 1;
|
|
break;
|
|
|
|
case ACT_REPLACE:
|
|
*cur_end = term; /* restore the string terminator */
|
|
len = exp_replace(trash, cur_ptr, exp->replace, pmatch);
|
|
delta = buffer_replace2(rtr, cur_ptr, cur_end, trash, len);
|
|
/* FIXME: if the user adds a newline in the replacement, the
|
|
* index will not be recalculated for now, and the new line
|
|
* will not be counted as a new header.
|
|
*/
|
|
|
|
txn->rsp.eoh += delta;
|
|
cur_end += delta;
|
|
|
|
txn->rsp.sol = rtr->data + txn->rsp.som; /* should be equal to txn->sol */
|
|
cur_end = (char *)http_parse_stsline(&txn->rsp, rtr->data,
|
|
HTTP_MSG_RPVER,
|
|
cur_ptr, cur_end + 1,
|
|
NULL, NULL);
|
|
if (unlikely(!cur_end))
|
|
return -1;
|
|
|
|
/* we have a full respnse and we know that we have either a CR
|
|
* or an LF at <ptr>.
|
|
*/
|
|
txn->status = strl2ui(rtr->data + txn->rsp.sl.st.c, txn->rsp.sl.st.c_l);
|
|
hdr_idx_set_start(&txn->hdr_idx, txn->rsp.sl.rq.l, *cur_end == '\r');
|
|
/* there is no point trying this regex on headers */
|
|
return 1;
|
|
}
|
|
}
|
|
*cur_end = term; /* restore the string terminator */
|
|
return done;
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* Apply all the resp filters <exp> to all headers in buffer <rtr> of session <t>.
|
|
* Returns 0 if everything is alright, or -1 in case a replacement lead to an
|
|
* unparsable response.
|
|
*/
|
|
int apply_filters_to_response(struct session *t, struct buffer *rtr, struct hdr_exp *exp)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
/* iterate through the filters in the outer loop */
|
|
while (exp && !(txn->flags & TX_SVDENY)) {
|
|
int ret;
|
|
|
|
/*
|
|
* The interleaving of transformations and verdicts
|
|
* makes it difficult to decide to continue or stop
|
|
* the evaluation.
|
|
*/
|
|
|
|
if ((txn->flags & TX_SVALLOW) &&
|
|
(exp->action == ACT_ALLOW || exp->action == ACT_DENY ||
|
|
exp->action == ACT_PASS)) {
|
|
exp = exp->next;
|
|
continue;
|
|
}
|
|
|
|
/* Apply the filter to the status line. */
|
|
ret = apply_filter_to_sts_line(t, rtr, exp);
|
|
if (unlikely(ret < 0))
|
|
return -1;
|
|
|
|
if (likely(ret == 0)) {
|
|
/* The filter did not match the response, it can be
|
|
* iterated through all headers.
|
|
*/
|
|
apply_filter_to_resp_headers(t, rtr, exp);
|
|
}
|
|
exp = exp->next;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* Manage server-side cookies. It can impact performance by about 2% so it is
|
|
* desirable to call it only when needed.
|
|
*/
|
|
void manage_server_side_cookies(struct session *t, struct buffer *rtr)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
char *p1, *p2, *p3, *p4;
|
|
|
|
appsess *asession_temp = NULL;
|
|
appsess local_asession;
|
|
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx, old_idx, delta;
|
|
|
|
/* Iterate through the headers.
|
|
* we start with the start line.
|
|
*/
|
|
old_idx = 0;
|
|
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
|
|
while ((cur_idx = txn->hdr_idx.v[old_idx].next)) {
|
|
struct hdr_idx_elem *cur_hdr;
|
|
int val;
|
|
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
/* We have one full header between cur_ptr and cur_end, and the
|
|
* next header starts at cur_next. We're only interested in
|
|
* "Cookie:" headers.
|
|
*/
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Set-Cookie", 10);
|
|
if (!val) {
|
|
old_idx = cur_idx;
|
|
continue;
|
|
}
|
|
|
|
/* OK, right now we know we have a set-cookie at cur_ptr */
|
|
txn->flags |= TX_SCK_ANY;
|
|
|
|
|
|
/* maybe we only wanted to see if there was a set-cookie */
|
|
if (t->be->cookie_name == NULL &&
|
|
t->be->appsession_name == NULL &&
|
|
t->be->capture_name == NULL)
|
|
return;
|
|
|
|
p1 = cur_ptr + val; /* first non-space char after 'Set-Cookie:' */
|
|
|
|
while (p1 < cur_end) { /* in fact, we'll break after the first cookie */
|
|
if (p1 == cur_end || *p1 == ';') /* end of cookie */
|
|
break;
|
|
|
|
/* p1 is at the beginning of the cookie name */
|
|
p2 = p1;
|
|
|
|
while (p2 < cur_end && *p2 != '=' && *p2 != ';')
|
|
p2++;
|
|
|
|
if (p2 == cur_end || *p2 == ';') /* next cookie */
|
|
break;
|
|
|
|
p3 = p2 + 1; /* skip the '=' sign */
|
|
if (p3 == cur_end)
|
|
break;
|
|
|
|
p4 = p3;
|
|
while (p4 < cur_end && !isspace((unsigned char)*p4) && *p4 != ';')
|
|
p4++;
|
|
|
|
/* here, we have the cookie name between p1 and p2,
|
|
* and its value between p3 and p4.
|
|
* we can process it.
|
|
*/
|
|
|
|
/* first, let's see if we want to capture it */
|
|
if (t->be->capture_name != NULL &&
|
|
txn->srv_cookie == NULL &&
|
|
(p4 - p1 >= t->be->capture_namelen) &&
|
|
memcmp(p1, t->be->capture_name, t->be->capture_namelen) == 0) {
|
|
int log_len = p4 - p1;
|
|
|
|
if ((txn->srv_cookie = pool_alloc2(pool2_capture)) == NULL) {
|
|
Alert("HTTP logging : out of memory.\n");
|
|
}
|
|
|
|
if (log_len > t->be->capture_len)
|
|
log_len = t->be->capture_len;
|
|
memcpy(txn->srv_cookie, p1, log_len);
|
|
txn->srv_cookie[log_len] = 0;
|
|
}
|
|
|
|
/* now check if we need to process it for persistence */
|
|
if ((p2 - p1 == t->be->cookie_len) && (t->be->cookie_name != NULL) &&
|
|
(memcmp(p1, t->be->cookie_name, p2 - p1) == 0)) {
|
|
/* Cool... it's the right one */
|
|
txn->flags |= TX_SCK_SEEN;
|
|
|
|
/* If the cookie is in insert mode on a known server, we'll delete
|
|
* this occurrence because we'll insert another one later.
|
|
* We'll delete it too if the "indirect" option is set and we're in
|
|
* a direct access. */
|
|
if (((t->srv) && (t->be->options & PR_O_COOK_INS)) ||
|
|
((t->flags & SN_DIRECT) && (t->be->options & PR_O_COOK_IND))) {
|
|
/* this header must be deleted */
|
|
delta = buffer_replace2(rtr, cur_ptr, cur_next, NULL, 0);
|
|
txn->hdr_idx.v[old_idx].next = cur_hdr->next;
|
|
txn->hdr_idx.used--;
|
|
cur_hdr->len = 0;
|
|
cur_next += delta;
|
|
txn->rsp.eoh += delta;
|
|
|
|
txn->flags |= TX_SCK_DELETED;
|
|
}
|
|
else if ((t->srv) && (t->srv->cookie) &&
|
|
(t->be->options & PR_O_COOK_RW)) {
|
|
/* replace bytes p3->p4 with the cookie name associated
|
|
* with this server since we know it.
|
|
*/
|
|
delta = buffer_replace2(rtr, p3, p4, t->srv->cookie, t->srv->cklen);
|
|
cur_hdr->len += delta;
|
|
cur_next += delta;
|
|
txn->rsp.eoh += delta;
|
|
|
|
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
|
|
}
|
|
else if ((t->srv) && (t->srv->cookie) &&
|
|
(t->be->options & PR_O_COOK_PFX)) {
|
|
/* insert the cookie name associated with this server
|
|
* before existing cookie, and insert a delimitor between them..
|
|
*/
|
|
delta = buffer_replace2(rtr, p3, p3, t->srv->cookie, t->srv->cklen + 1);
|
|
cur_hdr->len += delta;
|
|
cur_next += delta;
|
|
txn->rsp.eoh += delta;
|
|
|
|
p3[t->srv->cklen] = COOKIE_DELIM;
|
|
txn->flags |= TX_SCK_INSERTED | TX_SCK_DELETED;
|
|
}
|
|
}
|
|
/* next, let's see if the cookie is our appcookie */
|
|
else if ((t->be->appsession_name != NULL) &&
|
|
(memcmp(p1, t->be->appsession_name, p2 - p1) == 0)) {
|
|
|
|
/* Cool... it's the right one */
|
|
|
|
size_t server_id_len = strlen(t->srv->id) + 1;
|
|
asession_temp = &local_asession;
|
|
|
|
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
|
|
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
|
|
return;
|
|
}
|
|
memcpy(asession_temp->sessid, p3, t->be->appsession_len);
|
|
asession_temp->sessid[t->be->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
|
|
if (asession_temp == NULL) {
|
|
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
|
|
Alert("Not enough Memory process_srv():asession:calloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession:calloc().\n");
|
|
return;
|
|
}
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
asession_temp->request_count = 0;
|
|
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
|
|
} else {
|
|
/* free wasted memory */
|
|
pool_free2(apools.sessid, local_asession.sessid);
|
|
}
|
|
|
|
if (asession_temp->serverid == NULL) {
|
|
if ((asession_temp->serverid = pool_alloc2(apools.serverid)) == NULL) {
|
|
Alert("Not enough Memory process_srv():asession->sessid:malloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough Memory process_srv():asession->sessid:malloc().\n");
|
|
return;
|
|
}
|
|
asession_temp->serverid[0] = '\0';
|
|
}
|
|
|
|
if (asession_temp->serverid[0] == '\0')
|
|
memcpy(asession_temp->serverid, t->srv->id, server_id_len);
|
|
|
|
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
|
|
asession_temp->request_count++;
|
|
#if defined(DEBUG_HASH)
|
|
Alert("manage_server_side_cookies\n");
|
|
appsession_hash_dump(&(t->be->htbl_proxy));
|
|
#endif
|
|
}/* end if ((t->proxy->appsession_name != NULL) ... */
|
|
break; /* we don't want to loop again since there cannot be another cookie on the same line */
|
|
} /* we're now at the end of the cookie value */
|
|
|
|
/* keep the link from this header to next one */
|
|
old_idx = cur_idx;
|
|
} /* end of cookie processing on this header */
|
|
}
|
|
|
|
|
|
|
|
/*
|
|
* Check if response is cacheable or not. Updates t->flags.
|
|
*/
|
|
void check_response_for_cacheability(struct session *t, struct buffer *rtr)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
char *p1, *p2;
|
|
|
|
char *cur_ptr, *cur_end, *cur_next;
|
|
int cur_idx;
|
|
|
|
if (!(txn->flags & TX_CACHEABLE))
|
|
return;
|
|
|
|
/* Iterate through the headers.
|
|
* we start with the start line.
|
|
*/
|
|
cur_idx = 0;
|
|
cur_next = rtr->data + txn->rsp.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
|
|
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
|
|
struct hdr_idx_elem *cur_hdr;
|
|
int val;
|
|
|
|
cur_hdr = &txn->hdr_idx.v[cur_idx];
|
|
cur_ptr = cur_next;
|
|
cur_end = cur_ptr + cur_hdr->len;
|
|
cur_next = cur_end + cur_hdr->cr + 1;
|
|
|
|
/* We have one full header between cur_ptr and cur_end, and the
|
|
* next header starts at cur_next. We're only interested in
|
|
* "Cookie:" headers.
|
|
*/
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Pragma", 6);
|
|
if (val) {
|
|
if ((cur_end - (cur_ptr + val) >= 8) &&
|
|
strncasecmp(cur_ptr + val, "no-cache", 8) == 0) {
|
|
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
|
|
return;
|
|
}
|
|
}
|
|
|
|
val = http_header_match2(cur_ptr, cur_end, "Cache-control", 13);
|
|
if (!val)
|
|
continue;
|
|
|
|
/* OK, right now we know we have a cache-control header at cur_ptr */
|
|
|
|
p1 = cur_ptr + val; /* first non-space char after 'cache-control:' */
|
|
|
|
if (p1 >= cur_end) /* no more info */
|
|
continue;
|
|
|
|
/* p1 is at the beginning of the value */
|
|
p2 = p1;
|
|
|
|
while (p2 < cur_end && *p2 != '=' && *p2 != ',' && !isspace((unsigned char)*p2))
|
|
p2++;
|
|
|
|
/* we have a complete value between p1 and p2 */
|
|
if (p2 < cur_end && *p2 == '=') {
|
|
/* we have something of the form no-cache="set-cookie" */
|
|
if ((cur_end - p1 >= 21) &&
|
|
strncasecmp(p1, "no-cache=\"set-cookie", 20) == 0
|
|
&& (p1[20] == '"' || p1[20] == ','))
|
|
txn->flags &= ~TX_CACHE_COOK;
|
|
continue;
|
|
}
|
|
|
|
/* OK, so we know that either p2 points to the end of string or to a comma */
|
|
if (((p2 - p1 == 7) && strncasecmp(p1, "private", 7) == 0) ||
|
|
((p2 - p1 == 8) && strncasecmp(p1, "no-store", 8) == 0) ||
|
|
((p2 - p1 == 9) && strncasecmp(p1, "max-age=0", 9) == 0) ||
|
|
((p2 - p1 == 10) && strncasecmp(p1, "s-maxage=0", 10) == 0)) {
|
|
txn->flags &= ~TX_CACHEABLE & ~TX_CACHE_COOK;
|
|
return;
|
|
}
|
|
|
|
if ((p2 - p1 == 6) && strncasecmp(p1, "public", 6) == 0) {
|
|
txn->flags |= TX_CACHEABLE | TX_CACHE_COOK;
|
|
continue;
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* Try to retrieve a known appsession in the URI, then the associated server.
|
|
* If the server is found, it's assigned to the session.
|
|
*/
|
|
void get_srv_from_appsession(struct session *t, const char *begin, int len)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
appsess *asession_temp = NULL;
|
|
appsess local_asession;
|
|
char *request_line;
|
|
|
|
if (t->be->appsession_name == NULL ||
|
|
(t->txn.meth != HTTP_METH_GET && t->txn.meth != HTTP_METH_POST) ||
|
|
(request_line = memchr(begin, ';', len)) == NULL ||
|
|
((1 + t->be->appsession_name_len + 1 + t->be->appsession_len) > (begin + len - request_line)))
|
|
return;
|
|
|
|
/* skip ';' */
|
|
request_line++;
|
|
|
|
/* look if we have a jsessionid */
|
|
if (strncasecmp(request_line, t->be->appsession_name, t->be->appsession_name_len) != 0)
|
|
return;
|
|
|
|
/* skip jsessionid= */
|
|
request_line += t->be->appsession_name_len + 1;
|
|
|
|
/* First try if we already have an appsession */
|
|
asession_temp = &local_asession;
|
|
|
|
if ((asession_temp->sessid = pool_alloc2(apools.sessid)) == NULL) {
|
|
Alert("Not enough memory process_cli():asession_temp->sessid:calloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough Memory process_cli():asession_temp->sessid:calloc().\n");
|
|
return;
|
|
}
|
|
|
|
/* Copy the sessionid */
|
|
memcpy(asession_temp->sessid, request_line, t->be->appsession_len);
|
|
asession_temp->sessid[t->be->appsession_len] = 0;
|
|
asession_temp->serverid = NULL;
|
|
|
|
/* only do insert, if lookup fails */
|
|
asession_temp = appsession_hash_lookup(&(t->be->htbl_proxy), asession_temp->sessid);
|
|
if (asession_temp == NULL) {
|
|
if ((asession_temp = pool_alloc2(pool2_appsess)) == NULL) {
|
|
/* free previously allocated memory */
|
|
pool_free2(apools.sessid, local_asession.sessid);
|
|
Alert("Not enough memory process_cli():asession:calloc().\n");
|
|
send_log(t->be, LOG_ALERT, "Not enough memory process_cli():asession:calloc().\n");
|
|
return;
|
|
}
|
|
asession_temp->sessid = local_asession.sessid;
|
|
asession_temp->serverid = local_asession.serverid;
|
|
asession_temp->request_count=0;
|
|
appsession_hash_insert(&(t->be->htbl_proxy), asession_temp);
|
|
}
|
|
else {
|
|
/* free previously allocated memory */
|
|
pool_free2(apools.sessid, local_asession.sessid);
|
|
}
|
|
|
|
asession_temp->expire = tick_add_ifset(now_ms, t->be->timeout.appsession);
|
|
asession_temp->request_count++;
|
|
|
|
#if defined(DEBUG_HASH)
|
|
Alert("get_srv_from_appsession\n");
|
|
appsession_hash_dump(&(t->be->htbl_proxy));
|
|
#endif
|
|
if (asession_temp->serverid == NULL) {
|
|
/* TODO redispatch request */
|
|
Alert("Found Application Session without matching server.\n");
|
|
} else {
|
|
struct server *srv = t->be->srv;
|
|
while (srv) {
|
|
if (strcmp(srv->id, asession_temp->serverid) == 0) {
|
|
if (srv->state & SRV_RUNNING || t->be->options & PR_O_PERSIST) {
|
|
/* we found the server and it's usable */
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_VALID;
|
|
t->flags |= SN_DIRECT | SN_ASSIGNED;
|
|
t->srv = srv;
|
|
break;
|
|
} else {
|
|
txn->flags &= ~TX_CK_MASK;
|
|
txn->flags |= TX_CK_DOWN;
|
|
}
|
|
}
|
|
srv = srv->next;
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
/*
|
|
* In a GET or HEAD request, check if the requested URI matches the stats uri
|
|
* for the current backend, and if an authorization has been passed and is valid.
|
|
*
|
|
* It is assumed that the request is either a HEAD or GET and that the
|
|
* t->be->uri_auth field is valid. An HTTP/401 response may be sent, or
|
|
* produce_content() can be called to start sending data.
|
|
*
|
|
* Returns 1 if the session's state changes, otherwise 0.
|
|
*/
|
|
int stats_check_uri_auth(struct session *t, struct proxy *backend)
|
|
{
|
|
struct http_txn *txn = &t->txn;
|
|
struct uri_auth *uri_auth = backend->uri_auth;
|
|
struct user_auth *user;
|
|
int authenticated, cur_idx;
|
|
char *h;
|
|
|
|
memset(&t->data_ctx.stats, 0, sizeof(t->data_ctx.stats));
|
|
|
|
/* check URI size */
|
|
if (uri_auth->uri_len > txn->req.sl.rq.u_l)
|
|
return 0;
|
|
|
|
h = t->req->data + txn->req.sl.rq.u;
|
|
|
|
/* the URI is in h */
|
|
if (memcmp(h, uri_auth->uri_prefix, uri_auth->uri_len) != 0)
|
|
return 0;
|
|
|
|
h += uri_auth->uri_len;
|
|
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 3) {
|
|
if (memcmp(h, ";up", 3) == 0) {
|
|
t->data_ctx.stats.flags |= STAT_HIDE_DOWN;
|
|
break;
|
|
}
|
|
h++;
|
|
}
|
|
|
|
if (uri_auth->refresh) {
|
|
h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len;
|
|
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 10) {
|
|
if (memcmp(h, ";norefresh", 10) == 0) {
|
|
t->data_ctx.stats.flags |= STAT_NO_REFRESH;
|
|
break;
|
|
}
|
|
h++;
|
|
}
|
|
}
|
|
|
|
h = t->req->data + txn->req.sl.rq.u + uri_auth->uri_len;
|
|
while (h <= t->req->data + txn->req.sl.rq.u + txn->req.sl.rq.u_l - 4) {
|
|
if (memcmp(h, ";csv", 4) == 0) {
|
|
t->data_ctx.stats.flags |= STAT_FMT_CSV;
|
|
break;
|
|
}
|
|
h++;
|
|
}
|
|
|
|
t->data_ctx.stats.flags |= STAT_SHOW_STAT | STAT_SHOW_INFO;
|
|
|
|
/* we are in front of a interceptable URI. Let's check
|
|
* if there's an authentication and if it's valid.
|
|
*/
|
|
user = uri_auth->users;
|
|
if (!user) {
|
|
/* no user auth required, it's OK */
|
|
authenticated = 1;
|
|
} else {
|
|
authenticated = 0;
|
|
|
|
/* a user list is defined, we have to check.
|
|
* skip 21 chars for "Authorization: Basic ".
|
|
*/
|
|
|
|
/* FIXME: this should move to an earlier place */
|
|
cur_idx = 0;
|
|
h = t->req->data + txn->req.som + hdr_idx_first_pos(&txn->hdr_idx);
|
|
while ((cur_idx = txn->hdr_idx.v[cur_idx].next)) {
|
|
int len = txn->hdr_idx.v[cur_idx].len;
|
|
if (len > 14 &&
|
|
!strncasecmp("Authorization:", h, 14)) {
|
|
txn->auth_hdr.str = h;
|
|
txn->auth_hdr.len = len;
|
|
break;
|
|
}
|
|
h += len + txn->hdr_idx.v[cur_idx].cr + 1;
|
|
}
|
|
|
|
if (txn->auth_hdr.len < 21 ||
|
|
memcmp(txn->auth_hdr.str + 14, " Basic ", 7))
|
|
user = NULL;
|
|
|
|
while (user) {
|
|
if ((txn->auth_hdr.len == user->user_len + 14 + 7)
|
|
&& !memcmp(txn->auth_hdr.str + 14 + 7,
|
|
user->user_pwd, user->user_len)) {
|
|
authenticated = 1;
|
|
break;
|
|
}
|
|
user = user->next;
|
|
}
|
|
}
|
|
|
|
if (!authenticated) {
|
|
struct chunk msg;
|
|
|
|
/* no need to go further */
|
|
msg.str = trash;
|
|
msg.len = sprintf(trash, HTTP_401_fmt, uri_auth->auth_realm);
|
|
txn->status = 401;
|
|
client_retnclose(t, &msg);
|
|
trace_term(t, TT_HTTP_URI_1);
|
|
t->req->analysers = 0;
|
|
if (!(t->flags & SN_ERR_MASK))
|
|
t->flags |= SN_ERR_PRXCOND;
|
|
if (!(t->flags & SN_FINST_MASK))
|
|
t->flags |= SN_FINST_R;
|
|
return 1;
|
|
}
|
|
|
|
/* The request is valid, the user is authenticated. Let's start sending
|
|
* data.
|
|
*/
|
|
buffer_shutw_now(t->req);
|
|
buffer_shutr_now(t->rep);
|
|
buffer_start_hijack(t->rep);
|
|
t->logs.tv_request = now;
|
|
t->data_source = DATA_SRC_STATS;
|
|
t->data_state = DATA_ST_INIT;
|
|
t->task->nice = -32; /* small boost for HTTP statistics */
|
|
produce_content(t);
|
|
return 1;
|
|
}
|
|
|
|
|
|
/*
|
|
* Print a debug line with a header
|
|
*/
|
|
void debug_hdr(const char *dir, struct session *t, const char *start, const char *end)
|
|
{
|
|
int len, max;
|
|
len = sprintf(trash, "%08x:%s.%s[%04x:%04x]: ", t->uniq_id, t->be->id,
|
|
dir, (unsigned short)t->req->prod->fd, (unsigned short)t->req->cons->fd);
|
|
max = end - start;
|
|
UBOUND(max, sizeof(trash) - len - 1);
|
|
len += strlcpy2(trash + len, start, max + 1);
|
|
trash[len++] = '\n';
|
|
write(1, trash, len);
|
|
}
|
|
|
|
|
|
/************************************************************************/
|
|
/* The code below is dedicated to ACL parsing and matching */
|
|
/************************************************************************/
|
|
|
|
|
|
|
|
|
|
/* 1. Check on METHOD
|
|
* We use the pre-parsed method if it is known, and store its number as an
|
|
* integer. If it is unknown, we use the pointer and the length.
|
|
*/
|
|
static int acl_parse_meth(const char **text, struct acl_pattern *pattern, int *opaque)
|
|
{
|
|
int len, meth;
|
|
|
|
len = strlen(*text);
|
|
meth = find_http_meth(*text, len);
|
|
|
|
pattern->val.i = meth;
|
|
if (meth == HTTP_METH_OTHER) {
|
|
pattern->ptr.str = strdup(*text);
|
|
if (!pattern->ptr.str)
|
|
return 0;
|
|
pattern->len = len;
|
|
}
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_meth(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
int meth;
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
meth = txn->meth;
|
|
test->i = meth;
|
|
if (meth == HTTP_METH_OTHER) {
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
test->len = txn->req.sl.rq.m_l;
|
|
test->ptr = txn->req.sol;
|
|
}
|
|
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
static int acl_match_meth(struct acl_test *test, struct acl_pattern *pattern)
|
|
{
|
|
int icase;
|
|
|
|
if (test->i != pattern->val.i)
|
|
return ACL_PAT_FAIL;
|
|
|
|
if (test->i != HTTP_METH_OTHER)
|
|
return ACL_PAT_PASS;
|
|
|
|
/* Other method, we must compare the strings */
|
|
if (pattern->len != test->len)
|
|
return ACL_PAT_FAIL;
|
|
|
|
icase = pattern->flags & ACL_PAT_F_IGNORE_CASE;
|
|
if ((icase && strncasecmp(pattern->ptr.str, test->ptr, test->len) != 0) ||
|
|
(!icase && strncmp(pattern->ptr.str, test->ptr, test->len) != 0))
|
|
return ACL_PAT_FAIL;
|
|
return ACL_PAT_PASS;
|
|
}
|
|
|
|
/* 2. Check on Request/Status Version
|
|
* We simply compare strings here.
|
|
*/
|
|
static int acl_parse_ver(const char **text, struct acl_pattern *pattern, int *opaque)
|
|
{
|
|
pattern->ptr.str = strdup(*text);
|
|
if (!pattern->ptr.str)
|
|
return 0;
|
|
pattern->len = strlen(*text);
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_rqver(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
char *ptr;
|
|
int len;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
len = txn->req.sl.rq.v_l;
|
|
ptr = txn->req.sol + txn->req.sl.rq.v - txn->req.som;
|
|
|
|
while ((len-- > 0) && (*ptr++ != '/'));
|
|
if (len <= 0)
|
|
return 0;
|
|
|
|
test->ptr = ptr;
|
|
test->len = len;
|
|
|
|
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_stver(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
char *ptr;
|
|
int len;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
len = txn->rsp.sl.st.v_l;
|
|
ptr = txn->rsp.sol;
|
|
|
|
while ((len-- > 0) && (*ptr++ != '/'));
|
|
if (len <= 0)
|
|
return 0;
|
|
|
|
test->ptr = ptr;
|
|
test->len = len;
|
|
|
|
test->flags = ACL_TEST_F_READ_ONLY | ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
/* 3. Check on Status Code. We manipulate integers here. */
|
|
static int
|
|
acl_fetch_stcode(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
char *ptr;
|
|
int len;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
len = txn->rsp.sl.st.c_l;
|
|
ptr = txn->rsp.sol + txn->rsp.sl.st.c - txn->rsp.som;
|
|
|
|
test->i = __strl2ui(ptr, len);
|
|
test->flags = ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
/* 4. Check on URL/URI. A pointer to the URI is stored. */
|
|
static int
|
|
acl_fetch_url(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
test->len = txn->req.sl.rq.u_l;
|
|
test->ptr = txn->req.sol + txn->req.sl.rq.u;
|
|
|
|
/* we do not need to set READ_ONLY because the data is in a buffer */
|
|
test->flags = ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_url_ip(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
/* Parse HTTP request */
|
|
url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr);
|
|
test->ptr = (void *)&((struct sockaddr_in *)&l4->srv_addr)->sin_addr;
|
|
test->i = AF_INET;
|
|
|
|
/*
|
|
* If we are parsing url in frontend space, we prepare backend stage
|
|
* to not parse again the same url ! optimization lazyness...
|
|
*/
|
|
if (px->options & PR_O_HTTP_PROXY)
|
|
l4->flags |= SN_ADDR_SET;
|
|
|
|
test->flags = ACL_TEST_F_READ_ONLY;
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_url_port(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
/* Same optimization as url_ip */
|
|
url2sa(txn->req.sol + txn->req.sl.rq.u, txn->req.sl.rq.u_l, &l4->srv_addr);
|
|
test->i = ntohs(((struct sockaddr_in *)&l4->srv_addr)->sin_port);
|
|
|
|
if (px->options & PR_O_HTTP_PROXY)
|
|
l4->flags |= SN_ADDR_SET;
|
|
|
|
test->flags = ACL_TEST_F_READ_ONLY;
|
|
return 1;
|
|
}
|
|
|
|
/* 5. Check on HTTP header. A pointer to the beginning of the value is returned.
|
|
* This generic function is used by both acl_fetch_chdr() and acl_fetch_shdr().
|
|
*/
|
|
static int
|
|
acl_fetch_hdr(struct proxy *px, struct session *l4, void *l7, char *sol,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
struct hdr_idx *idx = &txn->hdr_idx;
|
|
struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (!(test->flags & ACL_TEST_F_FETCH_MORE))
|
|
/* search for header from the beginning */
|
|
ctx->idx = 0;
|
|
|
|
if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
|
|
test->flags |= ACL_TEST_F_FETCH_MORE;
|
|
test->flags |= ACL_TEST_F_VOL_HDR;
|
|
test->len = ctx->vlen;
|
|
test->ptr = (char *)ctx->line + ctx->val;
|
|
return 1;
|
|
}
|
|
|
|
test->flags &= ~ACL_TEST_F_FETCH_MORE;
|
|
test->flags |= ACL_TEST_F_VOL_HDR;
|
|
return 0;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_chdr(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
return acl_fetch_hdr(px, l4, txn, txn->req.sol, expr, test);
|
|
}
|
|
|
|
static int
|
|
acl_fetch_shdr(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
return acl_fetch_hdr(px, l4, txn, txn->rsp.sol, expr, test);
|
|
}
|
|
|
|
/* 6. Check on HTTP header count. The number of occurrences is returned.
|
|
* This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
|
|
*/
|
|
static int
|
|
acl_fetch_hdr_cnt(struct proxy *px, struct session *l4, void *l7, char *sol,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
struct hdr_idx *idx = &txn->hdr_idx;
|
|
struct hdr_ctx ctx;
|
|
int cnt;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
ctx.idx = 0;
|
|
cnt = 0;
|
|
while (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, &ctx))
|
|
cnt++;
|
|
|
|
test->i = cnt;
|
|
test->flags = ACL_TEST_F_VOL_HDR;
|
|
return 1;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_chdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
return acl_fetch_hdr_cnt(px, l4, txn, txn->req.sol, expr, test);
|
|
}
|
|
|
|
static int
|
|
acl_fetch_shdr_cnt(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
return acl_fetch_hdr_cnt(px, l4, txn, txn->rsp.sol, expr, test);
|
|
}
|
|
|
|
/* 7. Check on HTTP header's integer value. The integer value is returned.
|
|
* FIXME: the type is 'int', it may not be appropriate for everything.
|
|
* This generic function is used by both acl_fetch_chdr* and acl_fetch_shdr*.
|
|
*/
|
|
static int
|
|
acl_fetch_hdr_val(struct proxy *px, struct session *l4, void *l7, char *sol,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
struct hdr_idx *idx = &txn->hdr_idx;
|
|
struct hdr_ctx *ctx = (struct hdr_ctx *)test->ctx.a;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (!(test->flags & ACL_TEST_F_FETCH_MORE))
|
|
/* search for header from the beginning */
|
|
ctx->idx = 0;
|
|
|
|
if (http_find_header2(expr->arg.str, expr->arg_len, sol, idx, ctx)) {
|
|
test->flags |= ACL_TEST_F_FETCH_MORE;
|
|
test->flags |= ACL_TEST_F_VOL_HDR;
|
|
test->i = strl2ic((char *)ctx->line + ctx->val, ctx->vlen);
|
|
return 1;
|
|
}
|
|
|
|
test->flags &= ~ACL_TEST_F_FETCH_MORE;
|
|
test->flags |= ACL_TEST_F_VOL_HDR;
|
|
return 0;
|
|
}
|
|
|
|
static int
|
|
acl_fetch_chdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
return acl_fetch_hdr_val(px, l4, txn, txn->req.sol, expr, test);
|
|
}
|
|
|
|
static int
|
|
acl_fetch_shdr_val(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
return acl_fetch_hdr_val(px, l4, txn, txn->rsp.sol, expr, test);
|
|
}
|
|
|
|
/* 8. Check on URI PATH. A pointer to the PATH is stored. The path starts at
|
|
* the first '/' after the possible hostname, and ends before the possible '?'.
|
|
*/
|
|
static int
|
|
acl_fetch_path(struct proxy *px, struct session *l4, void *l7, int dir,
|
|
struct acl_expr *expr, struct acl_test *test)
|
|
{
|
|
struct http_txn *txn = l7;
|
|
char *ptr, *end;
|
|
|
|
if (!txn)
|
|
return 0;
|
|
|
|
if (txn->req.msg_state != HTTP_MSG_BODY)
|
|
return 0;
|
|
|
|
if (txn->rsp.msg_state != HTTP_MSG_RPBEFORE)
|
|
/* ensure the indexes are not affected */
|
|
return 0;
|
|
|
|
end = txn->req.sol + txn->req.sl.rq.u + txn->req.sl.rq.u_l;
|
|
ptr = http_get_path(txn);
|
|
if (!ptr)
|
|
return 0;
|
|
|
|
/* OK, we got the '/' ! */
|
|
test->ptr = ptr;
|
|
|
|
while (ptr < end && *ptr != '?')
|
|
ptr++;
|
|
|
|
test->len = ptr - test->ptr;
|
|
|
|
/* we do not need to set READ_ONLY because the data is in a buffer */
|
|
test->flags = ACL_TEST_F_VOL_1ST;
|
|
return 1;
|
|
}
|
|
|
|
|
|
|
|
/************************************************************************/
|
|
/* All supported keywords must be declared here. */
|
|
/************************************************************************/
|
|
|
|
/* Note: must not be declared <const> as its list will be overwritten */
|
|
static struct acl_kw_list acl_kws = {{ },{
|
|
{ "method", acl_parse_meth, acl_fetch_meth, acl_match_meth, ACL_USE_L7REQ_PERMANENT },
|
|
{ "req_ver", acl_parse_ver, acl_fetch_rqver, acl_match_str, ACL_USE_L7REQ_VOLATILE },
|
|
{ "resp_ver", acl_parse_ver, acl_fetch_stver, acl_match_str, ACL_USE_L7RTR_VOLATILE },
|
|
{ "status", acl_parse_int, acl_fetch_stcode, acl_match_int, ACL_USE_L7RTR_PERMANENT },
|
|
|
|
{ "url", acl_parse_str, acl_fetch_url, acl_match_str, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_beg", acl_parse_str, acl_fetch_url, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_end", acl_parse_str, acl_fetch_url, acl_match_end, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_sub", acl_parse_str, acl_fetch_url, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_dir", acl_parse_str, acl_fetch_url, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_dom", acl_parse_str, acl_fetch_url, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_reg", acl_parse_reg, acl_fetch_url, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_ip", acl_parse_ip, acl_fetch_url_ip, acl_match_ip, ACL_USE_L7REQ_VOLATILE },
|
|
{ "url_port", acl_parse_int, acl_fetch_url_port, acl_match_int, ACL_USE_L7REQ_VOLATILE },
|
|
|
|
/* note: we should set hdr* to use ACL_USE_HDR_VOLATILE, and chdr* to use L7REQ_VOLATILE */
|
|
{ "hdr", acl_parse_str, acl_fetch_chdr, acl_match_str, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_reg", acl_parse_reg, acl_fetch_chdr, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_beg", acl_parse_str, acl_fetch_chdr, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_end", acl_parse_str, acl_fetch_chdr, acl_match_end, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_sub", acl_parse_str, acl_fetch_chdr, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_dir", acl_parse_str, acl_fetch_chdr, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_dom", acl_parse_str, acl_fetch_chdr, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_cnt", acl_parse_int, acl_fetch_chdr_cnt,acl_match_int, ACL_USE_L7REQ_VOLATILE },
|
|
{ "hdr_val", acl_parse_int, acl_fetch_chdr_val,acl_match_int, ACL_USE_L7REQ_VOLATILE },
|
|
|
|
{ "shdr", acl_parse_str, acl_fetch_shdr, acl_match_str, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_reg", acl_parse_reg, acl_fetch_shdr, acl_match_reg, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_beg", acl_parse_str, acl_fetch_shdr, acl_match_beg, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_end", acl_parse_str, acl_fetch_shdr, acl_match_end, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_sub", acl_parse_str, acl_fetch_shdr, acl_match_sub, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_dir", acl_parse_str, acl_fetch_shdr, acl_match_dir, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_dom", acl_parse_str, acl_fetch_shdr, acl_match_dom, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_cnt", acl_parse_int, acl_fetch_shdr_cnt,acl_match_int, ACL_USE_L7RTR_VOLATILE },
|
|
{ "shdr_val", acl_parse_int, acl_fetch_shdr_val,acl_match_int, ACL_USE_L7RTR_VOLATILE },
|
|
|
|
{ "path", acl_parse_str, acl_fetch_path, acl_match_str, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_reg", acl_parse_reg, acl_fetch_path, acl_match_reg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_beg", acl_parse_str, acl_fetch_path, acl_match_beg, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_end", acl_parse_str, acl_fetch_path, acl_match_end, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_sub", acl_parse_str, acl_fetch_path, acl_match_sub, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_dir", acl_parse_str, acl_fetch_path, acl_match_dir, ACL_USE_L7REQ_VOLATILE },
|
|
{ "path_dom", acl_parse_str, acl_fetch_path, acl_match_dom, ACL_USE_L7REQ_VOLATILE },
|
|
|
|
{ NULL, NULL, NULL, NULL },
|
|
|
|
#if 0
|
|
{ "line", acl_parse_str, acl_fetch_line, acl_match_str },
|
|
{ "line_reg", acl_parse_reg, acl_fetch_line, acl_match_reg },
|
|
{ "line_beg", acl_parse_str, acl_fetch_line, acl_match_beg },
|
|
{ "line_end", acl_parse_str, acl_fetch_line, acl_match_end },
|
|
{ "line_sub", acl_parse_str, acl_fetch_line, acl_match_sub },
|
|
{ "line_dir", acl_parse_str, acl_fetch_line, acl_match_dir },
|
|
{ "line_dom", acl_parse_str, acl_fetch_line, acl_match_dom },
|
|
|
|
{ "cook", acl_parse_str, acl_fetch_cook, acl_match_str },
|
|
{ "cook_reg", acl_parse_reg, acl_fetch_cook, acl_match_reg },
|
|
{ "cook_beg", acl_parse_str, acl_fetch_cook, acl_match_beg },
|
|
{ "cook_end", acl_parse_str, acl_fetch_cook, acl_match_end },
|
|
{ "cook_sub", acl_parse_str, acl_fetch_cook, acl_match_sub },
|
|
{ "cook_dir", acl_parse_str, acl_fetch_cook, acl_match_dir },
|
|
{ "cook_dom", acl_parse_str, acl_fetch_cook, acl_match_dom },
|
|
{ "cook_pst", acl_parse_none, acl_fetch_cook, acl_match_pst },
|
|
|
|
{ "auth_user", acl_parse_str, acl_fetch_user, acl_match_str },
|
|
{ "auth_regex", acl_parse_reg, acl_fetch_user, acl_match_reg },
|
|
{ "auth_clear", acl_parse_str, acl_fetch_auth, acl_match_str },
|
|
{ "auth_md5", acl_parse_str, acl_fetch_auth, acl_match_md5 },
|
|
{ NULL, NULL, NULL, NULL },
|
|
#endif
|
|
}};
|
|
|
|
|
|
__attribute__((constructor))
|
|
static void __http_protocol_init(void)
|
|
{
|
|
acl_register_keywords(&acl_kws);
|
|
}
|
|
|
|
|
|
/*
|
|
* Local variables:
|
|
* c-indent-level: 8
|
|
* c-basic-offset: 8
|
|
* End:
|
|
*/
|